User:Eloil/Harmine
| Eloil/Harmine | |
|---|---|
| Eloil/Harmine | |
| Systematic name | 7-MeO-1-Me-9H-pyrido[3,4-b]-indole |
| Chemical formula | C13H12N2O |
| Molecular mass | 212.25 g/mol |
| Melting point | 321 °C (·HCl) |
| 262 °C (·HCl·2H2O)[1] | |
| CAS number | [442-51-3] |
| SMILES | CC1=NC=CC2=C1NC3=C2C=CC(=C3)OC |
| Disclaimer and references | |
Harmine is an alkaloid belonging to the Beta-carboline family of compounds. It occurs in a number of different plants, notably harmal or syrian rue (Peganum harmala) and Banisteriopsis caapi ('yage', 'ayahuasca'). Harmine is a reversible monoamine oxidase inhibitor and CNS stimulant.
Natural sources[edit]
Harmine is found in a wide variety of different organisms, most of which are plants. Shulgin (1997)[2] lists thirty different species known to contain harmine, including seven species of butterfly in the Nymphalidae family.