Copper usnate: Difference between revisions

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
+{{Short description|Chemical compound}}
 {{Drugbox
-| verifiedrevid = 376090212
+| verifiedrevid = 428779651
+| IUPAC_name =  Copper 4,8-diacetyl-2,9a-dimethyl-7,9-dioxodibenzofuran-1,3-diolate
-| IUPAC_name        =
-| image             =
+| image = Structure of Copper usnate.png
-| CAS_number        =
+<!--Clinical data-->
-| ATC_prefix        = G01
+| tradename =
-| ATC_suffix        = AX15
-| PubChem           =
+| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
-| DrugBank          =
+| pregnancy_US = <!-- A / B            / C / D / X -->
-| chemical_formula  =
+| pregnancy_category =
+| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
-| molecular_weight  =
+| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
-| bioavailability   =
+| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
-| protein_bound     =
+| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
-| metabolism        =
+| legal_status =
-| elimination_half-life =
+| routes_of_administration =
-| excretion         =
-| pregnancy_AU      =  <!-- A / B1 / B2 / B3 / C / D / X -->
+<!--Pharmacokinetic data-->
-| pregnancy_US      =  <!-- A / B            / C / D / X -->
-| pregnancy_category=
+| bioavailability =
+| protein_bound =
-| legal_AU =  <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
+| metabolism =
-| legal_CA =  <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
+| elimination_half-life =
-| legal_UK =  <!-- GSL, P, POM, CD, or Class A, B, C -->
+| excretion =
-| legal_US =  <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
-| legal_status      =
+<!--Identifiers-->
-| routes_of_administration =
+| CAS_number =
+| ATC_prefix = G01
+| ATC_suffix = AX15
+| PubChem =  46222573
+| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
+| DrugBank =  DB13830
+| StdInChI = 1S/C18H16O7.Cu/c1-6-14(22)12(8(3)20)16-13(15(6)23)18(4)10(25-16)5-9(21)11(7(2)19)17(18)24;/h5,11,22-23H,1-4H3;/q;+2/p-2
+| StdInChIKey = BJKWDVRCNOATJS-UHFFFAOYSA-L
+| ChemSpiderID = 30647422
+| UNII = 2EV5P25E2S
+<!--Chemical data-->
+| C=18 | H=14 | Cu=1 | O=7
+| SMILES = Cc1c(c(c2c(c1[O-])C3(C(=CC(=O)C(C3=O)C(=O)C)O2)C)C(=O)C)[O-].[Cu+2]
 }}
-'''Copper usnate''' is the [[copper]] salt of [[usnic acid]]. It has been used as an [[antimicrobial]].<ref>{{cite web |url=http://ntp.niehs.nih.gov/ntp/htdocs/Chem_Background/ExSumPdf/UsnicAcid.pdf |author=Frankos VH |title=NTP nomination for usnic acid and ''Usnea barbata'' herb |date=January 2005 |publisher=[[National Toxicology Program]]}} Retrieved on November 7, 2008.</ref>
+'''Copper usnate''' is the [[copper]] salt of [[usnic acid]]. It has been used as an [[antimicrobial]].<ref>{{cite web |url=https://ntp.niehs.nih.gov/ntp/htdocs/chem_background/exsumpdf/usnicacid_508.pdf | vauthors = Frankos VH |title=NTP nomination for usnic acid and ''Usnea barbata'' herb |date=January 2005 |publisher=[[National Toxicology Program]]}} Retrieved on November 7, 2008.</ref>
 ==References==
@@ Line 33: / Line 47: @@
 [[Category:Antimicrobials]]
-[[Category:Copper compounds]]
+[[Category:Copper(II) compounds]]