Lonazolac: Difference between revisions
Content deleted Content added
Updating {{drugbox}} (changes to watched fields - added verified revid - updated 'ChemSpiderID_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Wikipedia talk:Wiki |
Entranced98 (talk | contribs) Importing Wikidata short description: "Chemical compound" |
||
(11 intermediate revisions by 10 users not shown) | |||
Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
|||
| Watchedfields = changed |
| Watchedfields = changed |
||
| verifiedrevid = |
| verifiedrevid = 447986412 |
||
| IUPAC_name = [3-(4-chlorophenyl)-1-phenyl-1''H''-pyrazol-4-yl]acetic acid |
| IUPAC_name = [3-(4-chlorophenyl)-1-phenyl-1''H''-pyrazol-4-yl]acetic acid |
||
| image = lonazolac.png |
| image = lonazolac.png |
||
Line 25: | Line 27: | ||
<!--Identifiers--> |
<!--Identifiers--> |
||
| CAS_number_Ref = {{cascite|correct|CAS}} |
|||
| CAS_number = |
| CAS_number = 53808-88-1 |
||
| ATC_prefix = M01 |
| ATC_prefix = M01 |
||
| ATC_suffix = AB09 |
| ATC_suffix = AB09 |
||
Line 35: | Line 38: | ||
| KEGG_Ref = {{keggcite|correct|kegg}} |
| KEGG_Ref = {{keggcite|correct|kegg}} |
||
| KEGG = D07265 |
| KEGG = D07265 |
||
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|||
| ChEBI = 76164 |
|||
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|||
| ChemSpiderID = 61957 |
|||
<!--Chemical data--> |
<!--Chemical data--> |
||
| C=17 | H=13 | Cl=1 | N=2 | O=2 |
| C=17 | H=13 | Cl=1 | N=2 | O=2 |
||
| smiles = c1ccc(cc1)n2cc(c(n2)c3ccc(cc3)Cl)CC(=O)O |
|||
| molecular_weight = 312.75032 g/mol |
|||
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChI = 1S/C17H13ClN2O2/c18-14-8-6-12(7-9-14)17-13(10-16(21)22)11-20(19-17)15-4-2-1-3-5-15/h1-9,11H,10H2,(H,21,22) |
|||
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChIKey = XVUQHFRQHBLHQD-UHFFFAOYSA-N |
|||
}} |
}} |
||
'''Lonazolac''' is a [[ |
'''Lonazolac''' is a [[nonsteroidal anti-inflammatory drug]] (NSAID). |
||
==References== |
|||
{{Reflist|2}} |
|||
{{Anti-inflammatory and antirheumatic products}} |
{{Anti-inflammatory and antirheumatic products}} |
||
{{Prostanoidergics}} |
|||
{{NSAIDs}} |
|||
[[Category:Pyrazoles]] |
[[Category:Pyrazoles]] |
||
[[Category: |
[[Category:Nonsteroidal anti-inflammatory drugs]] |
||
[[Category: |
[[Category:Chloroarenes]] |
||