Luteoforol: Difference between revisions

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 449564692

| Name = Luteoforol

| ImageFile = Luteoforol.svg

| ImageName = Chemical structure of luteoforol

| IUPACName = (2S)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-4,5,7-triol

| OtherNames = 3-Deoxyleucocyanidin

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 24897-98-1

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 830GM1N73B

| PubChem = 440834

| KEGG = C05907

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 27686

| SMILES = C1C(C2=C(C=C(C=C2OC1C3=CC(=C(C=C3)O)O)O)O)O

|Section2={{Chembox Properties

| Formula = C₁₅H₁₄O₆

| MolarMass = 290.26 g/mol

| Density = <!-- g/cm³ -->

| MeltingPt = <!-- °C -->

| BoilingPt =

'''Luteoforol''' is a chemical compound belonging to the [[flavan-4-ol]] class of flavonoids.

Luteoforol is induced in [[pome]] fruits by [[prohexadione]]-calcium.<ref>{{Cite journal |last=Spinelli |first=Francesco |last2=Speakman |first2=John-Bryan |last3=Rademacher |first3=Wilhelm |last4=Halbwirth |first4=Heidi |last5=Stich |first5=Karl |last6=Costa |first6=Guglielmo |year=2005 |title=Luteoforol, a flavan 4-ol, is induced in pome fruits by prohexadione-calciumand shows phytoalexin-like properties against Erwinia amylovora and other plant pathogens |url=https://doi.org/10.1007%2Fs10658-005-2192-x |journal=European Journal of Plant Pathology |volume=112 |issue=2 |pages=133–142 |doi=10.1007/s10658-005-2192-x |s2cid=897040}}</ref>

[[Category:Flavan-4-ols]]

{{Aromatic-stub}}