Jump to content

User:Graeme Bartlett/SB202190

From Wikipedia, the free encyclopedia

listed on https://en.wikipedia.org/wiki/User:MichaK/Missing_chemicals

https://pubchem.ncbi.nlm.nih.gov/compound/5353940 IUPAC Name = 4-[4-(4-fluorophenyl)-5-pyridin-4-yl-1,3-dihydroimidazol-2-ylidene]cyclohexa-2,5-dien-1-one

CASNo = 152121-30-7

UNII = PVX798P8GI wikidata = https://www.wikidata.org/wiki/Q27164687 ChEBI=79090 InChI=1S/C20H14FN3O/c21-16-5-1-13(2-6-16)18-19(14-9-11-22-12-10-14)24-20(23-18)15-3-7-17(25)8-4-15/h1-12,23-24H InChIKey= NJNKPVPFGLGHPA-UHFFFAOYSA-N SMILES = C1=CC(=O)C=CC1=C2NC(=C(N2)C3=CC=NC=C3)C4=CC=C(C=C4)F

| GHSPictograms = GHS07: Exclamation mark | GHSSignalWord = Warning | HPhrases = H315, H319, H335 | PPhrases = P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, P501 SB202190 is an enzyme inhibitor. P38 MAP Kinase inhibition

It is a 1H-imidazole. Position 2 has a 4-hydroxyphenyl group. Position 4 has a pyridin-4-yl group, and position 5 has a 4-fluorophenyl group.