Dibenzepin: Difference between revisions

{{Drugbox

| verifiedrevid = 445384837

| image = Dibenzepin.png

| tradename =

| pregnancy_category =

| bioavailability = 25% (Oral)

| excretion = [[Urine]] (80%), [[Feces]] (20%)

| molecular_weight = 295.379 g/mol

| smiles = O=C2c1c(cccc1)N(c3c(N2CCN(C)C)cccc3)C

| InChI = 1/C18H21N3O/c1-19(2)12-13-21-17-11-7-6-10-16(17)20(3)15-9-5-4-8-14(15)18(21)22/h4-11H,12-13H2,1-3H3

| InChIKey = QPGGEKPRGVJKQB-UHFFFAOYAT

'''Dibenzepin''' ('''Noveril''', '''Anslopax''', '''Deprex''', '''Ecatril''', '''Neodit''', '''Victoril''') is a [[tricyclic antidepressant]] (TCA) used widely throughout [[Europe]] for the treatment of [[major depressive disorder|depression]].<ref name="isbn3-88763-075-0">{{cite book | author = Swiss Pharmaceutical Society | title = Index Nominum 2000: International Drug Directory (Book with CD-ROM) | publisher = Medpharm Scientific Publishers | location = Boca Raton | year = 2000 | pages = | isbn = 3-88763-075-0 | oclc = | doi = | url = http://books.google.com/books?id=5GpcTQD_L2oC&lpg=PA323&dq=dibenzepin&as_brr=3&pg=PA323#v=onepage&q=&f=false}}</ref><ref name="isbn0-8155-1144-2">{{cite book | author = Sittig, Marshall | title = Pharmaceutical manufacturing encyclopedia | publisher = Noyes Publications | location = Park Ridge, N.J., U.S.A | year = 1988 | pages = | isbn = 0-8155-1144-2 | oclc = | doi = | url = http://books.google.com/books?id=X2EyLsG4bcUC&lpg=PA470&dq=dibenzepin&as_brr=3&pg=PA470#v=onepage&q=&f=false}}</ref><ref name="pmid1687987">{{cite journal | author = Beresewicz M, Bidzińska E, Koszewska I, Puzyński S | title = [Results of using tricyclic antidepressive drugs in the treatment of endogenous depression (comparative analysis of 7 drugs)] | language = Polish | journal = Psychiatria Polska | volume = 25 | issue = 3-4 | pages = 13–8 | year = 1991 | pmid = 1687987 | doi = | url = }}</ref> It has similar efficacy and effects relative to other TCAs like [[imipramine]] but with fewer [[side effect]]s.<ref name="urlwww.health.gov.il">{{cite web | url = http://www.health.gov.il/units/pharmacy/trufot/alonim/2107.pdf | title = Novartis (dibenzepin) - Prescribing Information}}</ref><ref name="isbn1-4200-4479-6">{{cite book | author = Paloucek, Frank P.; Leikin, Jerrold B. | title = Poisoning and Toxicology Handbook, Fourth Edition (Poisoning and Toxicology Handbook (Leiken & Paloucek's)) | publisher = Informa Healthcare | location = | year = 2007 | pages = | isbn = 1-4200-4479-6 | oclc = | doi = | url = http://books.google.com/books?id=0Bw2UJTC_uMC&lpg=PA242&dq=dibenzepin&lr=lang_en&as_drrb_is=q&as_minm_is=0&as_miny_is=&as_maxm_is=0&as_maxy_is=&as_brr=3&pg=PA242#v=onepage&q=&f=false}}</ref><ref name="pmid6928">{{cite journal | author = Gowardman M, Brown RA | title = Dibenzepin and amitriptyline in depressive states: comparative double-blind trial | journal = The New Zealand Medical Journal | volume = 83 | issue = 560 | pages = 194–7 | year = 1976 | month = March | pmid = 6928 | doi = | url = }}</ref><ref name="pmid8749">{{cite journal | author = Baron DP, Unger HR, Williams HE, Knight RG | title = A double blind study of the antidepressants dibenzepin (Noveril) and amitriptyline | journal = The New Zealand Medical Journal | volume = 83 | issue = 562 | pages = 273–4 | year = 1976 | month = April | pmid = 8749 | doi = | url = }}</ref> Dibenzepin acts as a [[norepinephrine reuptake inhibitor]], potent [[antihistamine]], and weak [[anticholinergic]].<ref name="urlwww.health.gov.il">{{cite web | url = http://www.health.gov.il/units/pharmacy/trufot/alonim/2107.pdf | title = Novartis (dibenzepin) - Prescribing Information}}</ref><ref name="isbn1-4200-4479-6">{{cite book | author = Paloucek, Frank P.; Leikin, Jerrold B. | title = Poisoning and Toxicology Handbook, Fourth Edition (Poisoning and Toxicology Handbook (Leiken & Paloucek's)) | publisher = Informa Healthcare | location = | year = 2007 | pages = | isbn = 1-4200-4479-6 | oclc = | doi = | url = http://books.google.com/books?id=0Bw2UJTC_uMC&lpg=PA242&dq=dibenzepin&lr=lang_en&as_drrb_is=q&as_minm_is=0&as_miny_is=&as_maxm_is=0&as_maxy_is=&as_brr=3&pg=PA242#v=onepage&q=&f=false}}</ref><ref name="pmid20647">{{cite journal | author = Rehavi M, Maayani S, Goldstein L, Assael M, Sokolovsky M | title = Antimuscarinic properties of antidepressants: dibenzepin (Noveril) | journal = Psychopharmacology | volume = 54 | issue = 1 | pages = 35–8 | year = 1977 | month = August | pmid = 20647 | doi = 10.1007/BF00426538| url = }}</ref> It lacks any [[5-HT2 receptor|5-HT₂]] [[receptor antagonist|antagonistic]] properties.<ref name="pmid6148707">{{cite journal | author = Closse A, Jaton AL | title = Investigation of the influence of lithium upon the down-regulation of serotonin2 receptors in rat frontal cortex induced by long-term treatment with dibenzepin, an antidepressant without appreciable affinity to serotonin2 receptors | journal = Naunyn-Schmiedeberg's Archives of Pharmacology | volume = 326 | issue = 4 | pages = 291–3 | year = 1984 | month = July | pmid = 6148707 | doi = | url = }}</ref>

== See also ==

* [[Tricyclic antidepressant]]

== References ==

{{Reflist}}

== External links ==

* {{cite web | url = http://www.health.gov.il/units/pharmacy/trufot/alonim/2107.pdf | title = Novartis - Noveral (dibenzepin) - Prescribing Information}}

{{Anxiolytics}}

{{Adrenergics}}

{{Cholinergics}}

{{Histaminergics}}

[[Category:Tricyclic antidepressants]]

[[de:Dibenzepin]]

[[hu:Dibenzepin]]

[[pl:Dibenzepina]]