Amfenac: Difference between revisions
Content deleted Content added
Updating {{drugbox}} (changes to verified fields - updated 'DrugBank_Ref') per Chem/Drugbox validation (report errors or bugs) |
removed Category:Acetic acids; added Category:Phenylacetic acids using HotCat |
||
| (39 intermediate revisions by 25 users not shown) | |||
| Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{drugbox |
|||
{{Drugbox |
|||
| Verifiedfields = changed |
| Verifiedfields = changed |
||
| |
| Watchedfields = changed |
||
| ⚫ | |||
| ⚫ | |||
| IUPAC_name = (2-Amino-3-benzoylphenyl)acetic acid <!-- the locant '2' for acetic acid is not cited --> |
|||
| ⚫ | |||
| IUPAC_name = 2-Amino-3-benzoylphenylacetic acid<br />2-Amino-3-benzoylbenzeneacetic acid<br />2-(2-amino-3-benzoyl-phenyl)acetic acid |
|||
| image = Amfenac.svg |
| image = Amfenac.svg |
||
| width = 199 |
| width = 199 |
||
| ⚫ | |||
<!--Clinical data--> |
|||
| ⚫ | |||
| tradename = |
|||
| ⚫ | |||
| |
| pregnancy_AU = |
||
| ⚫ | |||
| ⚫ | |||
| ⚫ | |||
| StdInChI = 1S/C15H13NO3/c16-14-11(9-13(17)18)7-4-8-12(14)15(19)10-5-2-1-3-6-10/h1-8H,9,16H2,(H,17,18) |
|||
| ⚫ | |||
<!--Pharmacokinetic data--> |
|||
| StdInChIKey = SOYCMDCMZDHQFP-UHFFFAOYSA-N |
|||
| ⚫ | |||
| ⚫ | |||
| ⚫ | |||
| ⚫ | |||
<!--Identifiers--> |
|||
| IUPHAR_ligand = 7565 |
|||
| CAS_number_Ref = {{cascite|correct|??}} |
|||
| CAS_number = 51579-82-9 |
| CAS_number = 51579-82-9 |
||
| ⚫ | |||
| ⚫ | |||
| ATC_prefix = none |
| ATC_prefix = none |
||
| ATC_suffix = |
| ATC_suffix = |
||
| ATC_supplemental = |
|||
| PubChem = 2136 |
| PubChem = 2136 |
||
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|||
| ChEBI = 75915 |
|||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
||
| DrugBank = |
| DrugBank = |
||
| ⚫ | |||
| ⚫ | |||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
| ⚫ | |||
| KEGG_Ref = {{keggcite|correct|kegg}} |
| KEGG_Ref = {{keggcite|correct|kegg}} |
||
| KEGG = D07443 |
| KEGG = D07443 |
||
| ⚫ | |||
| ⚫ | |||
| ChEMBL = 25146 |
|||
| molecular_weight = 255.27 g/mol |
|||
<!--Chemical data--> |
|||
| ⚫ | |||
| smiles = O=C(c1cccc(c1N)CC(=O)O)c2ccccc2 |
| smiles = O=C(c1cccc(c1N)CC(=O)O)c2ccccc2 |
||
| ⚫ | |||
| ⚫ | |||
| ⚫ | |||
| ⚫ | |||
| ⚫ | |||
| ⚫ | |||
| ⚫ | |||
| elimination_half-life = |
|||
| ⚫ | |||
| ⚫ | |||
| pregnancy_AU = |
|||
| ⚫ | |||
| routes_of_administration = |
|||
}} |
}} |
||
'''Amfenac''' |
'''Amfenac''', also known as '''2-amino-3-benzoylbenzeneacetic acid''', is a [[nonsteroidal anti-inflammatory drug]] (NSAID) with [[acetic acid]] [[Moiety (chemistry)|moiety]].<ref name="pmid3265150">{{cite journal | vauthors = Hiranuma T, Kato S, Hachisu M | title = Analgesic action of amfenac Na, a non-steroidal anti-inflammatory agent | journal = Journal of Pharmacobio-Dynamics| volume = 11 | issue = 9 | pages = 612–9 | date = September 1988 | pmid = 3265150 | doi = 10.1248/bpb1978.11.612 | doi-access = free }}</ref> |
||
== |
==See also== |
||
* [[Bromfenac]] (same structure as amfenac but with ''p''-bromo) |
|||
[[File:Amfenac synth.png|500px]] |
|||
==References== |
|||
{{Cite journal|doi=10.1021/jm00195a012|title=Antiinflammatory agents. 1. Synthesis and antiinflammatory activity of 2-amino-3-benzoylphenylacetic acid|pmid=490552|year=1979|last1=Welstead|first1=William J.|last2=Moran|first2=H. Wayne|last3=Stauffer|first3=Harold F.|last4=Turnbull|first4=Lennox B.|last5=Sancilio|first5=Lawrence F.|journal=Journal of Medicinal Chemistry|volume=22|issue=9|pages=1074}} |
|||
{{Reflist}} |
|||
{{Anti-inflammatory and antirheumatic products}} |
{{Anti-inflammatory and antirheumatic products}} |
||
{{Prostanoid signaling modulators}} |
|||
{{NSAIDs}} |
|||
| ⚫ | |||
[[Category:2-Aminobenzophenones]] |
|||
| ⚫ | |||
| ⚫ | |||
[[Category:Aromatic ketones]] |
|||
| ⚫ | |||
[[Category:Anilines]] |
|||
{{musculoskeletal-drug-stub}} |
{{musculoskeletal-drug-stub}} |
||