Bismuth subgallate: Difference between revisions
Content deleted Content added
Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'UNII', 'CAS_number'). |
Rescuing 2 sources and tagging 0 as dead.) #IABot (v2.0.9.5) (Whoop whoop pull up - 19463 |
||
(41 intermediate revisions by 29 users not shown) | |||
Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
| Verifiedfields = changed |
||
⚫ | |||
| Watchedfields = changed |
|||
⚫ | |||
| IUPAC_name = 2,7-dihydroxy-1,3,2-benzodioxabismole-5-carboxylic acid |
| IUPAC_name = 2,7-dihydroxy-1,3,2-benzodioxabismole-5-carboxylic acid |
||
| image = Bismuth subgallate.svg |
| image = Bismuth subgallate.svg |
||
| alt = Skeletal formula of bismuth subgallate |
|||
| image2 = Bismuth-subgallate-3D-balls.png |
|||
| alt2 = Ball-and-stick model of the bismuth subgallate molecule |
|||
<!--Clinical data--> |
<!--Clinical data--> |
||
| tradename = |
| tradename = |
||
Line 16: | Line 18: | ||
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
||
| legal_US = OTC |
| legal_US = OTC |
||
| routes_of_administration = |
| routes_of_administration = Oral |
||
<!--Pharmacokinetic data--> |
<!--Pharmacokinetic data--> |
||
| bioavailability = |
| bioavailability = |
||
Line 24: | Line 25: | ||
| elimination_half-life = |
| elimination_half-life = |
||
| excretion = |
| excretion = |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| CASNo_Ref = changed |
|||
| CAS_number_Ref = {{cascite|changed|??}} |
| CAS_number_Ref = {{cascite|changed|??}} |
||
| CAS_number = |
| CAS_number = 99-26-3 |
||
| ATC_prefix = A07 |
| ATC_prefix = A07 |
||
| ATC_suffix = BB |
| ATC_suffix = BB |
||
| PubChem = 16682999 |
| PubChem = 16682999 |
||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
||
| DrugBank = |
| DrugBank = DB13909 |
||
| ChemSpiderID_Ref = {{chemspidercite| |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 10607905 |
| ChemSpiderID = 10607905 |
||
| UNII_Ref = {{fdacite|changed|FDA}} |
| UNII_Ref = {{fdacite|changed|FDA}} |
||
| UNII = |
| UNII = YIW503MI7V |
||
| ChEBI_Ref = {{ebicite| |
| ChEBI_Ref = {{ebicite|correct|EBI}} |
||
| ChEBI = 31292 |
| ChEBI = 31292 |
||
<!--Chemical data--> |
<!--Chemical data--> |
||
| chemical_formula = |
| chemical_formula = |
||
| C=7 | H=5 | Bi=1 | O=6 |
| C=7 | H=5 | Bi=1 | O=6 |
||
| molecular_weight = 394.091 g·mol<sup>−1</sup> |
|||
| smiles = OC(=O)c2cc1O[Bi](O)Oc1c(O)c2 |
| smiles = OC(=O)c2cc1O[Bi](O)Oc1c(O)c2 |
||
⚫ | |||
| InChI = 1/C7H6O5.Bi.H2O/c8-4-1-3(7(11)12)2-5(9)6(4)10;;/h1-2,8-10H,(H,11,12);;1H2/q;+3;/p-3/rC7H5BiO6/c9-4-1-3(7(10)11)2-5-6(4)14-8(12)13-5/h1-2,9,12H,(H,10,11) |
|||
| InChIKey = JAONZGLTYYUPCT-VWHLZXKRAW |
|||
⚫ | |||
| StdInChI = 1S/C7H6O5.Bi.H2O/c8-4-1-3(7(11)12)2-5(9)6(4)10;;/h1-2,8-10H,(H,11,12);;1H2/q;+3;/p-3 |
| StdInChI = 1S/C7H6O5.Bi.H2O/c8-4-1-3(7(11)12)2-5(9)6(4)10;;/h1-2,8-10H,(H,11,12);;1H2/q;+3;/p-3 |
||
| StdInChIKey_Ref = {{stdinchicite| |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChIKey = JAONZGLTYYUPCT-UHFFFAOYSA-K |
| StdInChIKey = JAONZGLTYYUPCT-UHFFFAOYSA-K |
||
| density = 1.1 |
| density = 1.1 |
||
}} |
}} |
||
'''Bismuth subgallate''', with a chemical formula C<sub>7</sub>H<sub>5</sub>BiO<sub>6</sub>, is the active ingredient in '''Devrom''' (internal deodorant), an over-the-counter FDA-approved medicine |
'''Bismuth subgallate''', with a chemical formula C<sub>7</sub>H<sub>5</sub>BiO<sub>6</sub>, is commonly used to treat malodor by deodorizing [[flatulence]] and [[human feces|stools]]. In the United States, it (bismuth subgallate) is the active ingredient in '''Devrom''' (internal deodorant), an over-the-counter FDA-approved medicine. Also, it has been used to treat ''[[Helicobacter pylori]]'' infection and is used in wound therapy. As an internal deodorant, it is commonly used by individuals who have had [[gastrointestinal stoma]] surgery, bariatric surgery, fecal incontinence, and irritable bowel syndrome.<ref>{{cite journal | vauthors = Gorbach SL | title = Bismuth therapy in gastrointestinal diseases | journal = Gastroenterology | volume = 99 | issue = 3 | pages = 863–75 | date = September 1990 | pmid = 2199292 | doi = 10.1016/0016-5085(90)90983-8 | author-link = Sherwood Gorbach }}</ref> |
||
| title = Bismuth therapy in gastrointestinal diseases |
|||
| author = Gorbach S. L. |
|||
| journal = Gastroenterology |
|||
| year = 1990 |
|||
| volume = 99 |
|||
| issue = 3 |
|||
| pages = 863–75 |
|||
| pmid = 2199292 |
|||
}}</ref> |
|||
Also, a double blind study in 1974 reported its effectiveness as a flatulence/stool deodorant in ileostomy patients.<ref>{{cite journal | vauthors = Sparberg M | title = Correspondence: Bismuth subgallate as an effective means for the control of ileostomy odor: a double blind study | journal = Gastroenterology | volume = 66 | issue = 3 | pages = 476 | date = March 1974 | pmid = 4813513 | doi = 10.1016/S0016-5085(74)80150-2 | doi-access = free }}</ref> |
|||
It can cause darkening of the tongue and stools, which is temporary and harmless. |
|||
A reversible [[encephalopathy]] was noted and examined in a few subjects taking bismuth subgallate.<ref>{{cite journal |
|||
| title = Reversible encephalopathy possibly associated with bismuth subgallate ingestion |
|||
| author = Burns R., Thomas D. W., Barron V. J. |
|||
| journal = British Medical Journal |
|||
| year = 1974 |
|||
| volume = 9 |
|||
| issue = 1 |
|||
| pages = 220–3 |
|||
| pmid = 4818163 |
|||
| pmc = 1633100 |
|||
}}</ref> |
|||
== |
==Adverse effects== |
||
It can cause darkening of the tongue and stools, which is temporary.<ref name=medscape>{{cite web|title=Bismuth subgallate (OTC) Devrom|url=http://reference.medscape.com/drug/bismuth-subgallate-999413|website=[[Medscape]]|access-date=2015-12-02}}</ref> |
|||
It is quite nontoxic, but it may cause minor irritation. |
|||
In 1974, a reversible [[encephalopathy]] was noted and examined in four colon cancer patients taking bismuth subgallate after [[abdominoperineal resection]].<ref>{{cite journal | vauthors = Burns R, Thomas DW, Barron VJ | title = Reversible encephalopathy possibly associated with bismuth subgallate ingestion | journal = British Medical Journal | volume = 1 | issue = 5901 | pages = 220–3 | date = February 1974 | pmid = 4818163 | pmc = 1633100 | doi = 10.1136/bmj.1.5901.220 }}</ref> |
|||
⚫ | |||
Bismuth subgallate is contraindicated in case of [[hypersensitivity]] to the substance, and should be used with caution in people with [[liver disease]] or [[kidney disease]].<ref name=medscape/> It is grouped in [[Pregnancy category#United States|pregnancy category C]]<ref name=medscape/> (risk not ruled out: Animal reproduction studies have shown an adverse effect on the fetus and there are no adequate and well-controlled studies in humans, but potential benefits may warrant use of the drug in pregnant women despite potential risks). During [[lactation]], very little bismuth subgallate passes over to the child.<ref name=medscape/> |
|||
== Structure == |
|||
[[File:Structure of bismuth subgallate.tif|thumb|left|The crystal structure of bismuth subgallate.<ref name = "BSGstructure" />]] |
|||
Crystal structure determination of bismuth subgallate revealed it is a [[coordination polymer]] with the formula [Bi(C<sub>6</sub>H<sub>2</sub>(O)<sub>3</sub>COOH)(H<sub>2</sub>O)]<sub>n</sub>2nH<sub>2</sub>O.<ref name="BSGstructure">{{cite journal | vauthors = Wang Y, Takki S, Cheung O, Xu H, Wan W, Öhrström L, Inge AK | title = Elucidation of the elusive structure and formula of the active pharmaceutical ingredient bismuth subgallate by continuous rotation electron diffraction | journal = Chemical Communications | volume = 53 | issue = 52 | pages = 7018–7021 | date = July 2017 | pmid = 28613325 | doi = 10.1039/C7CC03180G | doi-access = free }}</ref> The phenolate oxygen atoms of the gallate ligand chelate to bismuth cations and form chains. The material is nanoporous and the open-channels can be filled with small gas molecules such as carbon dioxide.<ref name = "BSGstructure" /> |
|||
{{-}} |
|||
⚫ | |||
* [[Bismuth]] |
* [[Bismuth]] |
||
* [[Gallic acid]] |
* [[Gallic acid]] |
||
==External links== |
== External links == |
||
* American Cancer Society: Ileostomy Guide [http://www.cancer.org/docroot/CRI/content/CRI_2_6x_Ileostomy.asp] |
* American Cancer Society: Ileostomy Guide [http://www.cancer.org/docroot/CRI/content/CRI_2_6x_Ileostomy.asp] {{Webarchive|url=https://web.archive.org/web/20070929091245/http://www.cancer.org/docroot/CRI/content/CRI_2_6x_Ileostomy.asp |date=2007-09-29 }} |
||
* Cleveland Clinic-Having an Ileostomy– A Primer for New Ostomates [http://my.clevelandclinic.org/Documents/Digestive_Disease/HavingIleostomy.pdf] |
* Cleveland Clinic-Having an Ileostomy– A Primer for New Ostomates [http://my.clevelandclinic.org/Documents/Digestive_Disease/HavingIleostomy.pdf] {{Webarchive|url=https://web.archive.org/web/20120616223912/http://my.clevelandclinic.org/Documents/Digestive_Disease/HavingIleostomy.pdf |date=2012-06-16 }} |
||
⚫ | |||
* United Ostomy Association of America-Ileostomy Guide [http://www.uoaa.org/ostomy_info/pubs/uoa_ileostomy_en.pdf] |
|||
⚫ | |||
* Devrom website [http://www.devrom.com] |
* Devrom website [http://www.devrom.com] |
||
==References== |
== References == |
||
{{reflist}} |
{{reflist}} |
||
{{Bismuth compounds}} |
|||
⚫ | |||
⚫ | |||
⚫ | |||
[[pl:Dermatol]] |
|||
⚫ | |||
[[sv:Dermatol]] |
|||
[[Category:Coordination polymers]] |