SB-205384: Difference between revisions

{{drugbox

| IUPAC_name = but-2-ynyl 4-amino-7-hydroxy-2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[3,2-e]pyridine-3-carboxylate

| image = SB-205384.png

| width = 250

| CAS_number = 160296-13-9

| ATC_prefix =

| ATC_suffix =

| PubChem = 197690

| DrugBank =

| C=17|H=18|N=2|O=3|S=1

| molecular_weight = 330.401 g/mol

| smiles = CC#CCOC(=O)c1c(C)nc2sc3CC(O)CCc3c2c1N

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->

| pregnancy_US = <!-- A / B / C / D / X -->

| pregnancy_category=

| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->

| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->

| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->

| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->

| legal_status = Investigational New Drug

| routes_of_administration =

'''SB-205,384''' is an [[anxiolytic]] drug. It has similar effects to [[benzodiazepine]] drugs, but is structurally distinct and so is classed as a [[nonbenzodiazepine]] anxiolytic.

SB-205,384 is a subtype selective [[GABAA receptor|GABA_A]] [[partial agonist]], which binds preferentially to the α3 subtype.<ref>{{cite journal | last1 = Meadows | first1 = HJ | last2 = Kumar | first2 = CS | last3 = Pritchett | first3 = DB | last4 = Blackburn | first4 = TP | last5 = Benham | first5 = CD | title = SB-205384: a GABA(A) receptor modulator with novel mechanism of action that shows subunit selectivity | journal = British journal of pharmacology | volume = 123 | issue = 6 | pages = 1253–9 | year = 1998 | pmid = 9559912 | pmc = 1565273 | doi = 10.1038/sj.bjp.0701721 }}</ref> It has a novel mechanism of action, prolonging the duration of GABA-mediated chloride flux but without increasing the intensity of the response, and this may give it an unusual pharmacological profile,<ref>{{cite journal | last1 = Meadows | first1 = HJ | last2 = Harries | first2 = MH | last3 = Thompson | first3 = M | last4 = Benham | first4 = CD | title = Effect of SB-205384 on the decay of GABA-activated chloride currents in granule cells cultured from rat cerebellum | journal = British journal of pharmacology | volume = 121 | issue = 7 | pages = 1334–8 | year = 1997 | pmid = 9257911 | pmc = 1564816 | doi = 10.1038/sj.bjp.0701251 }}</ref> with tests showing that it alters the firing of some populations of neurons while leaving others unaffected.<ref>{{cite journal | last1 = Ing | first1 = T | last2 = Poulter | first2 = MO | title = Diversity of GABA(A) receptor synaptic currents on individual pyramidal cortical neurons | journal = The European journal of neuroscience | volume = 25 | issue = 3 | pages = 723–34 | year = 2007 | pmid = 17313570 | doi = 10.1111/j.1460-9568.2007.05331.x }}</ref> Animal studies have shown it to produce both anxiolytic and anti-aggressive effects, but with little sedation or other behavioural changes.<ref>{{cite journal | last1 = Navarro | first1 = JF | last2 = Burón | first2 = E | last3 = Martín-López | first3 = M | title = Anxiolytic-like activity of SB-205384 in the elevated plus-maze test in mice | journal = Psicothema | volume = 18 | issue = 1 | pages = 100–4 | year = 2006 | pmid = 17296016 }}</ref><ref>{{cite journal | last1 = Navarro | first1 = JF | last2 = Burón | first2 = E | last3 = Martín-López | first3 = M | title = Effects of SB-205384, a positive modulator of alpha3-subunit-containing GABA-A receptors, on isolation-induced aggression in male mice | journal = Psicothema | volume = 20 | issue = 1 | pages = 144–7 | year = 2008 | pmid = 18206077 }}</ref>

<references />

[[Category:Alkynes]]

[[Category:Alcohols]]

{{nervous-system-drug-stub}}