Prednicarbate: Difference between revisions

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
+{{Short description|Chemical compound}}
-{{drugbox
+{{Drugbox
-| verifiedrevid = 379587793
+| Verifiedfields = changed
-| IUPAC_name = (11β)-17-[(ethoxycarbonyl)oxy]-11-hydroxy-3,20-dioxopregna-1,4-dien-21-yl propionate
+| Watchedfields = changed
-|synonyms = <small>[2-[(8''S'',9''S'',10''R'',11''S'',13''S'',14''S'',17''R'')-17-ethoxycarbonyloxy-11-hydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6''H''-cyclopenta[''a'']phenanthren-17-yl]-2-oxoethyl] propanoate</small>
+| verifiedrevid = 396722627
+| IUPAC_name = 17-[(Ethoxycarbonyl)oxy]-11β-hydroxy-3,20-dioxopregna-1,4-dien-21-yl propionate
 | image = Prednicarbate.png
+| width = 250px
-| CASNo_Ref = {{cascite}}
-| CAS_number = 73771-04-7
+<!--Clinical data-->
-| ATC_prefix = D07
-| ATC_suffix = AC18
+| tradename =
+| Drugs.com = {{drugs.com|monograph|prednicarbate}}
-| ATC_supplemental =
-| PubChem = 6714002
+| MedlinePlus = a604021
-| DrugBank = APRD01197
-| C=27 | H=36 | O=8
-| molecular_weight = 488.57 g/mol
-| bioavailability =
-| protein_bound =
-| metabolism =
-| elimination_half-life =
-| excretion =
 | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
 | pregnancy_US = <!-- A / B / C / D / X -->
 | pregnancy_category =
 | legal_AU = <!-- Unscheduled / S2 / S4 / S8 -->
 | legal_UK = <!-- GSL / P / POM / CD -->
 | legal_US = <!-- OTC / Rx-only -->
 | legal_status =
 | routes_of_administration = [[Topical]]
+<!--Pharmacokinetic data-->
+| bioavailability =
+| protein_bound =
+| metabolism =
+| elimination_half-life =
+| excretion =
+<!--Identifiers-->
+| IUPHAR_ligand = 7605
+| CAS_number_Ref = {{cascite|correct|??}}
+| CAS_number = 73771-04-7
+| ATC_prefix = D07
+| ATC_suffix = AC18
+| ATC_supplemental =
+| PubChem = 6714002
+| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
+| DrugBank = DB01130
+| UNII_Ref = {{fdacite|changed|FDA}}
+| UNII = V901LV1K7D
+| ChEMBL_Ref = {{ebicite|changed|EBI}}
+| ChEMBL = 1200386
+| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
+| ChemSpiderID = 5145991
+| smiles = O=C(OCC(=O)[C@@]1(OC(=O)OCC)CC[C@H]2[C@H]4[C@H]([C@@H](O)C[C@]12C)[C@]/3(/C=C\C(=O)\C=C\3CC4)C)CC
+| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
+| StdInChI = 1S/C27H36O8/c1-5-22(31)34-15-21(30)27(35-24(32)33-6-2)12-10-19-18-8-7-16-13-17(28)9-11-25(16,3)23(18)20(29)14-26(19,27)4/h9,11,13,18-20,23,29H,5-8,10,12,14-15H2,1-4H3/t18-,19-,20-,23+,25-,26-,27-/m0/s1
+| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
+| StdInChIKey = FNPXMHRZILFCKX-KAJVQRHHSA-N
+<!--Chemical data-->
+| C=27 | H=36 | O=8
+| synonyms = <small>{2-[(8''S'',9''S'',10''R'',11''S'',13''S'',14''S'',17''R'')-17-ethoxycarbonyloxy-11-hydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6''H''-cyclopenta[''a'']phenanthren-17-yl]-2-oxoethyl} propanoate</small>
 }}
-'''Prednicarbate''' is a relatively new [[topical]] [[corticosteroid]] drug. It is similar in potency to [[hydrocortisone]]. Compared to other topical corticosteroids, like [[betamethasone]], repeated prednicarbate use does not cause [[skin]] [[atrophy]] as quickly.{{Fact|date=September 2008}} Corticosteroids have always been an important part of the pharmacological arsenal of [[dermatology]]; however, their tendency to produce side-effects has caused the need to search for new preparations.
+'''Prednicarbate''' is a relatively new [[topical]] [[corticosteroid]] drug. It is similar in potency to [[hydrocortisone]]. Corticosteroids have always been an important part of the pharmacological arsenal of [[dermatology]]; however, their tendency to produce side-effects has caused the need to search for new preparations.<ref>{{cite book|url=https://books.google.com/books?id=4-MjAQAAMAAJ|title=United States Pharmacopeia, the National Formulary|publisher=United States Pharmacopeial Convention, Incorporated|year=2008|isbn=978-1-889788-53-1|page=3060}}</ref>
-It is nonhalogenated.<ref name="pmid15657633">{{cite journal |author=Gupta AK, Chow M |title=A review of prednicarbate (Dermatop) |journal=Skin Therapy Lett. |volume=9 |issue=10 |pages=5–6, 9 |year=2004 |pmid=15657633 |doi= |url=http://www.skintherapyletter.com/2004/9.10/2.html}}</ref>
+It is nonhalogenated.<ref name="pmid15657633">{{cite journal |vauthors=Gupta AK, Chow M |title=A review of prednicarbate (Dermatop) |journal=Skin Therapy Lett. |volume=9 |issue=10 |pages=5–6, 9 |year=2004 |pmid=15657633 |url=http://www.skintherapyletter.com/2004/9.10/2.html}}</ref>
 ==References==
+<references />
-{{reflist}}
+{{Glucocorticoids}}
+{{Glucocorticoidics}}
-{{Corticosteroids}}
+[[Category:Corticosteroid esters]]
 [[Category:Corticosteroids]]
-[[Category:Propionates]]
+[[Category:Propionate esters]]
 [[Category:Carbonate esters]]
+[[Category:Ethyl esters]]
 {{dermatologic-drug-stub}}
-[[ru:Предникарбат]]
-[[uk:Преднікарбат]]