Amidephrine: Difference between revisions

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
+{{Short description|Chemical compound}}
 {{Drugbox
+| Watchedfields = changed
-| verifiedrevid = 413851951
+| verifiedrevid = 443383199
-| IUPAC_name               = ''N''-{3-[1-hydroxy-2-(methylamino)ethyl]phenyl}methanesulfonamide
+| IUPAC_name =(''RS'')-''N''-<nowiki/>{3-[1-hydroxy-2-(methylamino)ethyl]phenyl}methanesulfonamide
-| image                    = Amidephrine.svg
+| image = Amidephrine.svg
-| InChI = 1/C10H16N2O3S/c1-11-7-10(13)8-4-3-5-9(6-8)12-16(2,14)15/h3-6,10-13H,7H2,1-2H3
+| width = 222
-| InChIKey = ZHOWHMXTJFZXRB-UHFFFAOYAU
-| smiles = O=S(=O)(Nc1cc(ccc1)C(O)CNC)C
+<!--Clinical data-->
+| tradename =
+| pregnancy_category =
+| legal_status =
+| routes_of_administration =
+<!--Pharmacokinetic data-->
+| bioavailability =
+| metabolism =
+| elimination_half-life =
+| excretion =
+<!--Identifiers-->
+| CAS_number_Ref = {{cascite|correct|??}}
+| CAS_number = 37571-84-9
+| ATC_prefix = none
+| ATC_suffix =
+| PubChem = 15010
+| IUPHAR_ligand = 514
+| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
+| ChemSpiderID = 14288
+| UNII_Ref = {{fdacite|correct|FDA}}
+| UNII = 7E2P22546V
 | ChEMBL_Ref = {{ebicite|correct|EBI}}
 | ChEMBL = 146408
+<!--Chemical data-->
+| C=10 | H=16 | N=2 | O=3 | S=1
+| SMILES = O=S(=O)(Nc1cc(ccc1)C(O)CNC)C
 | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
 | StdInChI = 1S/C10H16N2O3S/c1-11-7-10(13)8-4-3-5-9(6-8)12-16(2,14)15/h3-6,10-13H,7H2,1-2H3
 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
 | StdInChIKey = ZHOWHMXTJFZXRB-UHFFFAOYSA-N
-| CAS_number               = 3354-67-4
-| ATC_prefix               = none
-| ATC_suffix               =
-| UNII = 7E2P22546V
-| PubChem                  = 15010
-| IUPHAR_ligand = 514
-| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
-| ChemSpiderID             = 14288
-| C = 10 | H = 16 | N = 2 | O = 3 | S = 1
-| molecular_weight         = 244.31 g/mol
-| bioavailability          =
-| metabolism               =
-| elimination_half-life    =
-| excretion                =
-| pregnancy_category       =
-| legal_status             =
-| routes_of_administration =
 }}
-'''Amidephrine''' is a [[alpha-adrenergic agonist]].<ref name="pmid2569342">{{cite journal |author=MacLean MR, Thomson M, Hiley CR |title=Pressor effects of the alpha 2-adrenoceptor agonist B-HT 933 in anaesthetized and haemorrhagic rats: comparison with the haemodynamic effects of amidephrine |journal=Br. J. Pharmacol. |volume=97 |issue=2 |pages=419–32 |year=1989 |month=June |pmid=2569342 |pmc=1854522 |doi= |url=}}</ref>
+'''Amidephrine''', or '''amidefrine''', is a [[sulfonamide]] [[alpha-1 adrenergic receptor|α<sub>1</sub>-adrenergic receptor]] [[agonist]].<ref name="pmid2569342">{{cite journal |vauthors =MacLean MR, Thomson M, Hiley CR |title=Pressor effects of the alpha 2-adrenoceptor agonist B-HT 933 in anaesthetized and haemorrhagic rats: comparison with the haemodynamic effects of amidephrine |journal=Br. J. Pharmacol. |volume=97 |issue=2 |pages=419–32 |date=June 1989 |pmid=2569342 |pmc=1854522 |doi= 10.1111/j.1476-5381.1989.tb11969.x}}</ref>
 == References ==
@@ Line 37: / Line 48: @@
+{{Adrenergic receptor modulators}}
-{{Adrenergics}}
-[[Category:Alpha-adrenergic agonists]]
+[[Category:Alpha-1 adrenergic receptor agonists]]
+[[Category:Phenylethanolamines]]
 [[Category:Sulfonamides]]
-[[Category:Phenethylamines]]
-[[Category:Alcohols]]
-{{pharmacology-stub}}
+{{cardiovascular-drug-stub}}