Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Pipobroman: Difference between pages
(Difference between pages)
Content deleted Content added
Saving copy of the {{drugbox}} taken from revid 447585415 of page Pipobroman for the Chem/Drugbox validation project (updated: 'DrugBank'). |
Sweeetlemon (talk | contribs) m combined the 2 sentences as one of them was too small |
||
| Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:Pipobroman|oldid=447585415}} 447585415] of page [[Pipobroman]] with values updated to verified values.}} |
|||
{{Drugbox |
{{Drugbox |
||
| verifiedrevid = |
| verifiedrevid = 464207677 |
||
| IUPAC_name = 3-bromo-1-[4-(3-bromopropanoyl) piperazin-1-yl]-propan-1-one |
| IUPAC_name = 3-bromo-1-[4-(3-bromopropanoyl) piperazin-1-yl]-propan-1-one |
||
| image = Pipobroman.svg |
| image = Pipobroman.svg |
||
<!--Clinical data--> |
<!--Clinical data--> |
||
| tradename = |
| tradename = Vercite, Vercyte |
||
| Drugs.com = {{drugs.com|international|pipobroman}} |
| Drugs.com = {{drugs.com|international|pipobroman}} |
||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
||
| Line 16: | Line 15: | ||
| legal_status = |
| legal_status = |
||
| routes_of_administration = |
| routes_of_administration = |
||
<!--Pharmacokinetic data--> |
<!--Pharmacokinetic data--> |
||
| bioavailability = |
| bioavailability = |
||
| Line 23: | Line 21: | ||
| elimination_half-life = |
| elimination_half-life = |
||
| excretion = |
| excretion = |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| IUPHAR_ligand = 7271 |
|||
| |
| CAS_number_Ref = {{cascite|correct|??}} |
||
| CAS_number = 54-91-1 |
| CAS_number = 54-91-1 |
||
| ATC_prefix = L01 |
| ATC_prefix = L01 |
||
| Line 39: | Line 37: | ||
| KEGG_Ref = {{keggcite|correct|kegg}} |
| KEGG_Ref = {{keggcite|correct|kegg}} |
||
| KEGG = D00467 |
| KEGG = D00467 |
||
| ChEBI = 8242 |
|||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
||
| ChEMBL = 1585 |
| ChEMBL = 1585 |
||
<!--Chemical data--> |
<!--Chemical data--> |
||
| C=10 | H=16 | Br=2 | N=2 | O=2 |
| C=10 | H=16 | Br=2 | N=2 | O=2 |
||
| molecular_weight = 356.054 g/mol |
|||
| smiles = O=C(N1CCN(C(=O)CCBr)CC1)CCBr |
| smiles = O=C(N1CCN(C(=O)CCBr)CC1)CCBr |
||
| InChI = 1/C10H16Br2N2O2/c11-3-1-9(15)13-5-7-14(8-6-13)10(16)2-4-12/h1-8H2 |
|||
| InChIKey = NJBFOOCLYDNZJN-UHFFFAOYAD |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C10H16Br2N2O2/c11-3-1-9(15)13-5-7-14(8-6-13)10(16)2-4-12/h1-8H2 |
| StdInChI = 1S/C10H16Br2N2O2/c11-3-1-9(15)13-5-7-14(8-6-13)10(16)2-4-12/h1-8H2 |
||
| Line 53: | Line 48: | ||
| StdInChIKey = NJBFOOCLYDNZJN-UHFFFAOYSA-N |
| StdInChIKey = NJBFOOCLYDNZJN-UHFFFAOYSA-N |
||
}} |
}} |
||
'''Pipobroman''' (trade names '''Vercite''', '''Vercyte''') is an anti-cancer drug that probably acts as an [[alkylating antineoplastic agent|alkylating agent]],<ref>{{cite journal | vauthors = Passamonti F, Lazzarino M | title = Treatment of polycythemia vera and essential thrombocythemia: the role of pipobroman | journal = Leukemia & Lymphoma | volume = 44 | issue = 9 | pages = 1483–8 | date = September 2003 | pmid = 14565648 | doi = 10.3109/10428190309178768 }}</ref> and is marketed in France and Italy.<ref>{{cite web | work = Drugs.com | url = https://www.drugs.com/international/pipobroman.html | title = Pipobroman }}</ref> |
|||
== References == |
|||
{{reflist}} |
|||
{{Chemotherapeutic agents}} |
|||
[[Category:Alkylating antineoplastic agents]] |
|||
[[Category:Organobromides]] |
|||
[[Category:Carboxamides]] |
|||
[[Category:Piperazines]] |
|||
{{antineoplastic-drug-stub}} |
|||