Ritiometan: Difference between revisions

Browse history interactively
Page 1
Page 2
← Previous edit
Content deleted Content added
VisualWikitext
CheMoBot (talk | contribs)
Bots
141,565 edits
Updating {{drugbox}} (changes to verified fields - updated 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Wikipedia talk:WikiProject_Pha
Importing Wikidata short description: "Chemical compound"
 
(10 intermediate revisions by 9 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{drugbox
{{context|date=May 2014}}
⚫
| Verifiedfields = changed
{{Drugbox
⚫
| UNII_Ref = {{fdacite|changed|FDA}}
⚫
| Watchedfields = changed
⚫
| UNII = J89LM8QVEE
| verifiedrevid = 401043195
| verifiedrevid = 443589669
| IUPAC_name = 2,2<nowiki>'</nowiki>,2<nowiki>''</nowiki>-(methanetriyltrisulfanediyl)triacetic acid
| IUPAC_name = 2,2<nowiki>'</nowiki>,2<nowiki>''</nowiki>-(methanetriyltrisulfanediyl)triacetic acid
| image = Ritiometan.svg
| image = Ritiometan.svg

<!--Clinical data-->
| tradename = Nécyrane
| Drugs.com = {{drugs.com|international|ritiometan}}
⚫
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
⚫
| pregnancy_US = <!-- A / B / C / D / X -->
⚫
| pregnancy_category =
⚫
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
⚫
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
⚫
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
⚫
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
⚫
| legal_status =
⚫
| routes_of_administration = Topical (intranasal)

<!--Pharmacokinetic data-->
⚫
| bioavailability =
⚫
| protein_bound =
⚫
| metabolism =
⚫
| elimination_half-life =
⚫
| excretion =

<!--Identifiers-->
⚫
| CAS_number = 34914-39-1
⚫
| ATC_prefix = R01
⚫
| ATC_suffix = AX05
⚫
| PubChem = 65787
⚫
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
⚫
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 59206
| ChemSpiderID = 59206
⚫
| UNII_Ref = {{fdacite|correct|FDA}}
| InChI = 1/C7H10O6S3/c8-4(9)1-14-7(15-2-5(10)11)16-3-6(12)13/h7H,1-3H2,(H,8,9)(H,10,11)(H,12,13)
⚫
| UNII = J89LM8QVEE
| InChIKey = ZBNBQISDCFIEQC-UHFFFAOYAZ
⚫
| synonyms = (Methylidynetrithio)triacetic acid

<!--Chemical data-->
⚫
| C=7 | H=10 | O=6 | S=3
| smiles = O=C(O)CSC(SCC(=O)O)SCC(=O)O
| smiles = O=C(O)CSC(SCC(=O)O)SCC(=O)O
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
Line 15: Line 47:
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = ZBNBQISDCFIEQC-UHFFFAOYSA-N
| StdInChIKey = ZBNBQISDCFIEQC-UHFFFAOYSA-N
⚫
| CAS_number = 34914-39-1
⚫
| ATC_prefix = R01
⚫
| ATC_suffix = AX05
⚫
| PubChem = 65787
⚫
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
⚫
| DrugBank =
⚫
| C=7|H=10|O=6|S=3
| molecular_weight = 286.346 g/mol
⚫
| synonyms = (methylidynetrithio)triacetic acid
⚫
| bioavailability =
⚫
| protein_bound =
⚫
| metabolism =
⚫
| elimination_half-life =
⚫
| excretion =
⚫
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
⚫
| pregnancy_US = <!-- A / B / C / D / X -->
⚫
| pregnancy_category=
⚫
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
⚫
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
⚫
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
⚫
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
⚫
| legal_status =
⚫
| routes_of_administration = Topical (intranasal)
}}
}}
'''Ritiometan''' is an [[antibacterial]] used in [[nasal spray]]s. It is marketed in [[France]] under the trade name '''Necyrane'''.
'''Ritiometan''' is an [[antibacterial]] used in [[nasal spray]]s.<ref>NCI Thesaurus: [http://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C74155 Ritiometan]</ref> Also, it is used in an aerosol preparation for the treatment of infections of the nose and throat.<ref>{{Cite web|url=https://www.tititudorancea.com/z/ritiometan.htm|title=What does Ritiometan mean? Definition, meaning and sense|website=www.tititudorancea.com|access-date=2019-01-22}}</ref> It is marketed in [[France]] under the trade name '''Nécyrane'''.<ref>{{Drugs.com|international|ritiometan}}: Ritiometan</ref>

==References==
{{reflist}}


{{Nasal preparations}}
{{Nasal preparations}}
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"