Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and AL-37350A: Difference between pages

(Difference between pages)
Page 1
Page 2
Content deleted Content added
Saving copy of the {{drugbox}} taken from revid 465948585 of page AL-37350A for the Chem/Drugbox validation project (updated: 'ChEMBL').
 
No edit summary
Tags: Mobile edit Mobile web edit Advanced mobile edit
 
Line 1: Line 1:
{{Short description|Chemical compound}}
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:AL-37350A|oldid=465948585}} 465948585] of page [[AL-37350A]] with values updated to verified values.}}
{{Drugbox
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 462572977
| Watchedfields = changed
| verifiedrevid = 477346561
| IUPAC_name = (''S'')-(+)-1-(2-Aminopropyl)-8,9-dihydropyrano[3,2-''e'']indole
| IUPAC_name = (''S'')-(+)-1-(2-Aminopropyl)-8,9-dihydropyrano[3,2-''e'']indole
| image = AL-37350A_structure.png
| image = AL-37350A Structure.svg
| width = 140
| width = 140


Line 16: Line 18:
| legal_US =
| legal_US =
| legal_status =
| legal_status =
| routes_of_administration =
| routes_of_administration =


<!--Pharmacokinetic data-->
<!--Pharmacokinetic data-->
Line 23: Line 25:
| metabolism =
| metabolism =
| elimination_half-life =
| elimination_half-life =
| excretion =
| excretion =


<!--Identifiers-->
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number =
| CAS_number = 362603-40-5
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = KT54N4CC67
| ATC_prefix =
| ATC_prefix =
| ATC_suffix =
| ATC_suffix =
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 133455
| ChEMBL = 133455
| PubChem = 10331436
| PubChem = 10331436
| IUPHAR_ligand = 160
| IUPHAR_ligand = 160
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 8506896
| ChemSpiderID = 8506896
| SMILES = O2c1ccc3c(c1CCC2)c(cn3)C[C@@H](N)C
| InChI = 1/C14H18N2O/c1-9(15)7-10-8-16-12-4-5-13-11(14(10)12)3-2-6-17-13/h4-5,8-9,16H,2-3,6-7,15H2,1H3/t9-/m0/s1
| InChIKey = VVHJUSGIUWQPIT-VIFPVBQEBB
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C14H18N2O/c1-9(15)7-10-8-16-12-4-5-13-11(14(10)12)3-2-6-17-13/h4-5,8-9,16H,2-3,6-7,15H2,1H3/t9-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = VVHJUSGIUWQPIT-VIFPVBQESA-N


<!--Chemical data-->
<!--Chemical data-->
| C=14 | H=18 | N=2 | O=1
| C=14 | H=18 | N=2 | O=1
| smiles = O2c1ccc3c(c1CCC2)c(c[nH]3)C[C@@H](N)C
| molecular_weight = 230.305 g/mol
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| smiles = CC(N)Cc3cnc2ccc1OCCCc1c23
| StdInChI = 1S/C14H18N2O/c1-9(15)7-10-8-16-12-4-5-13-11(14(10)12)3-2-6-17-13/h4-5,8-9,16H,2-3,6-7,15H2,1H3/t9-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = VVHJUSGIUWQPIT-VIFPVBQESA-N
| melting_point =
| melting_point =
| melting_high =
| melting_high =
}}
}}
'''AL-37350A''' ('''4,5-DHP-AMT''') is a tricyclic [[tryptamine]] derivative which acts as a potent and selective [[agonist]] for the [[serotonin]] [[Receptor (biochemistry)|receptor]] [[5-HT2A receptor|5-HT<sub>2A</sub>]], with a [[Dissociation constant#Protein-ligand binding|Ki]] of 2.0 nM, and moderate selectivity over the related 5-HT<sub>2B</sub> and 5-HT<sub>2C</sub> receptors. It has been shown to have [[Intraocular pressure|ocular hypotensive]] activity in animal models, suggesting it may be useful for the treatment of [[glaucoma]].<ref name="pmid12954071">{{cite journal |vauthors =May JA, Chen HH, Rusinko A, Lynch VM, Sharif NA, McLaughlin MA |title=A novel and selective 5-HT2 receptor agonist with ocular hypotensive activity: (S)-(+)-1-(2-aminopropyl)-8,9-dihydropyrano[3,2-e]indole |journal=Journal of Medicinal Chemistry |volume=46 |issue=19 |pages=4188–95 |date=September 2003 |pmid=12954071 |doi=10.1021/jm030205t |citeseerx=10.1.1.688.6169 }}</ref>

==See also==
* [[Ramelteon]]
* [[AL-38022A]]
* [[CP-132,484]]
* [[1-(2-Dimethylaminoethyl)dihydropyrano(3,2-e)indole|4,5-DHP-DMT]]

== References ==
{{reflist}}

{{Hallucinogens}}
{{Serotonergics}}
{{Tryptamines}}

[[Category:Dihydropyrans]]
[[Category:Serotonin receptor agonists]]
[[Category:Tryptamines]]


{{nervous-system-drug-stub}}