SKF-89,145: Difference between revisions
Content deleted Content added
Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Wik |
Entranced98 (talk | contribs) Importing Wikidata short description: "Chemical compound" |
||
| (12 intermediate revisions by 11 users not shown) | |||
| Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
| ⚫ | |||
{{Drugbox |
|||
| |
|||
| ⚫ | |||
|IUPAC_name = 4-(6-methyl-5,7-dihydro-4''H''-thieno[2,3-c]pyridin-4-yl)benzene-1,2-diol |
| IUPAC_name = 4-(6-methyl-5,7-dihydro-4''H''-thieno[2,3-c]pyridin-4-yl)benzene-1,2-diol |
||
| image=SKF-89145_structure.png |
|||
| image = SKF-89,145 Structure.svg |
|||
| ⚫ | |||
| ATC_prefix= |
|||
<!--Clinical data--> |
|||
| ⚫ | |||
| tradename = |
|||
| ATC_supplemental= |
|||
| ⚫ | |||
| ⚫ | |||
| ⚫ | |||
| ⚫ | |||
| ⚫ | |||
<!--Pharmacokinetic data--> |
|||
| ⚫ | |||
| ⚫ | |||
| ⚫ | |||
| ⚫ | |||
<!--Identifiers--> |
|||
| ⚫ | |||
| ⚫ | |||
| ⚫ | |||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
||
| ChemSpiderID = 8236766 |
|||
| DrugBank= |
|||
| ChEMBL = 1591046 |
|||
| ⚫ | |||
| molecular_weight = 261.339 g/mol |
|||
<!--Chemical data--> |
|||
| ⚫ | |||
| smiles = Oc1ccc(cc1O)C2CN(C)Cc3sccc23 |
| smiles = Oc1ccc(cc1O)C2CN(C)Cc3sccc23 |
||
| StdInChI = 1S/C14H15NO2S/c1-15-7-11(10-4-5-18-14(10)8-15)9-2-3-12(16)13(17)6-9/h2-6,11,16-17H,7-8H2,1H3 |
|||
| ⚫ | |||
| StdInChIKey = SYHALWYYSDMSLE-UHFFFAOYSA-N |
|||
| protein_bound = |
|||
| ⚫ | |||
| ⚫ | |||
| ⚫ | |||
| ⚫ | |||
| ⚫ | |||
| ⚫ | |||
| ⚫ | |||
}} |
}} |
||
'''SKF-89,145''' is a drug which acts as a [[dopamine agonist]] selective for the [[Dopamine receptor D1|D<sub>1</sub>]] subtype. The ''N''-desmethyl derivative SKF-89,626 is also a selective D<sub>1</sub> agonist with similar potency and selectivity to SKF 89,145.<ref name="pmid3501846">{{cite journal | |
'''SKF-89,145''' is a drug which acts as a [[dopamine agonist]] selective for the [[Dopamine receptor D1|D<sub>1</sub>]] subtype. The ''N''-desmethyl derivative SKF-89,626 is also a selective D<sub>1</sub> agonist with similar potency and selectivity to SKF 89,145.<ref name="pmid3501846">{{cite journal | vauthors = O'Boyle KM, Waddington JL | title = New substituted 1-phenyl-3-benzazepine analogues of SK&F 38393 and N-methyl-thienopyridine analogues of dihydroxynomifensine with selective affinity for the D-1 dopamine receptor in human post-mortem brain | journal = Neuropharmacology | volume = 26 | issue = 12 | pages = 1807–10 | date = December 1987 | pmid = 3501846 | doi = 10.1016/0028-3908(87)90139-0 | s2cid = 34415106 }}</ref> |
||
==References== |
== References == |
||
{{ |
{{Reflist}} |
||
{{Dopamine receptor modulators}} |
|||
{{Dopaminergics}} |
|||
[[Category: |
[[Category:D1-receptor agonists]] |
||
[[Category:Catechols]] |
[[Category:Catechols]] |
||
[[Category:Thienopyridines]] |
[[Category:Thienopyridines]] |
||
{{nervous-system-drug-stub}} |
{{nervous-system-drug-stub}} |
||