Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Sulfametoxydiazine: Difference between pages
Appearance
(Difference between pages)
Content deleted Content added
Saving copy of the {{drugbox}} taken from revid 456843904 of page Sulfametoxydiazine for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number'). |
ce |
||
Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:Sulfametoxydiazine|oldid=456843904}} 456843904] of page [[Sulfametoxydiazine]] with values updated to verified values.}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
| Verifiedfields = changed |
||
⚫ | |||
| Watchedfields = changed |
|||
⚫ | |||
| IUPAC_name = 4-amino-''N''-(5-methoxy-2-pyrimidinyl)benzenesulfonamide |
| IUPAC_name = 4-amino-''N''-(5-methoxy-2-pyrimidinyl)benzenesulfonamide |
||
| image = Sulfametoxydiazine.svg |
| image = Sulfametoxydiazine.svg |
||
Line 27: | Line 26: | ||
<!--Identifiers--> |
<!--Identifiers--> |
||
| CAS_number_Ref = {{cascite| |
| CAS_number_Ref = {{cascite|changed|??}} |
||
| CAS_number = |
| CAS_number = 651-06-9 |
||
| ATC_prefix = J01 |
| ATC_prefix = J01 |
||
| ATC_suffix = ED04 |
| ATC_suffix = ED04 |
||
Line 36: | Line 35: | ||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 5135 |
| ChemSpiderID = 5135 |
||
| NIAID_ChemDB = 008164 |
|||
| UNII_Ref = {{fdacite| |
| UNII_Ref = {{fdacite|correct|FDA}} |
||
| UNII = 3L179F09D6 |
| UNII = 3L179F09D6 |
||
| KEGG_Ref = {{keggcite|correct|kegg}} |
| KEGG_Ref = {{keggcite|correct|kegg}} |
||
| KEGG = D02517 |
| KEGG = D02517 |
||
| ChEBI_Ref = {{ebicite| |
| ChEBI_Ref = {{ebicite|correct|EBI}} |
||
| ChEBI = 53727 |
| ChEBI = 53727 |
||
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
||
| ChEMBL = |
| ChEMBL = 1200359 |
||
<!--Chemical data--> |
|||
| C=11 | H=12 | N=4 | O=3 | S=1 |
| C=11 | H=12 | N=4 | O=3 | S=1 |
||
| molecular_weight = 280.303 g/mol |
|||
| smiles = O=S(=O)(Nc1ncc(OC)cn1)c2ccc(N)cc2 |
| smiles = O=S(=O)(Nc1ncc(OC)cn1)c2ccc(N)cc2 |
||
| InChI = 1/C11H12N4O3S/c1-18-9-6-13-11(14-7-9)15-19(16,17)10-4-2-8(12)3-5-10/h2-7H,12H2,1H3,(H,13,14,15) |
|||
| InChIKey = GPTONYMQFTZPKC-UHFFFAOYAE |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C11H12N4O3S/c1-18-9-6-13-11(14-7-9)15-19(16,17)10-4-2-8(12)3-5-10/h2-7H,12H2,1H3,(H,13,14,15) |
| StdInChI = 1S/C11H12N4O3S/c1-18-9-6-13-11(14-7-9)15-19(16,17)10-4-2-8(12)3-5-10/h2-7H,12H2,1H3,(H,13,14,15) |
||
Line 54: | Line 53: | ||
| StdInChIKey = GPTONYMQFTZPKC-UHFFFAOYSA-N |
| StdInChIKey = GPTONYMQFTZPKC-UHFFFAOYSA-N |
||
}} |
}} |
||
'''Sulfametoxydiazine''' ([[International Nonproprietary Name|INN]]) or '''sulfamethoxydiazine''' ([[United States Adopted Name|USAN]]: '''sulfameter''') is a long-acting [[sulfonamide (medicine)|sulfonamide]] [[antibacterial]].<ref name=":0">{{cite journal | vauthors = Wu Y, Yu S, Yu F, Yan N, Qu L, Zhang H | title = Chemiluminescence enzyme immunoassay for the determination of sulfamethoxydiazine | journal = Spectrochimica Acta Part A | volume = 81 | issue = 1 | pages = 544–547 | date = October 2011 | doi = 10.1016/j.saa.2011.06.047 | pmid = 21795101 | bibcode = 2011AcSpA..81..544W }}</ref> It is used as a [[leprostatic agent]] and in the treatment of [[urinary tract infection]]s.<ref>{{cite journal | vauthors = Burros HM, Gillenwater JY | title = Clinical Experience with Sulfamethoxydiazine* in Urinary Tract Infections | journal = The Journal of Urology | volume = 94 | issue = 1 | pages = 86–88 | date = July 1965 | pmid = 14319481 | doi = 10.1016/S0022-5347(17)63576-6 }}</ref> |
|||
Sulfamethoxydiazine is also used to treat and prevent diseases in animals. Because of its relatively long persistence, sulfamethoxydiazine residue can be detected in meat, dairy, and eggs, and is considered hazardous to human health. The United States and Japan both prohibit sulfamethoxydiazine residue in food, whereas the [[Codex Alimentarius Commission]] states that the maximum limit for sulfonamides in animal tissues is 100 μg/kg.<ref name=":0" /> |
|||
== References == |
|||
{{Reflist}} |
|||
{{Sulfonamides and trimethoprim}} |
|||
{{Antimycobacterials}} |
|||
[[Category:Pyrimidines]] |
|||
[[Category:Sulfonamide antibiotics]] |
|||
[[Category:Phenol ethers]] |
|||
{{antiinfective-drug-stub}} |