Methallylescaline: Difference between revisions
Content deleted Content added
Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: ChEMBL. |
Cosmicseeds (talk | contribs) Mescaline analog |
||
(35 intermediate revisions by 24 users not shown) | |||
Line 1: | Line 1: | ||
{{chembox |
{{chembox |
||
| verifiedrevid = |
| verifiedrevid = 411954698 |
||
| ImageFile = Methallylescaline. |
| ImageFile = Methallylescaline.svg |
||
| ImageSize = 200px |
| ImageSize = 200px |
||
| |
| PIN = 2-<nowiki/>{3,5-Dimethoxy-4-[(2-methylprop-2-en-1-yl)oxy]phenyl}ethan-1-amine |
||
| OtherNames = |
| OtherNames = |
||
| |
|Section1={{Chembox Identifiers |
||
| InChI = 1/C14H21NO3/c1-10(2)9-18-14-12(16-3)7-11(5-6-15)8-13(14)17-4/h7-8H,1,5-6,9,15H2,2-4H3 |
| InChI = 1/C14H21NO3/c1-10(2)9-18-14-12(16-3)7-11(5-6-15)8-13(14)17-4/h7-8H,1,5-6,9,15H2,2-4H3 |
||
| InChIKey = FOXJFBFFGULACD-UHFFFAOYAG |
| InChIKey = FOXJFBFFGULACD-UHFFFAOYAG |
||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|||
| ChEMBL = 126803 |
| ChEMBL = 126803 |
||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
Line 13: | Line 14: | ||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChIKey = FOXJFBFFGULACD-UHFFFAOYSA-N |
| StdInChIKey = FOXJFBFFGULACD-UHFFFAOYSA-N |
||
| CASNo_Ref = {{cascite|correct|??}} |
|||
| CASNo = 207740-41-8 |
| CASNo = 207740-41-8 |
||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID=21106346 |
| ChemSpiderID=21106346 |
||
| PubChem = |
| PubChem = 44350127 |
||
| UNII = CVN0S9V910 |
|||
| DTXSID = DTXSID20658380 |
|||
| SMILES = CC(=C)COc1c(cc(cc1OC)CCN)OC |
| SMILES = CC(=C)COc1c(cc(cc1OC)CCN)OC |
||
}} |
}} |
||
| |
|Section2={{Chembox Properties |
||
| C=14|H=21|N=1|O=3 |
|||
| Formula = C<sub>14</sub>H<sub>21</sub>NO<sub>3</sub> |
|||
| MolarMass = 251.321 g/mol |
|||
| Appearance = |
| Appearance = |
||
| Density = |
| Density = |
||
Line 27: | Line 30: | ||
| BoilingPt = |
| BoilingPt = |
||
| Solubility = }} |
| Solubility = }} |
||
| Section3 = {{Chembox |
| Section3 = {{Chembox Pharmacology |
||
| Legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|||
| Legal_BR = F2 |
|||
| Legal_BR_comment = <ref>{{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-07-24 |title=RDC Nº 804 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 804 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-804-de-24-de-julho-de-2023-498447451 |url-status=live |archive-url=https://web.archive.org/web/20230827163149/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-804-de-24-de-julho-de-2023-498447451 |archive-date=2023-08-27 |access-date=2023-08-27 |publisher=[[Diário Oficial da União]] |language=pt-BR |publication-date=2023-07-25}}</ref> |
|||
| Legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|||
| Legal_DE = <!-- Anlage I, II, III or Unscheduled --> |
|||
| Legal_NZ = <!-- Class A, B, C --> |
|||
| Legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|||
| Legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|||
| Legal_UN = <!-- N I, II, III, IV / P I, II, III, IV --> |
|||
| Legal_EU = |
|||
| Legal_status = |
|||
}} |
|||
|Section4={{Chembox Hazards |
|||
| MainHazards = |
| MainHazards = |
||
| FlashPt = |
| FlashPt = |
||
| |
| AutoignitionPt = }} |
||
}} |
}} |
||
'''Methallylescaline''' |
'''Methallylescaline''' ('''4-Methylallyloxy-3,5-dimethoxyphenethylamine''') is a lesser-known [[Psychedelics, dissociatives and deliriants|psychedelic drug]]. It is the 4-[[methyl]] [[structural analog|analog]] of [[allylescaline]]. Methallylescaline was first synthesized by [[Alexander Shulgin]]. In his book ''[[PiHKAL]]'', the dosage range is listed as 40–65 mg and the duration is listed as 12–16 hours.<ref>{{cite web | url = https://www.erowid.org/library/books_online/pihkal/pihkal099.shtml | title = Methallylescaline | work = PiHKAL }}</ref> Little data exists about the pharmacological properties, metabolism, and toxicity of methallylescaline, though it is known to be an agonist of 5-HT<sub>2A</sub> receptors, with effects comparable to that of other [[mescaline]] analogs and has been sold as a [[designer drug]].<ref name="pmid12602954">{{cite journal | vauthors = Clare BW | title = QSAR of benzene derivatives: comparison of classical descriptors, quantum theoretic parameters and flip regression, exemplified by phenylalkylamine hallucinogens | journal = Journal of Computer-aided Molecular Design | volume = 16 | issue = 8–9 | pages = 611–33 | date = 2002 | pmid = 12602954 | doi = 10.1023/a:1021966231380 | bibcode = 2002JCAMD..16..611C | s2cid = 9948738 }}</ref><ref name="pmid25965305">{{cite journal | vauthors = Coelho Neto J | title = Rapid detection of NBOME's and other NPS on blotter papers by direct ATR-FTIR spectrometry | journal = Forensic Science International | volume = 252 | issue = | pages = 87–92 | date = July 2015 | pmid = 25965305 | doi = 10.1016/j.forsciint.2015.04.025 }}</ref> |
||
== |
== Legal status == |
||
Methallylescaline is illegal in Sweden as of 26 January 2016.<ref>{{cite web | url=http://www.folkhalsomyndigheten.se/nyheter-och-press/nyhetsarkiv/2015/november/31-nya-amnen-kan-klassas-som-narkotika-eller-halsofarlig-vara/ | title=31 nya ämnen kan klassas som narkotika eller hälsofarlig vara | publisher=Folkhälsomyndigheten | language=Swedish | date=November 2015}}</ref> |
|||
== See also == |
|||
* [[2C-T-3]] |
|||
* [[3C-MAL]] |
|||
* [[Phenethylamine]] |
* [[Phenethylamine]] |
||
* [[Psychedelics, dissociatives and deliriants]] |
|||
==References== |
|||
⚫ | |||
{{reflist}} |
|||
* [http://www.erowid.org/library/books_online/pihkal/pihkal099.shtml Methallylescaline entry in ''PiHKAL''] |
|||
* [http://pihkal.info/read.php?domain=pk&id=99 MAL entry in PiHKAL • info] |
|||
{{ |
{{Hallucinogens}} |
||
{{Phenethylamines}} |
|||
[[Category: |
[[Category:Alkene derivatives]] |
||
[[Category:Phenol ethers]] |
[[Category:Phenol ethers]] |
||
[[Category: |
[[Category:Psychedelic phenethylamines]] |
||
[[Category:Designer drugs]] |
|||
[[Category:Mescalines]] |
|||
⚫ | |||
* [https://psychonautwiki.org/wiki/MAL Methallylescaline] at PsychonautWiki |
|||
{{Psychoactive-stub}} |
{{Psychoactive-stub}} |