Jump to content

Xanthinol: Difference between revisions

Browse history interactively
Page 1
Page 2
← Previous edit
Content deleted Content added
VisualWikitext
No edit summary
m Disambiguating links to Niacin (link changed to Niacin (substance)) using DisamAssist.
 
(18 intermediate revisions by 16 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{Drugbox
{{Drugbox
| Verifiedfields = changed
⚫
| IUPAC_name = 7-[2-hydroxy-3-(2-hydroxyethyl-methylamino)propyl]-1,3-dimethylpurine-2,6-dione
| Watchedfields = changed
⚫
| image = Xanthinol.png
| verifiedrevid = 380810980
⚫
| CAS_number = 2530-97-4
⚫
| IUPAC_name = 7-[2-hydroxy-3-(2-hydroxyethyl-methylamino)propyl]-1,3-dimethylpurine-2,6-dione
⚫
| ATC_prefix = none
⚫
| image = Xanthinol.png
⚫
| ATC_suffix =

⚫
| PubChem = 9913
<!--Clinical data-->
⚫
| DrugBank = 1
| tradename =
⚫
| C=13|H=21|N=5|O=4
⚫
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| molecular_weight = 311.33 g/mol
| pregnancy_US = <!-- A / B / C / D / X -->
⚫
| bioavailability =
⚫
| pregnancy_category =
⚫
| protein_bound =
⚫
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| metabolism =
⚫
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
⚫
| elimination_half-life =
| excretion =
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
⚫
| pregnancy_US = <!-- A / B / C / D / X -->
⚫
| routes_of_administration =
⚫
| pregnancy_category=

⚫
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
<!--Pharmacokinetic data-->
⚫
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
⚫
| bioavailability =
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
⚫
| protein_bound =
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| metabolism =
⚫
| elimination_half-life =
⚫
| routes_of_administration =
| excretion =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
⚫
| CAS_number = 2530-97-4
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = TN1B5910V2
⚫
| ATC_prefix = none
⚫
| ATC_suffix =
⚫
| PubChem = 9913
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 9526
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
⚫
| DrugBank = 1

<!--Chemical data-->
⚫
| C=13 | H=21 | N=5 | O=4
| smiles = O=C2N(c1ncn(c1C(=O)N2C)CC(O)CN(CCO)C)C
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C13H21N5O4/c1-15(4-5-19)6-9(20)7-18-8-14-11-10(18)12(21)17(3)13(22)16(11)2/h8-9,19-20H,4-7H2,1-3H3
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = DSFGXPJYDCSWTA-UHFFFAOYSA-N
}}
}}


'''Xanthinol''' is a drug prepared from [[theophylline]] used as a [[vasodilator]].<ref>3-(Theophyllyl-7)-1-(N-methyl-N-hydroxyethyl)amino-2-propanol. Yokoyama, Matatsugu; Kawano, Shigeharu. (1963) Japanese Patent 38020588</ref> It is most often used as the [[salt (chemistry)|salt]] with [[niacin]] (nicotinic acid), known as [[xantinol nicotinate]].<ref>[http://cancerweb.ncl.ac.uk/cgi-bin/omd?xanthinol+niacinate Xanthinol niacinate] at cancerweb.ncl.ac.uk</ref>
'''Xanthinol''' is a drug prepared from [[theophylline]] used as a [[vasodilator]].<ref>{{cite patent | title = 3-(Theophyllyl-7)-1-(N-methyl-N-hydroxyethyl)amino-2-propanol. | inventor = Yokoyama M, Kawano S | pubdate = 1963 | country = JA | number = 38020588 }}</ref><ref>{{cite book | vauthors = Morton IK, Hall JM |title=Concise dictionary of pharmacological agents : properties and synonyms |date=1999 |publisher=Kluwer Academic |location=Boston |isbn=978-0-7514-0499-9 |page=294}}</ref> It is most often used as the [[salt (chemistry)|salt]] with [[Niacin (substance)|niacin]] (nicotinic acid), known as xanthinol nicotinate.<ref>{{cite web | url = http://cancerweb.ncl.ac.uk/cgi-bin/omd?xanthinol+niacinate | title = Xanthinol niacinate] | work = cancerweb.ncl.ac.uk }}</ref>


==References==
==References==
Line 34: Line 57:
[[Category:Diols]]
[[Category:Diols]]


{{cardiovascular-drug-stub}}

{{pharma-stub}}
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"