Sulfamazone: Difference between revisions
Appearance
Content deleted Content added
Updating {{drugbox}} (changes to verified fields - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Wikipedia:WikiProject Chemicals/Chembox validation|Chem/Drugbox validation |
Entranced98 (talk | contribs) Importing Wikidata short description: "Chemical compound" |
||
(16 intermediate revisions by 13 users not shown) | |||
Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{drugbox |
|||
{{more citations needed|date=April 2022}} |
|||
| Verifiedfields = changed |
|||
{{Drugbox |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
| alt = Skeletal formula of sulfamazone |
|||
⚫ | |||
| width |
| width = 300 |
||
| image2 = Sulfamazone-3D-spacefill.png |
|||
⚫ | |||
| alt2 = Space-filling model of the sulfamazone molecule |
|||
⚫ | |||
<!--Clinical data--> |
|||
⚫ | |||
| tradename = |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
<!--Pharmacokinetic data--> |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
<!--Identifiers--> |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
||
| DrugBank |
| DrugBank = |
||
| ChEBI = 131721 |
|||
| ChEMBL = 2104921 |
|||
⚫ | |||
⚫ | |||
| KEGG_Ref = {{keggcite|correct|kegg}} |
| KEGG_Ref = {{keggcite|correct|kegg}} |
||
| KEGG = D07241 |
| KEGG = D07241 |
||
| ChemSpiderID = 163211 |
|||
⚫ | |||
| smiles = CC1=C(C(=O)N(N1C)C2=CC=CC=C2)C(NC3=CC=C(C=C3)S(=O)(=O)NC4=NN=C(C=C4)OC)S(=O)(=O)O |
|||
| molecular_weight = 560.602 g/mol |
|||
| StdInChI = 1S/C23H24N6O7S2/c1-15-21(23(30)29(28(15)2)17-7-5-4-6-8-17)22(38(33,34)35)24-16-9-11-18(12-10-16)37(31,32)27-19-13-14-20(36-3)26-25-19/h4-14,22,24H,1-3H3,(H,25,27)(H,33,34,35) |
|||
⚫ | |||
| StdInChIKey = BGLHAKAJGYLSOX-UHFFFAOYSA-N |
|||
⚫ | |||
<!--Chemical data--> |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
}} |
}} |
||
'''Sulfamazone''' ([[International Nonproprietary Name|INN]]) is a [[sulfonamide (medicine)|sulfonamide]] [[antibiotic]] with [[antipyretic]] properties. |
|||
'''Sulfamazone''' ([[International Nonproprietary Name|INN]]) is a [[sulfonamide (medicine)|sulfonamide]] [[antibiotic]] with [[antipyretic]] properties.<ref>{{cite journal | vauthors = Zhao Z, Dai X, Li C, Wang X, Tian J, Feng Y, Xie J, Ma C, Nie Z, Fan P, Qian M, He X, Wu S, Zhang Y, Zheng X | display-authors = 6 | title = Pyrazolone structural motif in medicinal chemistry: Retrospect and prospect | journal = European Journal of Medicinal Chemistry | volume = 186 | pages = 111893 | date = January 2020 | pmid = 31761383 | pmc = 7115706 | doi = 10.1016/j.ejmech.2019.111893 }}</ref> |
|||
⚫ | |||
== References == |
|||
⚫ | |||
{{Reflist}} |
|||
⚫ | |||
[[Category:Sulfonamide antibiotics]] |
[[Category:Sulfonamide antibiotics]] |
||
Line 42: | Line 58: | ||
[[Category:Pyridazines]] |
[[Category:Pyridazines]] |
||
[[Category:Sulfonic acids]] |
[[Category:Sulfonic acids]] |
||
⚫ |