NAN-190: Difference between revisions

(25 intermediate revisions by 19 users not shown)

Line 1:

⚫

~~{{Drugbox~~| verifiedrevid = ~~407716117~~

{{Drugbox

|

| Verifiedfields = changed

⚫

|IUPAC_name = 1-(2-Methoxyphenyl)-4-(4-phthalimidobutyl)piperazine

⚫

| verifiedrevid = 418038472

⚫

| image = NAN-~~190_structure~~.~~png~~

⚫

| IUPAC_name = 1-(2-Methoxyphenyl)-4-(4-phthalimidobutyl)piperazine

| width = 200

⚫

| image = NAN-190.svg

⚫

| CAS_number= ~~115388~~-32-4

| alt = Skeletal formula of NAN-190

⚫

| ChemSpiderID_Ref = {{chemspidercite|~~correct~~|chemspider}}

| ~~ChemSpiderID~~ =

| width = 250

| image2 = NAN-190-3D-spacefill.png

⚫

| ATC_prefix=

| alt2 = Space-filling model of the NAN-190 molecule

| ATC_suffix=

⚫

| PubChem= 4431

| tradename =

⚫

| routes_of_administration =

| CAS_number_Ref = {{cascite|correct|??}}

⚫

| CAS_number = 102392-05-2

| CAS_supplemental = {{CAS|115388-32-4}} (hydrobromide)

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = LQE19CTV54

⚫

| ATC_prefix =

⚫

| PubChem = 4431

| IUPHAR_ligand = 73

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank=

⚫

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 8618

| ChemSpiderID = 4278

| C=23 | H=27 | N=3 | O=3

| molecular_weight = 393.478 g/mol

| smiles = O=C1c2ccccc2C(=O)N1CCCCN4CCN(CC4)c3ccccc3OC

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| bioavailability=

| StdInChI = 1S/C23H27N3O3/c1-29-21-11-5-4-10-20(21)25-16-14-24(15-17-25)12-6-7-13-26-22(27)18-8-2-3-9-19(18)23(26)28/h2-5,8-11H,6-7,12-17H2,1H3

| metabolism =

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| elimination_half-life=

| StdInChIKey = SJDOMIRMMUGQQK-UHFFFAOYSA-N

| excretion =

| pregnancy_category =

| legal_status =

⚫

| routes_of_administration=

}}

'''NAN-190''' is a [[drug]] and research chemical widely used in scientific studies. It was previously believed to act as a selective [[5-HT1A|5-HT1A]] [[receptor (biochemistry)|receptor]] [[Antagonist (pharmacology)|antagonist]], but a subsequent discovery showed that it also potently blocks the [[Alpha-~~2_adrenergic_receptor~~|α2-adrenergic]] receptor.<ref name="pmid19190523">{{cite journal | ~~author~~ = Foong JP, Bornstein JC. | title = 5-HT antagonists NAN-190 and SB 269970 block alpha2-adrenoceptors in the guinea pig. | journal = ~~Neuroreport.~~ | volume = 20 | issue = 3 | pages = 325–330 | year = 2009 | pmid = 19190523 | doi = 10.1097/WNR.0b013e3283232caa }}</ref> The new finding has raised significant concerns about studies using NAN-190 as a specific [[serotonin]] receptor antagonist.<ref name="pmid19190523" />

'''NAN-190''' is a [[drug]] and research chemical widely used in scientific studies. It was previously believed to act as a selective [[5-HT1A|5-HT1A]] [[receptor (biochemistry)|receptor]] [[Antagonist (pharmacology)|antagonist]], but a subsequent discovery showed that it also potently blocks the [[Alpha-2 adrenergic receptor|α2-adrenergic receptor]].<ref name="pmid19190523">{{cite journal | vauthors = Foong JP, Bornstein JC | title = 5-HT antagonists NAN-190 and SB 269970 block alpha2-adrenoceptors in the guinea pig. | journal = NeuroReport | volume = 20 | issue = 3 | pages = 325–330 | year = 2009 | pmid = 19190523 | doi = 10.1097/WNR.0b013e3283232caa | s2cid = 25499247 }}</ref> The new finding has raised significant concerns about studies using NAN-190 as a specific [[serotonin receptor]] antagonist.<ref name="pmid19190523" />

⚫

==References==