Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and 2,4-Dimethyl-6-tert-butylphenol: Difference between pages

(Difference between pages)
Page 1
Page 2
Content deleted Content added
VisualWikitext
Saving copy of the {{chembox}} taken from revid 424863123 of page 2,4-Dimethyl-6-tert-butylphenol for the Chem/Drugbox validation project (updated: 'CASNo').
 
No edit summary
Tags: Mobile edit Mobile web edit Advanced mobile edit
 
Line 1: Line 1:
⚫
{{DISPLAYTITLE:2,4-Dimethyl-6-''tert''-butylphenol}}
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid [{{fullurl:2,4-Dimethyl-6-tert-butylphenol|oldid=424863123}} 424863123] of page [[2,4-Dimethyl-6-tert-butylphenol]] with values updated to verified values.}}
{{Chembox
{{Chembox
| Verifiedfields = changed
⚫
| verifiedrevid = 399200995
| Watchedfields = changed
⚫
| Name=2,4-Dimethyl-6-''tert''-butylphenol
⚫
| verifiedrevid = 477211193
⚫
| ImageFile = 2,4-dimethyl-6-tert-butylphenol.png
| Name =2,4-Dimethyl-6-''tert''-butylphenol
⚫
| ImageFile = 2,4-Dimethyl-6-tert-butylphenol Structural Formula V1.svg
| ImageSize =
| ImageSize =
| PIN = 2-''tert''-Butyl-4,6-dimethylphenol
| IUPACName =
| OtherNames = 2-''tert''-butyl-4,6-dimethylphenol, 2,4-dimethyl-6-''tert''-butylphenol, 6-''tert''-butyl-2,4-dimethylphenol, 2-(''tert''-butyl)-4,6-dimethylphenol, 2-''tert''-butyl-4,6-dimethyl phenol, 6-''t''-butyl-2,4-xylenol, 2-(1,1-dimethylethyl)-4,6-dimethyl-phenol
| OtherNames = 2,4-Dimethyl-6-''tert''-butylphenol<br />6-''tert''-Butyl-2,4-dimethylphenol<br />2-(''tert''-Butyl)-4,6-dimethylphenol<br />2-''tert''-Butyl-4,6-dimethyl phenol<br />6-''t''-Butyl-2,4-xylenol<br />2-(1,1-Dimethylethyl)-4,6-dimethyl-phenol
| Section1 = {{Chembox Identifiers
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 15097
| ChemSpiderID = 15097
| InChI = 1/C12H18O/c1-8-6-9(2)11(13)10(7-8)12(3,4)5/h6-7,13H,1-5H3
| InChI = 1/C12H18O/c1-8-6-9(2)11(13)10(7-8)12(3,4)5/h6-7,13H,1-5H3
Line 17: Line 19:
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = OPLCSTZDXXUYDU-UHFFFAOYSA-N
| StdInChIKey = OPLCSTZDXXUYDU-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|changed|??}}
| CASNo = <!-- blanked - oldvalue: 1879-09- -->
| CASNo = 1879-09-0
|
| PubChem =
| PubChem = 15884
| EC_number = 217-533-1
⚫
| SMILES = CC(C)(C)c1c(O)c(C)cc(C)c1
| UNNumber = 2430
| UNII = 4HZG7U1P1S
| ChEMBL = 3561934
⚫
| SMILES = CC(C)(C)c1c(O)c(C)cc(C)c1
}}
}}
| Section2 = {{Chembox Properties
|Section2={{Chembox Properties
| Formula =
| Formula = C<sub>12</sub>H<sub>18</sub>O
| MolarMass =
| MolarMass =
| Appearance =
| Appearance =
| Density =
| Density =
| MeltingPt = 21-23 °C
| MeltingPtC = 21 to 23
| MeltingPt_notes =
| BoilingPt = 248-249 °C
| BoilingPtC = 248 to 249
⚫
| Solubility =
| BoilingPt_notes =
⚫
}}
⚫
| Solubility =
⚫
| Section3 = {{Chembox Hazards
⚫
| MainHazards =
⚫
| FlashPt =
| Autoignition =
}}
}}
⚫
|Section3={{Chembox Hazards
| GHSPictograms = {{GHS06}}{{GHS07}}{{GHS08}}{{GHS09}}
| GHSSignalWord = Danger
| HPhrases = {{H-phrases|301|302|310|315|319|373|411}}
| PPhrases = {{P-phrases|260|262|264|270|273|280|301+310|301+312|302+350|302+352|305+351+338|310|314|321|322|330|332+313|337+313|361|362|363|391|405|501}}
⚫
| MainHazards =
⚫
| FlashPt =
| AutoignitionPt =
⚫
}}
}}
}}

'''2,4-Dimethyl-6-''tert''-butylphenol''' is the [[organic compound]] with the formula Me<sub>2</sub>(''tert''-Bu)C<sub>6</sub>H<sub>2</sub>OH (Me = [[methyl]], ''tert''-Bu = tertiary butyl). It is a colorless oil that is classified as an [[alkyl]]ated [[phenol]].<ref name=Ullmann/>

==Preparation, reactions, uses==
It is used as an [[antioxidant]], e.g. to prevent gumming in [[fuel]]s, and as an ultraviolet stabilizer. It is used in [[jet fuel]]s, [[gasoline]]s, and [[avgas]].

It is prepared by alkylation of xylenol with [[isobutylene]]. This alkylation provides a means to separate 2,4-xylenol from 2,5-xylenol since 2,4-dimethyl-6-tert-butylphenol is insoluble in 10% NaOH but 2,5-dimethyl-6-tert-butylphenol is soluble. Subsequent to separation, the tert-butyl group can be removed in strong acid.<ref name=Ullmann>{{Ullmann|doi=10.1002/14356007.a08_025 |title=Cresols and Xylenols |year=2000 |last1=Fiege |first1=Helmut | name-list-style = vanc |isbn=3-527-30673-0}}</ref>

==Tradenames==
One of its trade names is '''Topanol A'''. It is found in antioxidant mixtures AO-30, AO-31, AO-32, IONOL K72, IONOL K78, IONOL K98, and others.

==See also==
*[[2,6-Di-tert-butylphenol|2,6-Di-''tert''-butylphenol]]
*[[Butylated hydroxytoluene]]
*[[Propofol]] (Structural isomer)
*[[List of gasoline additives]]

==References==
{{Reflist}}

{{Motor fuel}}
{{Antioxidants}}

{{DEFAULTSORT:Dimethyl-6-Tert-Butylphenol, 2,4-}}
[[Category:Antioxidants]]
[[Category:Alkylphenols]]
[[Category:Fuel antioxidants]]
[[Category:Tert-butyl compounds]]
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"