Amosulalol: Difference between revisions

Browse history interactively
Page 1
Page 2
← Previous edit
Content deleted Content added
VisualWikitext
CheMoBot (talk | contribs)
Bots
141,565 edits
Updating {{drugbox}} (changes to verified fields - updated '') per Chem/Drugbox validation (report errors or bugs)
Put the {{Short description}} template first as prescribed by MOS:ORDER. Added the cs1 style template to denote Vancouver ("vanc") citation style, because references contain "vauthors" attribute to specify the list of authors.
 
(25 intermediate revisions by 17 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{drugbox
{{cs1 config|name-list-style=vanc}}
| Verifiedfields = changed
{{Verification|date=November 2023}}{{Drugbox
⚫
| UNII_Ref = {{fdacite|changed|FDA}}
⚫
| verifiedrevid = 437165565
⚫
| UNII = C69JI1BAU8
⚫
| IUPAC_name = (''RS'')-5-[1-hydroxy-2-[2-(2-methoxyphenoxy)ethylamino]ethyl]-2-methylbenzenesulfonamide
⚫
| verifiedrevid = 413863239
⚫
| image = Amosulalol.svg
⚫
| IUPAC_name = (''RS'')-5-[1-hydroxy-2-[2-(2-methoxyphenoxy)ethylamino]ethyl]-2-
| width =
methylbenzenesulfonamide

⚫
| image = Amosulalol.svg
<!--Clinical data-->
| tradename =
| Drugs.com = {{drugs.com|international|amosulalol}}
⚫
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
⚫
| pregnancy_US = <!-- A / B / C / D / X -->
⚫
| pregnancy_category =
⚫
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
⚫
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
⚫
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
⚫
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
⚫
| legal_status = Rx-only
⚫
| routes_of_administration = Oral

<!--Pharmacokinetic data-->
⚫
| bioavailability =
⚫
| protein_bound =
⚫
| metabolism =
⚫
| elimination_half-life =
⚫
| excretion =

<!--Identifiers-->
⚫
| CAS_number_Ref = {{cascite|correct|??}}
⚫
| CAS_number = 85320-68-9
⚫
| ATC_prefix = none
⚫
| ATC_suffix =
⚫
| ATC_supplemental =
⚫
| PubChem = 2169
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
⚫
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2084
| ChemSpiderID = 2084
⚫
| UNII_Ref = {{fdacite|correct|FDA}}
⚫
| UNII = C69JI1BAU8
| KEGG_Ref = {{keggcite|correct|kegg}}
⚫
| KEGG = D07451
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 152231
| ChEMBL = 152231

<!--Chemical data-->
⚫
| chemical_formula =
⚫
| C=18 | H=24 | N=2 | O=5 | S=1
⚫
| smiles = CC1=C(C=C(C=C1)C(CNCCOC2=CC=CC=C2OC)O)S(=O)(=O)N
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C18H24N2O5S/c1-13-7-8-14(11-18(13)26(19,22)23)15(21)12-20-9-10-25-17-6-4-3-5-16(17)24-2/h3-8,11,15,20-21H,9-10,12H2,1-2H3,(H2,19,22,23)
| StdInChI = 1S/C18H24N2O5S/c1-13-7-8-14(11-18(13)26(19,22)23)15(21)12-20-9-10-25-17-6-4-3-5-16(17)24-2/h3-8,11,15,20-21H,9-10,12H2,1-2H3,(H2,19,22,23)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = LVEXHFZHOIWIIP-UHFFFAOYSA-N
| StdInChIKey = LVEXHFZHOIWIIP-UHFFFAOYSA-N
| smiles1 = O=S(=O)(N)c1c(ccc(c1)C(O)CNCCOc2ccccc2OC)C
⚫
| CAS_number = 85320-68-9
| CAS_supplemental =
⚫
| ATC_prefix = none
⚫
| ATC_suffix =
⚫
| ATC_supplemental =
⚫
| PubChem = 2169
⚫
| DrugBank =
⚫
| KEGG_Ref = {{keggcite|correct|kegg}}
⚫
| KEGG = D07451
⚫
| chemical_formula =
⚫
| C=18 | H=24 | N=2 | O=5 | S=1
| molecular_weight = 380.45 g/mol
⚫
| smiles = CC1=C(C=C(C=C1)C(CNCCOC2=CC=CC=C2OC)O)S(=O)(=O)N
⚫
| bioavailability =
⚫
| protein_bound =
⚫
| metabolism =
⚫
| elimination_half-life =
⚫
| excretion =
⚫
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
⚫
| pregnancy_US = <!-- A / B / C / D / X -->
⚫
| pregnancy_category=
⚫
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
⚫
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
⚫
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
⚫
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
⚫
| legal_status = Rx-only
⚫
| routes_of_administration = Oral
}}
}}


'''Amosulalol''' ([[International Nonproprietary Name|INN]]) is an [[antihypertensive drug]]. It has much higher [[affinity (pharmacology)|affinity]] for [[alpha-1 adrenergic receptor|α<sub>1</sub>-adrenergic receptor]]s than for [[beta-adrenergic receptor|β-adrenergic receptor]]s.<ref>{{cite book | vauthors = Sponer G, Bartsch W, Hooper RG | chapter = Drugs acting on multiple receptors: β-blockers with additional properties. | title = Pharmacology of antihypertensive therapeutics | date = 1990 | pages = 131–226 (183) | publisher = Springer | location = Berlin, Heidelberg | series = Handbook of Experimental Pharmacology | volume = 93 | doi = 10.1007/978-3-642-74209-5_5 | isbn = 978-3-642-74209-5 | chapter-url = https://archive.org/details/pharmacologyofan0093unse }}</ref> It is not approved for use in the [[United States]].
'''Amosulalol''' ([[International Nonproprietary Name|INN]]) is a [[beta blocker]].


==References==
{{antihypertensive-stub}}
{{Reflist}}


{{Beta blockers}}


{{Adrenergic receptor modulators}}

[[Category:2-Phenoxyethanamines]]
⚫
[[Category:Alpha-1 blockers]]
[[Category:Beta blockers]]
[[Category:Beta blockers]]
[[Category:Phenol ethers]]
[[Category:Catechol ethers]]
[[Category:O-methylated phenols]]
[[Category:Phenylethanolamines]]
[[Category:Sulfonamides]]
[[Category:Sulfonamides]]

⚫
[[Category:Alcohols]]

{{Antihypertensive-stub}}
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"