Vinburnine: Difference between revisions

{{Short description|Chemical compound}}

| Watchedfields = changed

| verifiedrevid = 409095415

| IUPAC_name = (3α,16α)-14,15-Dihydroeburnamenin-14-one

| image = (all-S)-(–)-Vinburnine Formula V1.svg

<!--Clinical data-->

| tradename =

| Drugs.com = {{drugs.com|international|vinburnine}}

| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->

| pregnancy_US = <!-- A / B / C / D / X -->

| pregnancy_category =

| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->

| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->

| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->

| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->

| legal_status =

| routes_of_administration =

<!--Pharmacokinetic data-->

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

<!--Identifiers-->

| IUPHAR_ligand = 345

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 4880-88-0

| ATC_prefix = C04

| ATC_suffix = AX17

| PubChem = 71203

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 64339

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = G54D0HMY25

| KEGG_Ref = {{keggcite|correct|kegg}}

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1892145

<!--Chemical data-->

| C=19 | H=22 | N=2 | O=1

| synonyms = <small>3a-Ethyl-2,3,3a,4,10,11b-hexahydro-1''H'',11''H''-5a,11a-diaza-benzo[''cd'']fluoranthen-5-one</small>

| smiles = CC[C@@]12CCCN3[C@@H]1C4=C(CC3)C5=CC=CC=C5N4C(=O)C2

| StdInChI = 1S/C19H22N2O/c1-2-19-9-5-10-20-11-8-14-13-6-3-4-7-15(13)21(16(22)12-19)17(14)18(19)20/h3-4,6-7,18H,2,5,8-12H2,1H3/t18-,19+/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI_comment =

| StdInChIKey = WYJAPUKIYAZSEM-MOPGFXCFSA-N

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

'''Vinburnine''' (or '''eburnamonine''', ''Vincamone'') is a [[vasodilator]]. Vincamone is a [[vinca alkaloid]] and a metabolite of [[vincamine]].<ref>{{cite journal | vauthors = Vereczkey L, Tamás J, Czira G, Szporny L | title = Metabolism of vincamine in the rat in vivo and in vitro | journal = Arzneimittel-Forschung | volume = 30 | issue = 11 | pages = 1860–5 | pmid = 7192994 | year = 1980 }}</ref>

== References ==

{{reflist}}

{{Xenobiotic-sensing receptor modulators}}

[[Category:Vinca alkaloids]]

[[Category:Nitrogen heterocycles]]

[[Category:Heterocyclic compounds with 5 rings]]