U-92,016-A: Difference between revisions

(16 intermediate revisions by 13 users not shown)

Line 1:

{{Drugbox

⚫

| verifiedrevid = 460806839

| Verifiedfields = changed

⚫

| verifiedrevid = ~~407860404~~

| IUPAC_name = (8R)-8-(Dipropylamino)-6,7,8,9-tetrahydro-3H-benz[e]indole-2-carbonitrile

| image = U-92016A_structure.png

Line 8:

| tradename =

| legal_status =

| index2_label = hydrochloride

⚫

| CAS_number_Ref = {{cascite|correct|??}}

| IUPHAR_ligand = 30

⚫

| CAS_number = ~~149654~~-41-1

⚫

| CAS_number_Ref = {{cascite|correct|CAS}}

⚫

| CAS_number = 136924-88-4

| CAS_number2_Ref = {{cascite|correct|CAS}}

| CAS_number2 = 149654-41-1

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 9JQ994EAB3

| UNII2_Ref = {{fdacite|correct|FDA}}

| UNII2 = DSP36A348S

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| ChEMBL_Ref = {{ebicite|~~changed~~|EBI}}

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 71920

| PubChem = 9904242

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 8079896

| smiles = N#Cc3cc1c(ccc2c1C[C@H](N(CCC)CCC)CC2)n3

| smiles = N#Cc3cc1c(ccc2c1C[C@H](N(CCC)CCC)CC2)[nH]3

| InChI = 1/C19H25N3/c1-3-9-22(10-4-2)16-7-5-14-6-8-19-18(17(14)12-16)11-15(13-20)21-19/h6,8,11,16,21H,3-5,7,9-10,12H2,1-2H3/t16-/m1/s1

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

⚫

| ~~InChIKey~~ = WDDZPZKGLZNGEH-~~MRXNPFEDBL~~

| StdInChI = 1S/C19H25N3/c1-3-9-22(10-4-2)16-7-5-14-6-8-19-18(17(14)12-16)11-15(13-20)21-19/h6,8,11,16,21H,3-5,7,9-10,12H2,1-2H3/t16-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = WDDZPZKGLZNGEH-MRXNPFEDSA-N

⚫

| StdInChIKey = WDDZPZKGLZNGEH-MRXNPFEDSA-N

| C=19 | H=25 | N=3

| molecular_weight = 295.421 g/mol

}}

'''U-92,016-A''' is a [[psychoactive drug]] and [[research chemical]] used in scientific studies. It acts as a [[~~Potency_~~(pharmacology)|potent]], high [[Intrinsic activity|efficacy]], and selective [[5-HT1A|5-HT<sub>1A</sub>]] [[receptor (biochemistry)|receptor]] [[full agonist]] with a long duration of action.<ref name="pmid8101876">{{cite journal | doi = 10.1021/jm00067a003 | ~~author~~ = Romero AG, Leiby JA, McCall RB, Piercey MF, Smith MW, Han F. | title = Novel 2-substituted tetrahydro-3H-benz[e]indolamines: highly potent and selective agonists acting at the 5-HT1A receptor as possible anxiolytics and antidepressants. | journal = J Med Chem. | volume = 36 | issue = 15 | pages = 2066–2074 | year = 1993 | pmid = 8101876 }}</ref><ref name="pmid7965808">{{cite journal | ~~author~~ = McCall RB, Romero AG, Bienkowski MJ, Harris DW, McGuire JC, Piercey MF, Shuck ME, Smith MW, Svensson KA, Schreur PJ, ~~et al.~~ | title = Characterization of U-92016A as a selective, orally active, high intrinsic activity 5-hydroxytryptamine1A agonist. | journal = J Pharmacol Exp Ther. | volume = 271 | issue = 2 | pages = 875–883 | year = 1994 | pmid = 7965808 }}</ref> It has been suggested that it could be developed as an [[anxiolytic]] or [[antidepressant]] drug.<ref name="pmid8101876" />

'''U-92,016-A''' is a [[psychoactive drug]] and [[research chemical]] used in scientific studies. It acts as a [[Potency (pharmacology)|potent]], high [[Intrinsic activity|efficacy]], and selective [[5-HT1A|5-HT<sub>1A</sub>]] [[receptor (biochemistry)|receptor]] [[full agonist]] with a long duration of action.<ref name="pmid8101876">{{cite journal | doi = 10.1021/jm00067a003 | vauthors = Romero AG, Leiby JA, McCall RB, Piercey MF, Smith MW, Han F | title = Novel 2-substituted tetrahydro-3H-benz[e]indolamines: highly potent and selective agonists acting at the 5-HT1A receptor as possible anxiolytics and antidepressants. | journal = J Med Chem | volume = 36 | issue = 15 | pages = 2066–2074 | year = 1993 | pmid = 8101876 }}</ref><ref name="pmid7965808">{{cite journal |vauthors=McCall RB, Romero AG, Bienkowski MJ, Harris DW, McGuire JC, Piercey MF, Shuck ME, Smith MW, Svensson KA, Schreur PJ, etal | title = Characterization of U-92016A as a selective, orally active, high intrinsic activity 5-hydroxytryptamine1A agonist. | journal = J Pharmacol Exp Ther | volume = 271 | issue = 2 | pages = 875–883 | year = 1994 | pmid = 7965808 }}</ref> It has been suggested that it could be developed as an [[anxiolytic]] or [[antidepressant]] drug.<ref name="pmid8101876" />

== References ==

Line 41:

Line 48:

[[Category:Serotonin receptor agonists]]

[[Category:Nitriles]]

[[Category:Aminotetralins]]

[[Category:Indoles]]