Sivelestat
{{Drugbox | IUPAC_name = N-{2-[({4-[(2,2-dimethylpropanoyl)oxy]phenyl}sulfonyl)amino]benzoyl}glycine | image = Sivelestat.png | CAS_number = 127373-66-4 | CAS_supplemental = | ATC_prefix = | ATC_suffix = | ATC_supplemental = | PubChem = 107706 | DrugBank = | chemical_formula = | C=20 | H=22 | N=2 | O=7 | S=1 | molecular_weight = 434.46 g/mol | smiles = CC(C)(C)C(=O)OC1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC=C2C(=O)NCC(=O)O | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | pregnancy_AU = | pregnancy_US = | pregnancy_category= | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = Rx-only | routes_of_administration = IV }}
Sivelestat (INN, research name ONO 5046, marketed as Elaspol) is an inhibitor of human neutrophil elastase.[1]
It is commonly used in the treatment of acute respiratory failure.[2]
References
- ^ Kawabata K, Suzuki M, Sugitani M, Imaki K, Toda M, Miyamoto T (1991). "ONO-5046, a novel inhibitor of human neutrophil elastase". Biochem. Biophys. Res. Commun. 177 (2): 814–20. doi:10.1016/0006-291X(91)91862-7. PMID 2049103.
{{cite journal}}: Unknown parameter|month=ignored (help)CS1 maint: multiple names: authors list (link) - ^ Imokawa S, Mori K, Harada M; et al. (2008). "[Acute respiratory failure due to pneumocystis pneumonia successfully treated with combined use of sivelestat sodium hydrate]". Nihon Kokyuki Gakkai Zasshi (in Japanese). 46 (6): 461–5. PMID 18592991.
{{cite journal}}: Explicit use of et al. in:|author=(help); Unknown parameter|month=ignored (help)CS1 maint: multiple names: authors list (link)
 | This pharmacology-related article is a stub. You can help Wikipedia by expanding it. |