LSM-775: Difference between revisions

{{Short description|Chemical compound}}

| Watchedfields = changed

| verifiedrevid = 447574259

| IUPAC_name = (8β)-6-Methyl-8-(morpholin-4-ylcarbonyl)-9,10-didehydroergoline

| tradename =

| legal_AU =

| legal_CA =

| legal_DE = NpSG

| legal_UK = PSA

| legal_US =

| legal_status = Illegal in France<ref>{{cite web|date=20 May 2021|title=Arrêté du 20 mai 2021 modifiant l'arrêté du 22 février 1990 fixant la liste des substances classées comme stupéfiants | trans-title = Order of May 20, 2021 amending the order of February 22, 1990 setting the list of substances classified as narcotics |url=https://www.legifrance.gouv.fr/jorf/id/JORFTEXT000043523554|website=www.legifrance.gouv.fr|lang=fr}}</ref>

| routes_of_administration = [[wikt:oral|Oral]]

| CAS_number_Ref = {{cascite|correct|??}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 168Y0PXM7S

| C=20 | H=23 | N=3 | O=2

| smiles = O=C(N1CCOCC1)[C@@H]5C=C4c2cccc3c2c(c[nH]3)C[C@H]4N(C)C5

'''''N''-Morpholinyllysergamide''' ('''LSM-775''') is a derivative of [[ergine]].<ref>{{cite journal | vauthors = Gogerty JH, Dille JM | title = Pharmacology of d-lysergic acid morpholide (LSM) | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 120 | issue = 3 | pages = 340–8 | date = July 1957 | pmid = 13476356 | url = http://jpet.aspetjournals.org/content/120/3/340.abstract }}</ref> It is less potent than LSD but is reported to have some [[Lysergic acid diethylamide|LSD]]-like effects at doses ranging from 75 to 700 micrograms and a shorter duration. There are fewer signs of [[cardiovascular]] [[stimulation]] and [[Peripheral nervous system|peripheral]] [[Antitarget|toxicity]] with LSM-775 compared to LSD.<ref name="TiHKAL">{{cite web |url = https://www.erowid.org/library/books_online/tihkal/tihkal26.shtml |title = TiHKAL #26, LSD-25 |publisher = Erowid| vauthors = Shulgin A, Shulgin A }}</ref>{{dubious|date=March 2019}}

== See also ==

* [[1cP-LSD]]

* [[1B-LSD]]

* [[1P-ETH-LAD]]

* [[1P-LSD]]

* [[1V-LSD]]

* [[ALD-52]]

* [[AL-LAD]]

* [[ETH-LAD]]

* [[Lysergic acid 2,4-dimethylazetidide]] (LSZ)

* [[Lysergic acid diethylamide]] (LSD)

* [[O-Acetylpsilocin]] (4-AcO-DMT)

* [[PRO-LAD]]

== References ==

{{reflist}}

{{DEFAULTSORT:LSM-775}}

{{Hallucinogens}}

{{Serotonergics}}

{{Ergolines}}

[[Category:4-Morpholinyl compounds]]

[[Category:Serotonin receptor agonists]]

[[Category:Designer drugs]]