NEFA (drug): Difference between revisions

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
+{{short description|Chemical compound}}
-{{Drugbox| verifiedrevid = 400415439
+{{Infobox drug
-|
+| drug_name = NEFA
-| IUPAC_name = (4a''R'',9a''S'')-''N''-Ethyl-4,4a,9,9a-tetrahydro-1''H''-fluoren-4a-amine
+| Watchedfields = changed
+| verifiedrevid = 428773116
+| IUPAC_name = (4a''R'',9a''S'')-''N''-Ethyl-4,4a,9,9a-tetrahydro-1''H''-fluoren-4a-amine
 | image = NEFA.svg
-| width = 150px
+| width =
-| CAS_number=
-| ATC_prefix=
-| ATC_suffix=
-| PubChem=
-| DrugBank=
-| C=15 | H=19 | N=1
-| molecular_weight = 213.3181 g/mol
-| bioavailability=
-| metabolism =
-| elimination_half-life=
-| excretion =
-| pregnancy_category =
-| legal_status =
-| routes_of_administration=
-}}
+<!--Clinical data-->
-'''NEFA''' is a moderate affinity [[NMDA antagonist]] (IC<sub>50</sub> = 0.51 μM). It is a structural analog of [[phencyclidine]].<ref>{{cite journal|doi=10.1016/S0006-3495(98)77622-2|author=Dilmore JG, Johnson JW |title=Open channel block and alteration of N-methyl-D-aspartic acid receptor gating by an analog of phencyclidine |journal=Biophysical Journal |year=1998 |volume=75 |issue=4 |pages=1801–16|pmid=9746522|pmc=1299852}}</ref>
+| tradename =
+| routes_of_administration =
+<!--Pharmacokinetic data-->
-== References ==
+| metabolism =
-{{reflist}}
+| elimination_half-life =
+| excretion =
+<!--Identifiers-->
+| CAS_number_Ref = {{cascite|correct|CAS}}
+| CAS_number =  127140-88-9
+| PubChem   = 57426056
+| UNII_Ref = {{fdacite|correct|FDA}}
+| UNII = JMF9RU2BLC
+<!--Chemical data-->
+| C=15 | H=19 | N=1
+| smiles = CCN[C@]12CC=CC[C@H]1CC3=CC=CC=C23
+| StdInChI = 1S/C15H19N/c1-2-16-15-10-6-5-8-13(15)11-12-7-3-4-9-14(12)15/h3-7,9,13,16H,2,8,10-11H2,1H3/t13-,15+/m0/s1
+| StdInChIKey = DRCWOKJLSQUJPZ-DZGCQCFKSA-N
+}}
+'''NEFA''' is a moderate affinity [[NMDA antagonist]] (IC<sub>50</sub> = 0.51 μM). It is a structural analog of [[phencyclidine]].<ref>{{cite journal|doi=10.1016/S0006-3495(98)77622-2|vauthors=Dilmore JG, Johnson JW |title=Open channel block and alteration of N-methyl-D-aspartic acid receptor gating by an analog of phencyclidine |journal=Biophysical Journal |year=1998 |volume=75 |issue=4 |pages=1801–16|pmid=9746522|pmc=1299852|bibcode=1998BpJ....75.1801D }}</ref> It was first [[Organic synthesis|synthesized]] by a team at [[Parke-Davis]] in the late 1950s.<ref>GB Patent 893920 - Polycyclic amino compounds and methods for their production</ref>
+== References ==
+{{reflist}}
+{{Hallucinogens}}
-{{Dissociative_hallucinogens}}
+{{Ionotropic glutamate receptor modulators}}
-{{Glutamate_receptor_ligands}}
-{{DEFAULTSORT:Ethyl-4,4a,9,9a-tetrahydro-1H-fluoren-4a-amine, (4aR,9aS)-N-}}
+{{DEFAULTSORT:Ethyl-4, 4a, 9, 9a-tetrahydro-1H-fluoren-4a-amine, (4aR, 9aS)-N-}}
 [[Category:Dissociative drugs]]
 [[Category:NMDA receptor antagonists]]
 [[Category:Fluorenes]]
-[[Category:amines]]
+[[Category:Amines]]