Glisoxepide: Difference between revisions

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
 {{chembox
+| Verifiedfields = changed
-| verifiedrevid = 443836213
+| Watchedfields = changed
-|ImageFile=Glisoxepide.png
+| verifiedrevid = 443837353
-|ImageSize=200px
+| ImageFile = Glisoxepide.svg
-|IUPACName=
+| ImageSize = 275
-|OtherNames=
+| ImageFile1 = Glisoxepide molecule ball.png
-|Section1={{Chembox Identifiers
+| ImageSize1 = 275
-|  ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
+| PIN = ''N''-[2-(4-<nowiki/>{[(Azepan-1-yl)carbamoyl]sulfamoyl}phenyl)ethyl]-5-methyl-1,2-oxazole-3-carboxamide
+| OtherNames =
+| Section1 = {{Chembox Identifiers
+| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
 | ChemSpiderID = 30380
 | UNII_Ref = {{fdacite|correct|FDA}}
@@ Line 17: / Line 22: @@
 | StdInChIKey = ZKUDBRCEOBOWLF-UHFFFAOYSA-N
 | CASNo_Ref = {{cascite|correct|CAS}}
-| CASNo=25046-79-1
+| CASNo = 25046-79-1
-|  PubChem=32778
+| PubChem = 32778
+| ChEMBL_Ref = {{ebicite|changed|EBI}}
+| ChEMBL = 2106618
 | KEGG_Ref = {{keggcite|correct|kegg}}
 | KEGG = D07118
-|  DrugBank_Ref = {{drugbankcite|correct|drugbank}}
+| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
 | DrugBank = DB01289
 | SMILES = O=C(NCCc1ccc(cc1)S(=O)(=O)NC(=O)NN2CCCCCC2)c3noc(c3)C
 }}
-|Section2={{Chembox Properties
+| Section2 = {{Chembox Properties
-|  Formula=C<sub>20</sub>H<sub>27</sub>N<sub>5</sub>O<sub>5</sub>S
+| Formula = C<sub>20</sub>H<sub>27</sub>N<sub>5</sub>O<sub>5</sub>S
-|  MolarMass=449.52388
+| MolarMass = 449.52388 g/mol
-|  Appearance=
+| Appearance =
-|  Density=
+| Density =
-|  MeltingPt=
+| MeltingPt =
-|  BoilingPt=
+| BoilingPt =
-|  Solubility=
+| Solubility =
   }}
-|Section3={{Chembox Hazards
+|Section6 = {{Chembox Pharmacology
-|  MainHazards=
+| ATCCode_prefix = A10
-|  FlashPt=
+| ATCCode_suffix = BB11
-|  Autoignition=
+}}
+|Section7={{Chembox Hazards
+| MainHazards =
+| FlashPt =
+| AutoignitionPt =
   }}
 }}
-'''Glisoxepide''' ([[International Nonproprietary Name|INN]]) is a [[sulfonylurea]].<ref>{{cite journal |author=Haupt E, Köberich W, Beyer J, Schöffling K |title=Pharmacodynamic aspects of tolbutamide, glibenclamide, glibornuride and glisoxepide. I. Dose response relations and repeated administration in diabetic subjects |journal=Diabetologia |volume=7 |issue=6 |pages=449–54 |year=1971 |month=December |pmid=5004178}}</ref>
+'''Glisoxepide''' ([[International Nonproprietary Name|INN]]) is an orally available [[anti-diabetic drug]] from the group of [[sulfonylurea]]s.<ref>{{cite journal |vauthors=Haupt E, Köberich W, Beyer J, Schöffling K |title=Pharmacodynamic aspects of tolbutamide, glibenclamide, glibornuride and glisoxepide. I. Dose response relations and repeated administration in diabetic subjects |journal=Diabetologia |volume=7 |issue=6 |pages=449–54 |date=December 1971 |pmid=5004178 |doi=10.1007/bf01212061|doi-access=free }}</ref> It belongs to second-generation sulfonylureas.<ref>{{cite journal|last1=Loubatières|first1=A|last2=Ribes|first2=G|last3=Mariani|first3=MM|last4=Alric|first4=R|title=Pharmacological Comparison Between Tolbutamide and Two Second Generation Hypoglycemic Sulfonylureas (Glibenclamide and Glisoxepide)|journal=Acta Diabetologica Latina|volume=10|issue=2|pages=261–82|pmid=4200420|doi=10.1007/bf02590661|year=1973}}</ref>
 ==References==
 {{Reflist}}
+{{Oral hypoglycemics and insulin analogs}}
-{{pharmacology-stub}}
+{{Ion channel modulators}}
-[[Category:Sulfonylureas]]
+[[Category:Potassium channel blockers]]
-[[Category:Isoxazoles]]
-[[Category:amides]]
 [[Category:Azepanes]]
-[[Category:ureas]]
+[[Category:Carboxamides]]
+[[Category:Isoxazoles]]
+[[Category:Benzenesulfonylureas]]
+{{gastrointestinal-drug-stub}}