Lonazolac: Difference between revisions

Page 1
Page 2
Content deleted Content added
CheMoBot (talk | contribs)
Updating {{drugbox}} (changes to watched fields - added verified revid - updated 'ChemSpiderID_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Wikipedia talk:Wiki
Importing Wikidata short description: "Chemical compound"
 
(11 intermediate revisions by 10 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{Drugbox
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| Watchedfields = changed
| verifiedrevid = 444592177
| verifiedrevid = 447986412
| IUPAC_name = [3-(4-chlorophenyl)-1-phenyl-1''H''-pyrazol-4-yl]acetic acid
| IUPAC_name = [3-(4-chlorophenyl)-1-phenyl-1''H''-pyrazol-4-yl]acetic acid
| image = lonazolac.png
| image = lonazolac.png
Line 25: Line 27:


<!--Identifiers-->
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number =
| CAS_number = 53808-88-1
| ATC_prefix = M01
| ATC_prefix = M01
| ATC_suffix = AB09
| ATC_suffix = AB09
Line 35: Line 38:
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07265
| KEGG = D07265
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 76164
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 61957


<!--Chemical data-->
<!--Chemical data-->
| C=17 | H=13 | Cl=1 | N=2 | O=2
| C=17 | H=13 | Cl=1 | N=2 | O=2
| smiles = c1ccc(cc1)n2cc(c(n2)c3ccc(cc3)Cl)CC(=O)O
| molecular_weight = 312.75032 g/mol
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C17H13ClN2O2/c18-14-8-6-12(7-9-14)17-13(10-16(21)22)11-20(19-17)15-4-2-1-3-5-15/h1-9,11H,10H2,(H,21,22)
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = XVUQHFRQHBLHQD-UHFFFAOYSA-N
}}
}}


'''Lonazolac''' is a [[non-steroidal anti-inflammatory drug]].
'''Lonazolac''' is a [[nonsteroidal anti-inflammatory drug]] (NSAID).


==References==
{{Reflist|2}}




{{Anti-inflammatory and antirheumatic products}}
{{Anti-inflammatory and antirheumatic products}}
{{Prostanoidergics}}
{{NSAIDs}}


[[Category:Pyrazoles]]
[[Category:Pyrazoles]]
[[Category:Non-steroidal anti-inflammatory drugs]]
[[Category:Nonsteroidal anti-inflammatory drugs]]
[[Category:Organochlorides]]
[[Category:Chloroarenes]]