S-17092: Difference between revisions
Appearance
Content deleted Content added
Updating {{drugbox}} (changes to watched fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per [[Wikipedia:WikiProject Chemicals/Chembox validation|Chem/Drugbox valida |
Entranced98 (talk | contribs) Importing Wikidata short description: "Chemical compound" |
||
(24 intermediate revisions by 18 users not shown) | |||
Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
⚫ | |||
{{drugbox |
|||
⚫ | |||
| Verifiedfields = changed |
|||
| |
|||
⚫ | |||
⚫ | |||
| IUPAC_name = [(2S,3aS,7aS)-1([(R,R)-2-phenylcyclopropyl]- |
| IUPAC_name = [(2S,3aS,7aS)-1([(R,R)-2-phenylcyclopropyl]- |
||
carbonyl)-2-([thiazolidin-3-yl]carbonyl)octahydro-1H-indole |
carbonyl)-2-([thiazolidin-3-yl]carbonyl)octahydro-1H-indole |
||
| image = S- |
| image = S-17092.svg |
||
| width = |
| width = 250 |
||
| CAS_number_Ref = {{cascite|correct|??}} |
|||
| CAS_number = |
| CAS_number = |
||
| ATC_prefix = |
| ATC_prefix = |
||
| ATC_suffix = |
| ATC_suffix = |
||
| PubChem = 9977327 |
| PubChem = 9977327 |
||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|||
| DrugBank = |
| DrugBank = |
||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
⚫ | |||
| UNII = 8W5MLJ83KU |
|||
| molecular_weight = 384.486 g/mol |
|||
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|||
| smiles = C5CCCN5C(=O)C1CC3CCCCC3N1C(=O)C2CC2c(cc4)ccc4F |
|||
| ChemSpiderID = 8152919 |
|||
| smiles = O=C(N1CCCC1)[C@H]4N(C(=O)[C@H]3[C@H](c2ccc(F)cc2)C3)[C@H]5CCCC[C@H]5C4 |
|||
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChI = 1S/C23H29FN2O2/c24-17-9-7-15(8-10-17)18-14-19(18)22(27)26-20-6-2-1-5-16(20)13-21(26)23(28)25-11-3-4-12-25/h7-10,16,18-21H,1-6,11-14H2/t16-,18-,19+,20-,21-/m0/s1 |
|||
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChIKey = JNUXCIMICQKTPX-RQUKQETFSA-N |
|||
⚫ | |||
| bioavailability = |
| bioavailability = |
||
| protein_bound = |
| protein_bound = |
||
<gallery> |
|||
File:Example.jpg|Caption1 |
|||
File:Example.jpg|Caption2 |
|||
</gallery> |
|||
| metabolism = |
| metabolism = |
||
| elimination_half-life = |
| elimination_half-life = |
||
| excretion = |
| excretion = |
||
| pregnancy_AU = <!-- A |
| pregnancy_AU = <!-- A, B1, B2, B3, C, D, X --> |
||
| pregnancy_US = <!-- A |
| pregnancy_US = <!-- A, B, C, D, X --> |
||
| pregnancy_category= |
| pregnancy_category= |
||
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
||
| legal_CA = <!-- Schedule I --> |
| legal_CA = <!-- Schedule I --> |
||
| legal_UK = <!-- Class A --> |
| legal_UK = <!-- Class A --> |
||
| legal_US |
| legal_US = Investigational New Drug |
||
| legal_status |
| legal_status = |
||
| routes_of_administration = |
| routes_of_administration = |
||
}} |
}} |
||
'''S-17092''' is a drug which acts as a selective [[enzyme inhibition|inhibitor]] of the enzyme [[ |
'''S-17092''' is a drug which acts as a selective [[enzyme inhibition|inhibitor]] of the enzyme [[prolyl endopeptidase]].<ref>{{cite journal | vauthors = Barelli H, Petit A, Hirsch E, Wilk S, De Nanteuil G, Morain P, Checler F | title = S 17092-1, a highly potent, specific and cell permeant inhibitor of human proline endopeptidase | journal = Biochemical and Biophysical Research Communications | volume = 257 | issue = 3 | pages = 657–61 | date = April 1999 | pmid = 10208839 | doi = 10.1006/bbrc.1999.0366 }}</ref> This enzyme is involved in the metabolic breakdown of a number of [[neuropeptide]] [[neurotransmitter]]s in the brain,<ref>{{cite journal | vauthors = Bellemère G, Morain P, Vaudry H, Jégou S | title = Effect of S 17092, a novel prolyl endopeptidase inhibitor, on substance P and alpha-melanocyte-stimulating hormone breakdown in the rat brain | journal = Journal of Neurochemistry | volume = 84 | issue = 5 | pages = 919–29 | date = March 2003 | pmid = 12603817 | doi = 10.1046/j.1471-4159.2003.01536.x | s2cid = 24773419 }}</ref><ref>{{cite journal | vauthors = Bellemère G, Vaudry H, Morain P, Jégou S | title = Effect of prolyl endopeptidase inhibition on arginine-vasopressin and thyrotrophin-releasing hormone catabolism in the rat brain | journal = Journal of Neuroendocrinology | volume = 17 | issue = 5 | pages = 306–13 | date = May 2005 | pmid = 15869566 | doi = 10.1111/j.1365-2826.2005.01308.x | s2cid = 9129184 }}</ref> and so inhibiting the action of the enzyme increases the activity of these neuropeptides. This produces [[nootropic]] effects which make S-17092 a promising and novel treatment for neurodegenerative conditions such as [[Alzheimer's disease]] and [[Parkinson's disease]].<ref>{{cite journal | vauthors = Morain P, Lestage P, De Nanteuil G, Jochemsen R, Robin JL, Guez D, Boyer PA | title = S 17092: a prolyl endopeptidase inhibitor as a potential therapeutic drug for memory impairment. Preclinical and clinical studies | journal = CNS Drug Reviews | volume = 8 | issue = 1 | pages = 31–52 | pmid = 12070525 | pmc = 6741683 | year = 2002 | doi = 10.1111/j.1527-3458.2002.tb00214.x }}</ref><ref>{{cite journal | vauthors = Morain P, Boeijinga PH, Demazières A, De Nanteuil G, Luthringer R | title = Psychotropic profile of S 17092, a prolyl endopeptidase inhibitor, using quantitative EEG in young healthy volunteers | journal = Neuropsychobiology | volume = 55 | issue = 3–4 | pages = 176–83 | pmid = 17700042 | doi = 10.1159/000107070 | year = 2007 | s2cid = 27856130 }}</ref> |
||
==See also== |
== See also == |
||
* [[C16 (PKR inhibitor)]] |
|||
* [[UK-414,495]] |
* [[UK-414,495]] |
||
==References== |
== References == |
||
{{reflist}} |
{{reflist}} |
||
⚫ | |||
{{Psychostimulants, agents used for ADHD and nootropics}} |
|||
⚫ | |||
[[Category:Nootropics]] |
[[Category:Nootropics]] |
||
[[Category: |
[[Category:Carboxamides]] |
||
[[Category:Indoles]] |
[[Category:Indoles]] |
||
[[Category:Thiazolidines]] |
[[Category:Thiazolidines]] |