Diisodecyl phthalate: Difference between revisions

| Verifiedfields = changed

| verifiedrevid = 441501081

| ImageSize = 220px

| ImageFile2 = Diisodecyl phthalate 3D BS.png

| ImageSize2 = 220px

| PIN = Bis(8-methylnonyl) benzene-1,2-dicarboxylate

| OtherNames = Bis(8-methylnonyl) phthalate<br />Bis(isodecyl) phthalate

|Section1={{Chembox Identifiers

| CASNo = 26761-40-0

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = WF93T741QI

| PubChem = 33599

| ChemSpiderID = 30996

| StdInChI = 1S/C28H46O4/c1-23(2)17-11-7-5-9-15-21-31-27(29)25-19-13-14-20-26(25)28(30)32-22-16-10-6-8-12-18-24(3)4/h13-14,19-20,23-24H,5-12,15-18,21-22H2,1-4H3

| StdInChIKey = ZVFDTKUVRCTHQE-UHFFFAOYSA-N

| SMILES = O=C(OCCCCCCCC(C)C)C1=CC=CC=C1C(OCCCCCCCC(C)C)=O}}

|Section2={{Chembox Properties

| C=28|H=46|O=4

| Appearance =

| Density = 0.96-0.97 g/cm³ at 20&nbsp;°C<ref name="BGIA GESTIS">{{GESTIS|ZVG=35170|CAS=26761-40-0|Date=Sep 27, 2007}}</ref>

| MeltingPtC = −50

| MeltingPt_ref = <ref name="BGIA GESTIS" />

| BoilingPtC = 250 to 257

| BoilingPt_notes = at 0.5 kPa <ref>{{cite web|last=NIOSH|title=International Chemical Safety Cards|url=https://www.cdc.gov/niosh/ipcsneng/neng0875.html|publisher=NIOSH|access-date=2017-09-09|archive-url=https://web.archive.org/web/20170614213534/https://www.cdc.gov/niosh/ipcsneng/neng0875.html|archive-date=2017-06-14|url-status=dead}}</ref>

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

'''Diisodecyl phthalate''' ('''DIDP''') is a commonly used [[plasticizer]] used in the production of [[plastic]] and plastic coating to increase flexibility. It is a mixture of compounds derived from the [[esterification]] of [[phthalic acid]] and isomeric [[decyl alcohol]]s.

The coating on furnishings, cookware, pharmaceutical pills, food wrappers and many other products may have DIDP or other [[phthalates]] in them. There has been recent concern in the US and European Union for their [[toxicity]] and [[bioaccumulative]] quality. The European Union has set a maximum specific migration limit (SML) from [[food contact materials]] of 9&nbsp;mg/kg food for the sum of diisodecyl phthalates and [[diisononyl phthalate]]s.<ref>{{cite web|title=EU legislative list for food contact materials|url=http://ec.europa.eu/food/food/chemicalsafety/foodcontact/legisl_list_en.htm}}</ref>

DIDP has been listed since 2007 under [[Proposition 65]] as a substance known to the state of California to cause reproductive toxicity.<ref>{{cite web|title=OEHHA Proposition 65 List of Chemicals|url=http://oehha.ca.gov/prop65/prop65_list/Newlist.html}}</ref> The similar compound [[DINP]] is also listed.

In 2013, ECHA's Risk Assessment Committee (RAC) concluded that Di-isodecyl phthalate (DIDP) does not warrant classification for reprotoxic effects under the EU's Classification, Labelling and Packaging (CLP) regulation.<ref>{{cite web |title=Evaluation of new scientific evidence concerning DINP and DIDP |url=https://echa.europa.eu/documents/10162/31b4067e-de40-4044-93e8-9c9ff1960715 |website=[[European Chemicals Agency]] |archive-url=https://web.archive.org/web/20220901073958/https://echa.europa.eu/documents/10162/31b4067e-de40-4044-93e8-9c9ff1960715 |archive-date=2022-09-01 |url-status=live |access-date=2020-01-26 }}</ref>

==See also==

* [[DPHP]], a similar phthalate ester

{{HealthIssuesOfPlastics}}

[[Category:Phthalate esters]]