Fenpropimorph
{{Chembox | ImageFile = Fenpropimorph.svg | ImageSize = | IUPACName = cis-2,6-Dimethyl-4-{2-methyl-3-[4-(2-methyl-2-propanyl)phenyl]propyl}morpholine or (2R,6S)-4-[3-(4-tert-butylphenyl)-2-methylpropyl]-2,6-dimethylmorpholine | OtherNames = BAS 42100F; Corbel; Forbel 750; Mistral |Section1=! colspan=2 style="background: #f8eaba; text-align: center;" |Identifiers
|-
|
|
|-
|
|
|-
| ChEBI
|
|- | ChEMBL
|
|- | ChemSpider
|
|-
| ECHA InfoCard | 100.060.636 |-
|
|
|-
|
|
|-
| colspan="2" |
- InChI=1S/C20H33NO/c1-15(12-21-13-16(2)22-17(3)14-21)11-18-7-9-19(10-8-18)20(4,5)6/h7-10,15-17H,11-14H2,1-6H3/t15?,16-,17+Key: RYAUSSKQMZRMAI-ALOPSCKCSA-N
- InChI=1/C20H33NO/c1-15(12-21-13-16(2)22-17(3)14-21)11-18-7-9-19(10-8-18)20(4,5)6/h7-10,15-17H,11-14H2,1-6H3/t15?,16-,17+Key: RYAUSSKQMZRMAI-ALOPSCKCBN
|-
| colspan="2" |
- O2[C@H](CN(CC(C)Cc1ccc(cc1)C(C)(C)C)C[C@H]2C)C
|- |Section2=! colspan=2 style="background: #f8eaba; text-align: center;" |Properties
|-
|
| C20H33NO
|- | Molar mass
| 303.490 g·mol−1
|- | Appearance | Colorless liquid[1] |-
| Boiling point | 120 °C (248 °F; 393 K) (0.067 mbar)[1]
|-
|
| 4.3 mg/L (20 °C)[1] |- |Section3= }}
Fenpropimorph is a morpholine-derived fungicide used in agriculture, primarily on cereal crops such as wheat.[1] It works by inhibiting the sterol pathway of the fungus while plants are unaffected [2]
External links
- Fenpropimorph, alanwood.net
- Fenpropimorph in the Pesticide Properties DataBase (PPDB)
References
- ^ a b c d Fenpropimorph, Food and Agriculture Organization of the United Nations
- ^ [1] Antifungal Agents: Chemotherapeutic Targets and Immunologic Strategies, NAFSIKA H. GEORGOPAPADAKOU AND THOMAS J. WALSH, PMID 8834867