Dimenoxadol: Difference between revisions

{{Short description|Opioid analgesic drug}}

| verifiedrevid = 447990763

| IUPAC_name = 2-(dimethylamino)ethyl 2-ethoxy-2,2-diphenylacetate

| legal_AU = S9

| legal_BR = A1

| legal_BR_comment = <ref>{{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=[[Diário Oficial da União]] |language=pt-BR |publication-date=2023-04-04}}</ref>

| legal_CA = Schedule I

| legal_DE = Anlage I

| legal_UN = P I

| routes_of_administration =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| ChEMBL = 2104309

| UNII_Ref = {{fdacite|correct|FDA}}

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D12672

| smiles = CCOC(C1=CC=CC=C1)(C2=CC=CC=C2)C(=O)OCCN(C)C

'''Dimenoxadol''' ([[International Nonproprietary Name|INN]]) (brand name '''Estocin''' (in [[Russia]])), or '''dimenoxadole''' ([[British Approved Name|BAN]]), is an [[opioid]] [[analgesic]] which is a [[benzilic acid]] derivative, closely related to [[benactyzine]] (an [[anticholinergic]]). Further, the structure is similar to [[methadone]] and related compounds like [[dextropropoxyphene]].

It was invented in Germany in the 1950s,<ref>{{cite patent | country = GB | number = 716700 | title = A new and improved analgesic and process for its production | inventor = Boehringer A, et al. | pubdate = 10/13/1954}}</ref> and produces similar effects to other opioids, including [[analgesia]], [[sedation]], [[dizziness]] and [[nausea]].<ref>{{cite journal | vauthors = Gorbatova EN | title = [The pharmacology of estocin, an new analgesic] | journal = Stomatologiia | volume = 46 | issue = 2 | pages = 22–5 | year = 1967 | pmid = 5232927 }}</ref><ref>{{cite journal | vauthors = Kingisepp GI, Kurvits K, Nurmand LB | title = [Pharmacology of dimethylaminoethyl ester of diphenylethoxyacetic acid hydrochloride--estocin] | journal = Farmakologiia I Toksikologiia | volume = 32 | issue = 6 | pages = 710–2 | year = 1969 | pmid = 5381602 }}</ref><ref>{{cite journal | vauthors = Liberman SS | title = [Analgesic action of estocin (dimethylaminoethyl ester hydrochloride of alpha, alpha-diphenylethoxyacetic acid)] | journal = Farmakologiia I Toksikologiia | volume = 31 | issue = 6 | pages = 668–71 | year = 1968 | pmid = 5729519 }}</ref>

In the United States it is a Schedule I Narcotic controlled substance with an ACSCN of 9617 and a 2013 annual aggregate manufacturing quota of zero.

== References ==

{{Reflist}}

{{Analgesics}}

{{Opioidergics}}

[[Category:Analgesics]]

[[Category:Mu-opioid receptor agonists]]

[[Category:Dimethylamino compounds]]