Dieticyclidine: Difference between revisions

Browse history interactively
Page 1
Page 2
← Previous edit
Content deleted Content added
VisualWikitext
CheMoBot (talk | contribs)
Bots
141,565 edits
Updating {{drugbox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (
Fixed spacing between stub template and category templates
 
(23 intermediate revisions by 20 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{drugbox
{{Drugbox
⚫
| verifiedrevid = 376092072
| Verifiedfields = changed
| Watchedfields = changed
⚫
| verifiedrevid = 424837616
| IUPAC_name = N,N-diethyl-1-phenylcyclohexan-1-amine
| IUPAC_name = N,N-diethyl-1-phenylcyclohexan-1-amine
| image = Dieticyclidine.svg
| image = Dieticyclidine.svg
| width =
| width =

<!--Clinical data-->
| tradename =
⚫
| pregnancy_category =
| legal_CA = Schedule I
| legal_UK = Class B
⚫
| legal_status =
⚫
| routes_of_administration =

<!--Pharmacokinetic data-->
⚫
| bioavailability =
⚫
| protein_bound =
⚫
| metabolism =
⚫
| elimination_half-life =
⚫
| excretion =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 2201-19-6
| CAS_number = 2201-19-6
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 8JY6P22UVD
| ATC_prefix = none
| ATC_prefix = none
| PubChem = 604690
| PubChem = 604690
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
⚫
| C = 16 | H = 25 | N = 1
| smiles = CCN(CC)C1(CCCCC1)C2=CC=CC=C2
| ChemSpiderID = 525655
| smiles = CCN(CC)C1(CCCCC1)C2=CC=CC=C2
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| molecular_weight = 231.376
| StdInChI = 1S/C16H25N/c1-3-17(4-2)16(13-9-6-10-14-16)15-11-7-5-8-12-15/h5,7-8,11-12H,3-4,6,9-10,13-14H2,1-2H3
⚫
| bioavailability =
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
⚫
| protein_bound =
| StdInChIKey = GRHWLIMQOFAGHA-UHFFFAOYSA-N
⚫
| metabolism =

⚫
| elimination_half-life =
<!--Chemical data-->
⚫
| excretion =
⚫
| C=16 | H=25 | N=1
⚫
| pregnancy_category =
⚫
| legal_status =
⚫
| routes_of_administration =
}}
}}


'''Dieticyclidine''' ('''PCDE'''), or '''diethylphenylcyclohexylamine''', is a [[psychoactive drug]] and [[research chemical]] of the [[arylcyclohexylamine]] [[chemical class]] related to [[phencyclidine]] (PCP) and [[eticyclidine]] (PCE). It [[drug_action|act]]s as an [[NMDA receptor antagonist]] but has low potency and acts mainly as a [[prodrug]] for eticyclidine.<ref name="pmid8095205">{{cite journal |author=Cho AK, Hiramatsu M, Schmitz DA, Landaw EM, Chang AS, Ramamurthy S, Jenden DJ |title=A pharmacokinetic study of phenylcyclohexyldiethylamine. An analog of phencyclidine |journal=Drug Metabolism and Disposition: the Biological Fate of Chemicals |volume=21 |issue=1 |pages=125–32 |year=1993 |pmid=8095205 |doi= |url=}}</ref><ref name="pmid8450474">{{cite journal |author=Cho AK, Hiramatsu M, Schmitz DA, Vargas HM, Landaw EM |title=A behavioral and pharmacokinetic study of the actions of phenylcyclohexyldiethylamine and its active metabolite, phenylcyclohexylethylamine |journal=The Journal of Pharmacology and Experimental Therapeutics |volume=264 |issue=3 |pages=1401–5 |year=1993 |month=March |pmid=8450474 |doi= |url=}}</ref>
'''Dieticyclidine''' ('''PCDE'''), or '''diethylphenylcyclohexylamine''', is a [[psychoactive drug]] and [[research chemical]] of the [[arylcyclohexylamine]] [[chemical class]] related to [[phencyclidine]] (PCP) and [[eticyclidine]] (PCE). It [[drug action|act]]s as an [[NMDA receptor antagonist]] but has low potency and acts mainly as a [[prodrug]] for [[eticyclidine]].<ref name="pmid8095205">{{cite journal | vauthors = Cho AK, Hiramatsu M, Schmitz DA, Landaw EM, Chang AS, Ramamurthy S, Jenden DJ | title = A pharmacokinetic study of phenylcyclohexyldiethylamine. An analog of phencyclidine | journal = Drug Metabolism and Disposition | volume = 21 | issue = 1 | pages = 125–32 | year = 1993 | pmid = 8095205 }}</ref><ref name="pmid8450474">{{cite journal | vauthors = Cho AK, Hiramatsu M, Schmitz DA, Vargas HM, Landaw EM | title = A behavioral and pharmacokinetic study of the actions of phenylcyclohexyldiethylamine and its active metabolite, phenylcyclohexylethylamine | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 264 | issue = 3 | pages = 1401–5 | date = March 1993 | pmid = 8450474 }}</ref>

== See also ==
* [[Arylcyclohexylamine]]


== References ==
== References ==
{{Reflist}}
{{Reflist}}



{{General anesthetics}}
{{General anesthetics}}
{{Depressants}}
{{Depressants}}
{{Hallucinogens}}
{{Hallucinogens}}
{{Dopamine receptor modulators}}
{{Dopaminergics}}
{{Ionotropic glutamate receptor modulators}}
{{Glutamatergics}}


[[Category:Psychoactive drugs]]
[[Category:Arylcyclohexylamines]]
[[Category:Amines]]
[[Category:Diethylamino compounds]]
[[Category:Designer drugs]]
[[Category:Dissociative drugs]]
[[Category:NMDA receptor antagonists]]




{{nervous-system-drug-stub}}
{{psychoactive-stub}}
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"