AM-1220: Difference between revisions

Page 1
Page 2
Content deleted Content added
No edit summary
Importing Wikidata short description: "Chemical compound"
 
(37 intermediate revisions by 25 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{Drugbox
{{Drugbox
| verifiedrevid = 454826769
| Watchedfields = changed
| IUPAC_name = (''R'')-(1-((1-Methylpiperidin-2-yl)methyl)-1''H''-indol-3-yl)(naphthalen-1-yl)methanone
| verifiedrevid = 440192487
| IUPAC_name = (R)-(1-((1-methylpiperidin-2-yl)methyl)-1H-indol-3-yl)(naphthalen-1-yl)methanone
| image = AM-1220_structure.png
| image = AM-1220_structure.png
| width = 200
| width = 200
Line 11: Line 11:
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| pregnancy_category =
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_AU = S9
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_CA = Schedule II
| legal_DE = Anlage II
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| legal_UK = Class B
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_US = Schedule I
| legal_status = banned under analog laws in some US states
| legal_NZ = Temporary Class
| routes_of_administration =
| legal_status =
| routes_of_administration =


<!--Pharmacokinetic data-->
<!--Pharmacokinetic data-->
Line 23: Line 25:
| metabolism =
| metabolism =
| elimination_half-life =
| elimination_half-life =
| excretion =
| excretion =


<!--Identifiers-->
<!--Identifiers-->
| index2_label = (''R'')-enantiomer
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 137642-54-7
| CAS_number = 137642-54-7
| CAS_supplemental = (racemic) <br /> 134959-64-1 ((R) enantiomer)
| CAS_supplemental = (racemic) <br /> 134959-64-1 ((''R'')-enantiomer)
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 05850M72P2
| UNII2_Ref = {{fdacite|correct|FDA}}
| UNII2 = 44NQ9RBE1B
| ATC_prefix =
| ATC_prefix =
| ATC_suffix =
| ATC_suffix =
Line 38: Line 46:
<!--Chemical data-->
<!--Chemical data-->
| C=26 | H=26 | N=2 | O=1
| C=26 | H=26 | N=2 | O=1
| molecular_weight = 382.497 g/mol
| smiles = O=C(C1=CC=CC2=C1C=CC=C2)C3=CN(C[C@@H]4N(C)CCCC4)C5=CC=CC=C53
| smiles = O=C(C1=CC=CC2=C1C=CC=C2)C3=CN(C[C@@H]4N(C)CCCC4)C5=CC=CC=C53
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
Line 46: Line 53:
}}
}}


'''AM-1220''' is a drug which acts as a potent and moderately selective [[agonist]] for the [[cannabinoid receptor]] [[Cannabinoid receptor 1|CB<sub>1</sub>]], with around 19x selectivity for CB<sub>1</sub> over the related [[Cannabinoid receptor 2|CB<sub>2</sub>]] receptor.<ref name="WO 2001 28557 A1">{{Ref patent2 | country = WO | number = 200128557 | status = granted | title = Cannabimimetic indole derivatives | pubdate = 2001-04-26 | gdate = 2001-06-07 | pridate= 1999-10-18 | inventor = Makriyannis A, Deng H | assign1= }}</ref> It was originally invented in the early 1990s by a team led by Thomas D'Ambra at [[Sterling Winthrop]],<ref name="US 5068234">{{Ref patent2 | country = US | number = 5068234 | status = granted | title = 3-arylcarbonyl-1-(C-attached-N-heteryl)-1H-indoles | pubdate = | gdate = 1991-11-26 | pridate= 1990-02-26 | inventor = Thomas E. D'Ambra et al | assign1= }}</ref> but has subsequently been researched by many others, most notably the team led by [[Alexandros Makriyannis]] at the [[University of Connecticut]]. The (piperidin-2-yl)methyl side chain of AM-1220 contains a stereocenter, so there are two [[enantiomer]]s with quite different potency, the (R) enantiomer having a [[Dissociation constant|K<sub>i</sub>]] of 0.27nM at CB<sub>1</sub> while the (S) enantiomer has a much weaker K<sub>i</sub> of 217nM.<ref>{{Cite doi|10.1016/0960-894X(95)00560-G}}</ref> A number of related compounds are known with similar potent cannabinoid activity, with modifications such as substitution of the indole ring at the 2- or 6- positions, the naphthoyl ring substituted at the 4- position or replaced by substituted benzoyl rings or other groups, or the 1-(N-methylpiperidin-2-ylmethyl) group replaced by similar heterocyclic groups such as N-methylpyrrolidin-2-ylmethyl or N-methylmorpholin-3-ylmethyl.<ref name=liganDesign>[http://proquest.umi.com/pqdlink?did=726066941&Fmt=7&clientId=79356&RQT=309&VName=PQD Hongfeng Deng. Design and synthesis of selective cannabinoid receptor ligands: Aminoalkylindole and other heterocyclic analogs. PhD Dissertation, University of Connecticut, 2000.]</ref><ref>{{Cite doi|10.1021/jm0502743}}</ref><ref name="US 7820144">{{Ref patent2 | country = US | number = 7820144 | status = granted | title = Receptor selective cannabimimetic aminoalkylindoles | pubdate = | gdate = 2010-10-26 | pridate= 2007-01-05 | inventor = Alexandros Makriyannis et al | assign1= }}</ref> AM-1220 was first detected as an ingredient of [[synthetic cannabis]] smoking blends in 2010.<ref>[http://www.drugs.ie/downloadDocs/HS_ID_Poster_714-823.pdf Head Shop ‘Legal Highs’ Active Constituents Identification Chart (July - August 2010)]</ref>
'''AM-1220''' is a drug that acts as a potent and moderately selective [[agonist]] for the [[cannabinoid receptor]] [[Cannabinoid receptor 1|CB<sub>1</sub>]], with around 19 times selectivity for CB<sub>1</sub> over the related [[Cannabinoid receptor 2|CB<sub>2</sub>]] receptor.<ref name="WO 2001 28557 A1">{{Ref patent2 |country= WO |number= 200128557 |status= granted |title= Cannabimimetic indole derivatives |pubdate= 2001-04-26 |gdate= 2001-06-07 |pridate= 1999-10-18 |inventor= Makriyannis A, Deng H }}</ref> It was originally invented in the early 1990s by a team led by Thomas D'Ambra at [[Sterling Winthrop]],<ref name="US 5068234">{{Ref patent2 |country= US |number= 5068234 |status= granted |title= 3-arylcarbonyl-1-(C-attached-N-heteryl)-1H-indoles |gdate= 1991-11-26 |pridate= 1990-02-26 |inventor= D'Ambra TE, ''et al.'' }}</ref> but has subsequently been researched by many others, most notably the team led by [[Alexandros Makriyannis]] at the [[University of Connecticut]]. The (piperidin-2-yl)methyl side chain of AM-1220 contains a stereocenter, so there are two [[enantiomer]]s with quite different potency, the (''R'')-enantiomer having a [[Dissociation constant|K<sub>i</sub>]] of 0.27&nbsp;nM at CB<sub>1</sub> while the (''S'')-enantiomer has a much weaker K<sub>i</sub> of 217&nbsp;nM.<ref>{{Cite journal | last1 = D'ambra | first1 = T. | doi = 10.1016/0960-894X(95)00560-G | title = C-Attached aminoalkylindoles: potent cannabinoid mimetics | journal = Bioorganic & Medicinal Chemistry Letters | volume = 6 | pages = 17–22| year = 1996 | issue=1}}</ref>


==Related compounds==
[[Image:AM1220heterocycles.png|300px|thumb|left|Related 1-(N-methylpyrrolidin-2-ylmethyl) and 1-(N-methylmorpholin-3-ylmethyl) derivatives]]{{clear-left}}
A number of related compounds are known with similar potent cannabinoid activity, with modifications such as substitution of the indole ring at the 2- or 6-positions, the naphthoyl ring substituted at the 4-position or replaced by substituted benzoyl rings or other groups, or the 1-(N-methylpiperidin-2-ylmethyl) group replaced by similar heterocyclic groups such as ''N''-methylpyrrolidin-2-ylmethyl or ''N''-methylmorpholin-3-ylmethyl.<ref name=liganDesign>{{Cite thesis |type=PhD. Dissertation |title=Design and synthesis of selective cannabinoid receptor ligands: Aminoalkylindole and other heterocyclic analogs | vauthors = Deng H |year=2000 |publisher=University of Connecticut |id={{ProQuest|304624325}} }}</ref><ref>{{cite journal | vauthors = Willis PG, Pavlova OA, Chefer SI, Vaupel DB, Mukhin AG, Horti AG | title = Synthesis and structure-activity relationship of a novel series of aminoalkylindoles with potential for imaging the neuronal cannabinoid receptor by positron emission tomography | journal = Journal of Medicinal Chemistry | volume = 48 | issue = 18 | pages = 5813–22 | date = September 2005 | pmid = 16134948 | doi = 10.1021/jm0502743 }}</ref><ref name="US 7820144">{{Ref patent2 |country= US |number= 7820144 |status= granted |title= Receptor selective cannabimimetic aminoalkylindoles |gdate= 2010-10-26 |pridate= 2007-01-05 |inventor= Makriyannis A, ''et al.'' }}</ref> AM-1220 was first detected as an ingredient of [[synthetic cannabis]] smoking blends in 2010.<ref>[http://www.drugs.ie/downloadDocs/HS_ID_Poster_714-823.pdf Head Shop ‘Legal Highs’ Active Constituents Identification Chart (July - August 2010)]</ref>


[[Image:AM1220heterocycles.png|300px|thumb|none|Related 1-(''N''-methylpyrrolidin-2-ylmethyl) and 1-(''N''-methylmorpholin-3-ylmethyl) derivatives]]
==See also==

==Legal status==
=== [[United States]] ===
in the [[United States]] of America all CB<sub>1</sub> receptor agonists of the 3-(1-naphthoyl)indole class such as AM-1220 are [[Schedule I Controlled Substances]] under the [[Controlled Substances Act]] s.<ref>{{UnitedStatesCode2|21|812|Schedules of controlled substances}}</ref>
=== [[United Kingdom]] ===
it's illegal to supply, smuggle, distribute, transport, sell or trade the pharmaceutical drug under the [[Psychoactive Substances Act 2016]] which was enforced on May26th 2016.

===China===

As of October 2015, AM-1220 is a controlled substance in China.<ref>{{cite web | url=http://www.sfda.gov.cn/WS01/CL0056/130753.html | title=关于印发《非药用类麻醉药品和精神药品列管办法》的通知 | publisher=China Food and Drug Administration | date=27 September 2015 | language=zh | access-date=1 October 2015 | archive-url=https://web.archive.org/web/20151001222554/http://www.sfda.gov.cn/WS01/CL0056/130753.html | archive-date=1 October 2015 | url-status=dead }}</ref>

== See also ==
* [[A-834,735]]
* [[A-834,735]]
* [[AM-1221]]
* [[AM-1221]]
Line 56: Line 76:
* [[AM-2201]]
* [[AM-2201]]
* [[AM-2233]]
* [[AM-2233]]
* [[Cannabipiperidiethanone]]


==References==
== References ==
{{reflist}}
<references/>


{{Cannabinoids}}
{{Cannabinoids}}


[[Category:Cannabinoids]]
[[Category:Naphthoylindoles]]
[[Category:Naphthoylindoles]]
[[Category:AM cannabinoids]]
[[Category:AM cannabinoids]]
[[Category:Aminoalkylindoles]]
[[Category:Aminoalkylindoles]]
[[Category:Piperidines]]
[[Category:Piperidines]]
[[Category:Designer drugs]]

[[Category:CB1 receptor agonists]]

[[Category:CB2 receptor agonists]]
{{cannabinoid-stub}}