Deptropine: Difference between revisions

Browse history interactively
Page 1
Page 2
← Previous edit
Content deleted Content added
VisualWikitext
CheMoBot (talk | contribs)
Bots
141,565 edits
Updating {{drugbox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'ChEMBL_Ref', 'DrugBank_Ref') per Chem/Drugbox validation (report [[Wikipedia talk:WikiProject_Pharmacolog
m Reverted edits by 85.210.62.194 (talk) to last version by Alliegaytor
 
(19 intermediate revisions by 15 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{drugbox
{{Drugbox
| Watchedfields = changed
⚫
| verifiedrevid = 443972172
⚫
| IUPAC_name = 3a-[(10,11-dihydro-5''H''-dibenzo[''a'',''d'']cyclohepten-5-yl)<br>oxy]1a''H'',5a''H''-tropane
⚫
| image = Deptropine.svg
⚫
| width = 180

<!--Clinical data-->
| tradename =
⚫
| pregnancy_category =
⚫
| legal_status =
⚫
| routes_of_administration =

<!--Pharmacokinetic data-->
⚫
| bioavailability =
⚫
| protein_bound =
⚫
| metabolism =
⚫
| elimination_half-life =
⚫
| excretion =

<!--Identifiers-->
⚫
| CAS_number = 604-51-3
⚫
| CAS_supplemental = {{CAS|2169-75-7}}
⚫
| ATC_prefix = R06
⚫
| ATC_suffix = AX16
⚫
| PubChem = 16576
⚫
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫
| ChemSpiderID = 16735768
| DrugBank = DB13466
| ChEMBL = 1946186
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = AY31301GKG
| UNII = AY31301GKG
⚫
| KEGG_Ref = {{keggcite|correct|kegg}}
⚫
| verifiedrevid = 443568907
⚫
| KEGG = D07404
⚫
| IUPAC_name = 3a-[(10,11-dihydro-5''H''-dibenzo[''a'',''d'']cyclohepten-5-yl)<br>oxy]1a''H'',5a''H''-tropane
⚫
| ChEBI_Ref = {{ebicite|correct|EBI}}
⚫
| image = Deptropine.svg
⚫
| ChEBI = 50189
⚫
| width = 180

⚫
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
<!--Chemical data-->
⚫
| ChemSpiderID = 16735768
⚫
| C=23 | H=27 | N=1 | O=1
| InChI = 1/C23H27NO/c1-24-18-12-13-19(24)15-20(14-18)25-23-21-8-4-2-6-16(21)10-11-17-7-3-5-9-22(17)23/h2-9,18-20,23H,10-15H2,1H3/t18-,19+,20+
| smiles = CN5[C@@H]1CC[C@H]5C[C@H](C1)OC3c4ccccc4CCc2ccccc23
| smiles = CN5[C@@H]1CC[C@H]5C[C@H](C1)OC3c4ccccc4CCc2ccccc23
| InChIKey = ZWPODSUQWXAZNC-PMOLBWCYBB
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C23H27NO/c1-24-18-12-13-19(24)15-20(14-18)25-23-21-8-4-2-6-16(21)10-11-17-7-3-5-9-22(17)23/h2-9,18-20,23H,10-15H2,1H3/t18-,19+,20+
| StdInChI = 1S/C23H27NO/c1-24-18-12-13-19(24)15-20(14-18)25-23-21-8-4-2-6-16(21)10-11-17-7-3-5-9-22(17)23/h2-9,18-20,23H,10-15H2,1H3/t18-,19+,20+
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = ZWPODSUQWXAZNC-PMOLBWCYSA-N
| StdInChIKey = ZWPODSUQWXAZNC-PMOLBWCYSA-N
⚫
| CAS_number = 604-51-3
⚫
| CAS_supplemental = {{CAS|2169-75-7}} ([[citrate]])
⚫
| ATC_prefix = R06
⚫
| ATC_suffix = AX16
⚫
| ChEBI_Ref = {{ebicite|correct|EBI}}
⚫
| ChEBI = 50189
⚫
| PubChem = 16576
⚫
| KEGG_Ref = {{keggcite|correct|kegg}}
⚫
| KEGG = D07404
⚫
| C=23|H=27|N=1|O=1
| molecular_weight = 333.467 g/mol
⚫
| bioavailability =
⚫
| protein_bound =
⚫
| metabolism =
⚫
| elimination_half-life =
⚫
| excretion =
⚫
| pregnancy_category=
⚫
| legal_status =
⚫
| routes_of_administration =
}}
}}


'''Deptropine''' ('''Brontina''') also known as '''dibenzheptropine''', is an [[antihistamine]] with [[anticholinergic]] properties. It is usually marketed as the [[citrate]] salt.
'''Deptropine''' ('''Brontina''') also known as '''dibenzheptropine''', is an [[antihistamine]] with [[anticholinergic]] properties acting at the [[Histamine H1 receptor|H1 receptor]].<ref>{{Cite web|last=PubChem|title=Deptropine|url=https://pubchem.ncbi.nlm.nih.gov/compound/16576|access-date=2020-11-16|website=pubchem.ncbi.nlm.nih.gov|language=en}}</ref> It is usually marketed as the [[citrate]] salt.<ref>{{cite journal | vauthors = Leckie WJ, Horne NW | journal = Thorax | volume = 20 | issue = 4 | pages = 317–23 | date = July 1965 | pmid = 14321719 | pmc = 1018942 | doi = 10.1136/thx.20.4.317 | title = Preliminary Assessment of Deptropine Dihydrogen Citrate in Chronic Airways Obstruction }}</ref>


== References ==
== References ==
{{Reflist|2}}
{{Reflist}}



{{Antihistamines}}
{{Cholinergics}}
{{Cholinergics}}
{{Histaminergics}}
{{Histaminergics}}
{{Tricyclics}}
{{Tricyclics}}




[[Category:H1 receptor antagonists]]
[[Category:H1 receptor antagonists]]
Line 52: Line 60:
[[Category:Dibenzocycloheptenes]]
[[Category:Dibenzocycloheptenes]]
[[Category:Ethers]]
[[Category:Ethers]]



{{respiratory-system-drug-stub}}
{{respiratory-system-drug-stub}}

[[th:เดพโทรปีน]]
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"