SC-17599: Difference between revisions

{{drugbox |

| IUPAC_name = 6-[(dimethylamino)methyl]-3-ethoxy-21-fluoro-20-oxopregna-3,5-dien-17-yl acetate

| image = SC-17599.svg

| width = 200

| CAS_number =

| synonyms = SC-17599, 17α-Acetoxy-6-dimethylaminomethyl-21-fluoro-3-ethoxy-pregna-3,5-dien-20-one, [(8''R'',9''S'',10''R'',13''S'',14''S'',17''R'')-6-(dimethylaminomethyl)-3-ethoxy-17-(2-fluoroacetyl)-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[''a'']phenanthren-17-yl] acetate

| ATC_prefix =

| ATC_suffix =

| PubChem = 10436424

| DrugBank =

| C = 28 | H = 42 | F = 1 | N = 1 | O = 4

| molecular_weight = 475.634 g/mol

| smiles = CC14CCC(OCC)=CC1=C(CN(C)C)CC3C4CCC2(C)C3CCC2(OC(C)=O)C(=O)CF

| melting_point =

| melting_high =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->

| pregnancy_US = <!-- A / B / C / D / X -->

| pregnancy_category=

| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->

| legal_CA =

| legal_UK =

| legal_US =

| legal_status = Legal

| routes_of_administration =

}}

'''SC-17599''' is a [[steroid]] derivative drug discovered in 1968 which acts as a selective [[mu opioid receptor|μ-opioid]] [[Receptor (biochemistry)|receptor]] [[agonist]], with little or no affinity for the [[delta opioid receptor|δ-opioid]] or [[kappa opioid receptor|κ-opioid]] receptors. It is an active [[analgesic]] ''in vivo'', more potent than [[codeine]] or [[pethidine]] but slightly less potent than [[morphine]],<ref>Craig CR. Analgetic Activity and Other Pharmacological Properties of a Steroid; 17α-acetoxy-6-dimethylaminomethyl-21-fluoro-3-ethoxypregna-3,5-dien-20-one Hydrochloride (SC17599) ''Journal of Pharmacology And Experimental Therapeutics'' 1968; 164(2):371-379.</ref> and produces similar effects to morphine in animals but with less [[sedation]].<ref>McFadyen IJ, Houshyar H, Liu-Chen LY, Woods JH, Traynor JR. The steroid 17alpha-acetoxy-6-dimethylaminomethyl-21-fluoro-3-ethoxy-pregna-3, 5-dien-20-one (SC17599) is a selective mu-opioid agonist: implications for the mu-opioid pharmacophore. ''Molecular Pharmacology''. 2000 Oct;58(4):669-76. PMID 10999935</ref><ref>Houshyar H, Mc Fadyen IJ, Woods JH, Traynor JR. Antinociceptive and other behavioral effects of the steroid SC17599 are mediated by the mu-opioid receptor. ''European Journal of Pharmacology''. 2000 Apr 28;395(2):121-8. PMID 10794817</ref>

{{pharm-stub}}

<references />

{{opioids}}

[[Category:Steroids]]

[[Category:Mu-opioid agonists]]