Methallylescaline: Difference between revisions

Page 1
Page 2
Content deleted Content added
Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: ChEMBL.
Mescaline analog
 
(35 intermediate revisions by 24 users not shown)
Line 1: Line 1:
{{chembox
{{chembox
| verifiedrevid = 400306057
| verifiedrevid = 411954698
| ImageFile = Methallylescaline.png
| ImageFile = Methallylescaline.svg
| ImageSize = 200px
| ImageSize = 200px
| IUPACName = 2-{3,5-dimethoxy-4-[(2-methylprop-2-en-1-yl)oxy]phenyl}ethanamine
| PIN = 2-<nowiki/>{3,5-Dimethoxy-4-[(2-methylprop-2-en-1-yl)oxy]phenyl}ethan-1-amine
| OtherNames =
| OtherNames =
| Section1 = {{Chembox Identifiers
|Section1={{Chembox Identifiers
| InChI = 1/C14H21NO3/c1-10(2)9-18-14-12(16-3)7-11(5-6-15)8-13(14)17-4/h7-8H,1,5-6,9,15H2,2-4H3
| InChI = 1/C14H21NO3/c1-10(2)9-18-14-12(16-3)7-11(5-6-15)8-13(14)17-4/h7-8H,1,5-6,9,15H2,2-4H3
| InChIKey = FOXJFBFFGULACD-UHFFFAOYAG
| InChIKey = FOXJFBFFGULACD-UHFFFAOYAG
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 126803
| ChEMBL = 126803
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
Line 13: Line 14:
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = FOXJFBFFGULACD-UHFFFAOYSA-N
| StdInChIKey = FOXJFBFFGULACD-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 207740-41-8
| CASNo = 207740-41-8
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID=21106346
| ChemSpiderID=21106346
| PubChem =
| PubChem = 44350127
| UNII = CVN0S9V910
| DTXSID = DTXSID20658380
| SMILES = CC(=C)COc1c(cc(cc1OC)CCN)OC
| SMILES = CC(=C)COc1c(cc(cc1OC)CCN)OC
}}
}}
| Section2 = {{Chembox Properties
|Section2={{Chembox Properties
| C=14|H=21|N=1|O=3
| Formula = C<sub>14</sub>H<sub>21</sub>NO<sub>3</sub>
| MolarMass = 251.321 g/mol
| Appearance =
| Appearance =
| Density =
| Density =
Line 27: Line 30:
| BoilingPt =
| BoilingPt =
| Solubility = }}
| Solubility = }}
| Section3 = {{Chembox Hazards
| Section3 = {{Chembox Pharmacology
| Legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| Legal_BR = F2
| Legal_BR_comment = <ref>{{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-07-24 |title=RDC Nº 804 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 804 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-804-de-24-de-julho-de-2023-498447451 |url-status=live |archive-url=https://web.archive.org/web/20230827163149/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-804-de-24-de-julho-de-2023-498447451 |archive-date=2023-08-27 |access-date=2023-08-27 |publisher=[[Diário Oficial da União]] |language=pt-BR |publication-date=2023-07-25}}</ref>
| Legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| Legal_DE = <!-- Anlage I, II, III or Unscheduled -->
| Legal_NZ = <!-- Class A, B, C -->
| Legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| Legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| Legal_UN = <!-- N I, II, III, IV / P I, II, III, IV -->
| Legal_EU =
| Legal_status =
}}
|Section4={{Chembox Hazards
| MainHazards =
| MainHazards =
| FlashPt =
| FlashPt =
| Autoignition = }}
| AutoignitionPt = }}
}}
}}


'''Methallylescaline''', or '''4-[[methyl|meth]][[allyl]][[oxy]]-3,5-di[[methoxy]][[phenethylamine]]''', is a lesser-known [[Psychedelics, dissociatives and deliriants|psychedelic drug]]. It is also the 4-[[methyl]] [[Analog (chemistry)|analog]] of [[allylescaline]]. Methallylescaline was first synthesized by [[Alexander Shulgin]]. In his book ''[[PiHKAL|PiHKAL (Phenethylamines i Have Known And Loved)]]'', the dosage range is listed as 40–65&nbsp;mg, and the duration listed as 12–16 hours. Methallylescaline produces intense open and closed-eye visuals, such as [[neon]] [[colors]] and [[kaleidoscope]]-like imagery. Very little data exists about the pharmacological properties, metabolism, and toxicity of Methallylescaline.
'''Methallylescaline''' ('''4-Methylallyloxy-3,5-dimethoxyphenethylamine''') is a lesser-known [[Psychedelics, dissociatives and deliriants|psychedelic drug]]. It is the 4-[[methyl]] [[structural analog|analog]] of [[allylescaline]]. Methallylescaline was first synthesized by [[Alexander Shulgin]]. In his book ''[[PiHKAL]]'', the dosage range is listed as 40–65&nbsp;mg and the duration is listed as 12–16 hours.<ref>{{cite web | url = https://www.erowid.org/library/books_online/pihkal/pihkal099.shtml | title = Methallylescaline | work = PiHKAL }}</ref> Little data exists about the pharmacological properties, metabolism, and toxicity of methallylescaline, though it is known to be an agonist of 5-HT<sub>2A</sub> receptors, with effects comparable to that of other [[mescaline]] analogs and has been sold as a [[designer drug]].<ref name="pmid12602954">{{cite journal | vauthors = Clare BW | title = QSAR of benzene derivatives: comparison of classical descriptors, quantum theoretic parameters and flip regression, exemplified by phenylalkylamine hallucinogens | journal = Journal of Computer-aided Molecular Design | volume = 16 | issue = 8–9 | pages = 611–33 | date = 2002 | pmid = 12602954 | doi = 10.1023/a:1021966231380 | bibcode = 2002JCAMD..16..611C | s2cid = 9948738 }}</ref><ref name="pmid25965305">{{cite journal | vauthors = Coelho Neto J | title = Rapid detection of NBOME's and other NPS on blotter papers by direct ATR-FTIR spectrometry | journal = Forensic Science International | volume = 252 | issue = | pages = 87–92 | date = July 2015 | pmid = 25965305 | doi = 10.1016/j.forsciint.2015.04.025 }}</ref>


== See also ==
== Legal status ==
Methallylescaline is illegal in Sweden as of 26 January 2016.<ref>{{cite web | url=http://www.folkhalsomyndigheten.se/nyheter-och-press/nyhetsarkiv/2015/november/31-nya-amnen-kan-klassas-som-narkotika-eller-halsofarlig-vara/ | title=31 nya ämnen kan klassas som narkotika eller hälsofarlig vara | publisher=Folkhälsomyndigheten | language=Swedish | date=November 2015}}</ref>


== See also ==
* [[2C-T-3]]
* [[3C-MAL]]
* [[Phenethylamine]]
* [[Phenethylamine]]
* [[Psychedelics, dissociatives and deliriants]]


==References==
== External links ==
{{reflist}}
* [http://www.erowid.org/library/books_online/pihkal/pihkal099.shtml Methallylescaline entry in ''PiHKAL'']
* [http://pihkal.info/read.php?domain=pk&id=99 MAL entry in PiHKAL • info]


{{PiHKAL}}
{{Hallucinogens}}
{{Phenethylamines}}


[[Category:Psychedelic phenethylamines]]
[[Category:Alkene derivatives]]
[[Category:Phenol ethers]]
[[Category:Phenol ethers]]
[[Category:Alkenes]]
[[Category:Psychedelic phenethylamines]]
[[Category:Designer drugs]]
[[Category:Mescalines]]


== External links ==


* [https://psychonautwiki.org/wiki/MAL Methallylescaline] at PsychonautWiki
{{Psychoactive-stub}}
{{Psychoactive-stub}}