Altrose: Difference between revisions

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 457807456

| ImageSize = 244

| ImageName = Stereo structural formula of (5R)-altrose

| ImageSize1 = 244

| ImageName1 = Stereo structural formula of (6R)-altropyranose

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 389851

| CASNo = 1990-29-0

| CASNo_Comment = (D)

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo1 = 1949-88-8

| CASNo1_Comment = (L)

| CASNo1_Ref = {{cascite|correct|??}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 5PLN1O36FF

| UNII_Comment = (D)

| PubChem = 441032

| PubChem_Comment = (D)

| PubChem1 = 10219674

| PubChem1_Comment = (L)

| ChEBI = 28385

| ChEBI_Comment = (D)

| ChEBI1 = 63421

| ChEBI1_Comment = (L)

| KEGG = C06464

| KEGG_Comment = (D)

| SMILES = OCC(O)[C@@H](O)[C@@H](O)[C@H](O)C=O

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4?,5+,6-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = GZCGUPFRVQAUEE-ZPQYLTHOSA-N}}

|Section2={{Chembox Properties

| C = 6

| H = 12

| O = 6

| MeltingPtC = 103 to 105}}

'''Altrose''' is an [[aldohexose]] sugar. <small>D</small>-Altrose is an unnatural [[monosaccharide]]. It is soluble in water and practically insoluble in [[methanol]]. However, L-altrose has been isolated from strains of the bacterium ''[[Butyrivibrio fibrisolvens]]''.<ref>{{Ref patent |country=US |number=4966845 |title=Microbial production of L-altrose |invent1=Stack; Robert J. |status= patent |gdate=1990-10-30 |assign1=Government of the United States of America, Secretary of Agriculture |class= }}</ref>

Altrose is a C-3 [[epimer]] of [[mannose]]. The ring [[conformational isomerism|conformation]] of α-altropyranoside is flexible compared to most other aldohexopyranosides, with [[idose]] as exception. In solution different derivatives of altrose have been shown to occupy both ⁴C₁, ^OS₂ and ¹C₄-conformations.<ref name="ImmelFujita1999">{{cite journal|last1=Immel|first1=Stefan|last2=Fujita|first2=Kahee|last3=Lichtenthaler|first3=Frieder W.|title=Solution Geometries and Lipophilicity Patterns ofα-Cycloaltrin|journal=Chemistry - A European Journal|volume=5|issue=11|year=1999|pages=3185–3192|issn=0947-6539|doi=10.1002/(SICI)1521-3765(19991105)5:11<3185::AID-CHEM3185>3.0.CO;2-W}}</ref>

{{organic-compound-stub}}

[[Category:Furanoses]]

[[Category:Pyranoses]]