Jump to content

Angiotensinamide

From Wikipedia, the free encyclopedia

This is an old revision of this page, as edited by DePiep (talk | contribs) at 14:53, 2 April 2016 (Remove redundant parameters InChI, InChIKey (StdInChI, StdInChIKey are used). See Talk (via AWB script)). The present address (URL) is a permanent link to this revision, which may differ significantly from the current revision.

{{Drugbox | verifiedrevid = 459715971 | IUPAC_name = 2-[(1-{2-[2-(2-{2-[2-(2-amino-3-carbamoylpropanamido)-5-[(diaminomethylidene)amino]pentanamido]-3-methylbutanamido}-3-(4-hydroxyphenyl)propanamido)-3-methylbutanamido]-3-(1H-imidazol-5-yl)propanoyl}pyrrolidin-2-yl)formamido]-3-phenylpropanoic acid | image = Angiotensinamide.svg | tradename = | pregnancy_category = | legal_status = | routes_of_administration = Intravenous infusion | bioavailability = | metabolism = | elimination_half-life = | excretion = | CAS_number_Ref =  checkY | CAS_number = 53-73-6 | ATC_prefix = C01 | ATC_suffix = CX06 | DrugBank_Ref =  checkY | DrugBank = | UNII_Ref =  checkY | UNII = 7WAL1X78KV | KEGG_Ref =  checkY | KEGG = D02939 | ChEMBL = 409803 | PubChem = 10351092 | ChemSpiderID_Ref =  checkY | ChemSpiderID = 8526544 | smiles = O=C(N)C[C@H](N)C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N2[C@H](C(=O)N[C@H](C(=O)O)Cc1ccccc1)CCC2)Cc3cncn3)C(C)C)Cc4ccc(O)cc4)C(C)C)CCC/N=C(\N)N | StdInChI_Ref =  checkY | StdInChI = 1S/C49H70N14O11/c1-26(2)39(61-42(67)33(12-8-18-55-49(52)53)57-41(66)32(50)23-38(51)65)45(70)58-34(20-29-14-16-31(64)17-15-29)43(68)62-40(27(3)4)46(71)59-35(22-30-24-54-25-56-30)47(72)63-19-9-13-37(63)44(69)60-36(48(73)74)21-28-10-6-5-7-11-28/h5-7,10-11,14-17,24-27,32-37,39-40,64H,8-9,12-13,18-23,50H2,1-4H3,(H2,51,65)(H,54,56)(H,57,66)(H,58,70)(H,59,71)(H,60,69)(H,61,67)(H,62,68)(H,73,74)(H4,52,53,55)/t32-,33-,34-,35-,36-,37-,39-,40-/m0/s1 | StdInChIKey_Ref =  checkY | StdInChIKey = JYPVVOOBQVVUQV-CGHBYZBKSA-N | C=49 | H=70 | N=14 | O=11 | molecular_weight = 1031.17 g/mol }}

Angiotensinamide (INN; BAN and USAN angiotensin amide) is a potent vasoconstrictor used as a cardiac stimulant. It is a derivative of angiotensin II.

See also