Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and HU-345: Difference between pages
(Difference between pages)
Content deleted Content added
Saving copy of the {{drugbox}} taken from revid 461633552 of page HU-345 for the Chem/Drugbox validation project (updated: 'ChEMBL'). |
consistent citation formatting |
||
| Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:HU-345|oldid=461633552}} 461633552] of page [[HU-345]] with values updated to verified values.}} |
|||
{{Drugbox |
{{Drugbox |
||
| Watchedfields = changed |
|||
| verifiedrevid = |
| verifiedrevid = 461742669 |
||
| IUPAC_name = 6,6,9- |
| IUPAC_name = 6,6,9-Trimethyl-3-pentyl-1''H''-benzo[''c'']chromene-1,4(6''H'')-dione |
||
| image = HU- |
| image = HU-345 Structure.svg |
||
| CAS_number_Ref = {{cascite|correct|??}} |
| CAS_number_Ref = {{cascite|correct|??}} |
||
| CAS_number = |
| CAS_number = |
||
| ATC_prefix = |
| ATC_prefix = |
||
| ATC_suffix = |
| ATC_suffix = |
||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|||
| ChEMBL = 127671 |
| ChEMBL = 127671 |
||
| PubChem = 11198119 |
| PubChem = 11198119 |
||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
||
| DrugBank = |
| DrugBank = |
||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 9373188 |
| ChemSpiderID = 9373188 |
||
| C=21 | H=24 | O=3 |
|||
| chemical_formula = C<sub>21</sub>H<sub>24</sub>O<sub>3</sub> |
|||
| molecular_weight = 324.414 |
|||
| smiles = O=C2\C(=C/C(=O)C=3c1c(ccc(c1)C)C(OC2=3)(C)C)CCCCC |
| smiles = O=C2\C(=C/C(=O)C=3c1c(ccc(c1)C)C(OC2=3)(C)C)CCCCC |
||
| InChI = 1/C21H24O3/c1-5-6-7-8-14-12-17(22)18-15-11-13(2)9-10-16(15)21(3,4)24-20(18)19(14)23/h9-12H,5-8H2,1-4H3 |
|||
| InChIKey = UFDYTRQMIXJHTH-UHFFFAOYAM |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C21H24O3/c1-5-6-7-8-14-12-17(22)18-15-11-13(2)9-10-16(15)21(3,4)24-20(18)19(14)23/h9-12H,5-8H2,1-4H3 |
| StdInChI = 1S/C21H24O3/c1-5-6-7-8-14-12-17(22)18-15-11-13(2)9-10-16(15)21(3,4)24-20(18)19(14)23/h9-12H,5-8H2,1-4H3 |
||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChIKey = UFDYTRQMIXJHTH-UHFFFAOYSA-N |
| StdInChIKey = UFDYTRQMIXJHTH-UHFFFAOYSA-N |
||
| bioavailability = |
| bioavailability = |
||
| protein_bound = |
| protein_bound = |
||
| metabolism = |
| metabolism = |
||
| elimination_half-life = |
| elimination_half-life = |
||
| excretion = |
| excretion = |
||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
||
| pregnancy_US = <!-- A / B / C / D / X --> |
| pregnancy_US = <!-- A / B / C / D / X --> |
||
| pregnancy_category= |
| pregnancy_category= |
||
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
||
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
||
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
||
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
||
| legal_status = |
| legal_status = |
||
| routes_of_administration = |
| routes_of_administration = |
||
}} |
}} |
||
'''HU-345''' (cannabinol [[quinone]]) is a drug that is able to [[angiogenesis inhibitor|inhibit]] [[aortic ring]] [[angiogenesis]] more potently than its parent compound [[cannabinol]] (CBN).<ref>{{cite journal | vauthors = Kogan NM, Blázquez C, Alvarez L, Gallily R, Schlesinger M, Guzmán M, Mechoulam R | title = A cannabinoid quinone inhibits angiogenesis by targeting vascular endothelial cells | journal = Molecular Pharmacology | volume = 70 | issue = 1 | pages = 51–59 | date = July 2006 | pmid = 16571653 | doi = 10.1124/mol.105.021089 | s2cid = 4830577 }}</ref><ref name="US 0092584">{{Ref patent2 |country= US |number= 0092584 |status= granted |title= Therapeutic Use of Quinonoid Derivatives of Cannabinoids |pubdate= 2011-04-21 |gdate= 2011-04-21 |pridate= 2005-01-14 |inventor= Mechoulam R, Kogan NM, Rabinowitz R, Schlesinger M }}</ref> It exhibits no psychoactive effects on the body. |
|||
HU-345 can be derived through the oxidative degradation of CBN.<ref>{{cite journal | vauthors = Kogan NM, Peters M, Mechoulam R | title = Cannabinoid Quinones-A Review and Novel Observations | journal = Molecules | volume = 26 | issue = 6 | pages = 1761 | date = March 2021 | pmid = 33801057 | pmc = 8003933 | doi = 10.3390/molecules26061761 | doi-access = free }}</ref> |
|||
== See also == |
|||
*[[HU-331]] |
|||
*[[HU-336]] |
|||
== References == |
|||
{{reflist}} |
|||
{{Cannabinoids}} |
|||
{{cannabinoid-stub}} |
|||
[[Category:Angiogenesis inhibitors]] |
|||
[[Category:HU cannabinoids]] |
|||