HZ-2: Difference between revisions

| IUPAC_name = Dimethyl 3,7-dimethyl-9-oxo-2,4-dipyridin-2-yl-3,7-diazabicyclo[3.3.1]nonane-1,5-dicarboxylate

| image = HZ-2.png

| width = 200

| CAS_number = 253304-60-8

| smiles = n3ccccc3C(N1C)C2(C(=O)OC)CN(C)CC(C2=O)(C(=O)OC)C1c4ccccn4

| ATC_prefix =

| ATC_suffix =

| PubChem = 356604

| DrugBank =

| C=23|H=26|N=4|O=5

| molecular_weight = 438.475 g/mol

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->

| pregnancy_US = <!-- A / B / C / D / X -->

| pregnancy_category=

| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->

| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->

| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->

| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->

| legal_status =

| routes_of_administration =

'''HZ-2''' is a drug which acts as a highly selective [[kappa opioid receptor|κ-opioid]] [[agonist]].<ref>{{cite journal | last1 = Siener | first1 = T | last2 = Cambareri | first2 = A | last3 = Kuhl | first3 = U | last4 = Englberger | first4 = W | last5 = Haurand | first5 = M | last6 = Kögel | first6 = B | last7 = Holzgrabe | first7 = U | title = Synthesis and opioid receptor affinity of a series of 2, 4-diaryl-substituted 3,7-diazabicylononanones | journal = Journal of medicinal chemistry | volume = 43 | issue = 20 | pages = 3746–51 | year = 2000 | pmid = 11020289 }}</ref> It is a potent [[analgesic]] with around the same potency as [[morphine]], with a long duration of action and high oral bioavailability.<ref>{{cite journal | last1 = Holzgrabe | first1 = U | last2 = Cambareri | first2 = A | last3 = Kuhl | first3 = U | last4 = Siener | first4 = T | last5 = Brandt | first5 = W | last6 = Strassburger | first6 = W | last7 = Friderichs | first7 = E | last8 = Englberger | first8 = W | last9 = Kögel | first9 = B | title = Diazabicyclononanones, a potent class of kappa opioid analgesics | journal = Farmaco (Societa chimica italiana : 1989) | volume = 57 | issue = 7 | pages = 531–4 | year = 2002 | pmid = 12164207 }}</ref><ref>{{cite journal | last1 = Holzgrabe | first1 = U | last2 = Brandt | first2 = W | title = Mechanism of action of the diazabicyclononanone-type kappa-agonists | journal = Journal of medicinal chemistry | volume = 46 | issue = 8 | pages = 1383–9 | year = 2003 | pmid = 12672238 | doi = 10.1021/jm0210360 }}</ref> Side effects include [[sedation]], [[nausea]] and [[dysphoria]] as well as [[diuretic]] effects.<ref>{{cite journal | doi = 10.1111/j.1527-3458.1998.tb00041.x | last1 = Kögel | first1 = B | last2 = Christoph | first2 = T | last3 = Friderichs | first3 = E | last4 = Hennies | first4 = HH | last5 = Matthiesen | first5 = T | last6 = Schneider | first6 = J | last7 = Holzgrabe | first7 = U. | year = 1998 | title = HZ2, a Selective Kappa-Opioid Agonist | url = | journal = CNS Drug Reviews | volume = 4 | issue = 1| pages = 54–70 }}</ref>

==References==

<references/>

{{Dissociative_hallucinogens}}

[[Category:Pyridines]]

[[Category:Kappa agonists]]