Template:Infobox mineral: Difference between revisions
added Z -- number of unit cells for a formula unit, fixed spelling of symmetry (checked against British, also apparently misspelled in British) |
opps |
||
Line 22: | Line 22: | ||
| label6 = [[Hermann–Mauguin notation|Crystal symmetry]] |
| label6 = [[Hermann–Mauguin notation|Crystal symmetry]] |
||
| data6 = {{{symmetry}}} |
| data6 = {{{symmetry|}}} |
||
| label7 = Z |
| label7 = Z |
Revision as of 19:44, 16 September 2009
![]() | This template uses Lua: |
This template is used on pages about minerals as well as gemstones to provide handy easy to access data about that mineral.
{{{name}}} | |
---|---|
[[File:{{{image}}}|Template:Px|alt={{{alt}}}]] {{{caption}}} | |
General | |
Category | {{{category}}} |
Chemical formula | {{{formula}}} |
Strunz classification | {{{strunz}}} |
Dana classification | {{{dana}}} |
Crystal symmetry | {{{symmetry}}} |
Identification | |
Molar mass | {{{molweight}}} |
Colour | {{{color}}} |
Crystal habit | {{{habit}}} |
Crystal system | {{{system}}} |
Twinning | {{{twinning}}} |
Cleavage | {{{cleavage}}} |
Fracture | {{{fracture}}} |
Tenacity | {{{tenacity}}} |
Mohs scale hardness | {{{mohs}}} |
Lustre | {{{luster}}} |
Streak | {{{streak}}} |
Specific gravity | {{{gravity}}} |
Density | {{{density}}} |
Polish lustre | {{{polish}}} |
Optical properties | {{{opticalprop}}} |
Refractive index | {{{refractive}}} |
Birefringence | {{{birefringence}}} |
Pleochroism | {{{pleochroism}}} |
2V angle | {{{2V}}} |
Dispersion | {{{dispersion}}} |
Extinction | {{{extinction}}} |
Length fast/slow | {{{length fast/slow}}} |
Ultraviolet fluorescence | {{{fluorescence}}} |
Absorption spectra | {{{absorption}}} |
Melting point | {{{melt}}} |
Fusibility | {{{fusibility}}} |
Diagnostic features | {{{diagnostic}}} |
Solubility | {{{solubility}}} |
Common impurities | {{{impurities}}} |
Alters to | {{{alteration}}} |
Other characteristics | {{{other}}} |
{{{prop1}}} | {{{prop1text}}} |
References | {{{references}}} |
Major varieties | |
{{{var1}}} | {{{var1text}}} |
{{{var2}}} | {{{var2text}}} |
{{{var3}}} | {{{var3text}}} |
{{{var4}}} | {{{var4text}}} |
{{{var5}}} | {{{var5text}}} |
{{{var6}}} | {{{var6text}}} |
Usage
Most field names are in lowercase.
Copy a blank version to use. Please delete any unused fields to avoid clutter in the edit window.
Ruby | |
---|---|
![]() A naturally occurring ruby crystal | |
General | |
Category | Mineral variety |
Chemical formula | aluminium oxide with chromium, Al2O3:Cr |
Crystal symmetry | R3c (No. 167) |
Identification | |
Color | Red, may be brownish, purplish or pinkish |
Crystal habit | Varies with locality. Terminated tabular hexagonal prisms. |
Crystal system | Trigonal |
Cleavage | No true cleavage |
Fracture | Uneven or conchoidal |
Mohs scale hardness | 9.0 |
Luster | Vitreous |
Streak | white |
Specific gravity | 4.0 |
Refractive index | nω=1.768 - 1.772 nε=1.760 - 1.763, Birefringence 0.008 |
Pleochroism | Orangey red, purplish red |
Ultraviolet fluorescence | red under longwave |
Melting point | 2044 °C |
Solubility | none |
Major varieties | |
Sapphire | Any color except red and violet |
Oriental amethyst | violet color |
Corundum | various colors (mineral species) |
Emery | Granular (mineral mixture) |
{{Infobox mineral
| name =
| boxwidth =
| boxbgcolor =
| image =
| imagesize =
| alt =
| caption =
| struct image =
| struct caption =
| struct imagesize =
| struct2 image =
| struct2 caption =
| struct2 imagesize=
| SMILES =
| Jmol =
| category =
| formula =
| IMAsymbol =
| molweight =
| strunz =
| dana =
| system =
| class =
| symmetry =
| unit cell =
| color =
| colour =
| habit =
| twinning =
| cleavage =
| fracture =
| tenacity =
| mohs =
| luster =
| streak =
| diaphaneity =
| gravity =
| density =
| polish =
| opticalprop =
| refractive =
| birefringence =
| pleochroism =
| 2V =
| dispersion =
| extinction =
| length fast/slow =
| fluorescence =
| absorption =
| melt =
| Curie temp =
| fusibility =
| diagnostic =
| solubility =
| impurities =
| alteration =
| other =
| prop1 =
| prop1text =
| references =
| var1 =
| var1text =
| var2 =
| var2text =
| var3 =
| var3text =
| var4 =
| var4text =
| var5 =
| var5text =
| var6 =
| var6text =
}}
All parameters used
name | |
---|---|
![]() caption | |
General | |
Category | category |
Chemical formula | formula |
Strunz classification | strunz |
Dana classification | dana |
Crystal symmetry | symmetry |
Identification | |
Molar mass | molweight |
Colour | color |
Crystal habit | habit |
Crystal system | system |
Twinning | twinning |
Cleavage | cleavage |
Fracture | fracture |
Tenacity | tenacity |
Mohs scale hardness | mohs |
Lustre | luster |
Streak | streak |
Specific gravity | gravity |
Density | density |
Polish lustre | polish |
Optical properties | opticalprop |
Refractive index | refractive |
Birefringence | birefringence |
Pleochroism | pleochroism |
2V angle | 2V |
Dispersion | dispersion |
Extinction | extinction |
Length fast/slow | length fast/slow |
Ultraviolet fluorescence | fluorescence |
Absorption spectra | absorption |
Melting point | melt |
Fusibility | fusibility |
Diagnostic features | diagnostic |
Solubility | solubility |
Common impurities | impurities |
Alters to | alteration |
Other characteristics | other |
prop1 | prop1text |
References | references |
Major varieties | |
var1 | var1text |
var2 | var2text |
var3 | var3text |
var4 | var4text |
var5 | var5text |
var6 | var6text |
| image = Tridymite tabulars - Ochtendung, Eifel, Germany.jpg
| imagesize = 260px
|struct image=a-tridymite.png
|struct caption=Crystal structure of α-tridymite
|struct imagesize=150px
|struct2 image=Diamond lattice.stl
|struct2 caption=Some other image
|struct2 imagesize=200px
|SMILES = O[C@@H]4C/C3=C/C=C1\[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@H](C)CCCC(C)C)C)[C@@]3(C)CC4
|Jmol= C([C@@H]([C@@H]1C(=C(C(=O)O1)O)O)O)O<!-- different so will show difgferent struct - to test -->
|boxbgcolor = yellow
| 2V = 2V
| absorption = absorption
| alt = alt
| alteration = alteration
| birefringence = birefringence
| boxtextcolor = boxtextcolor
| boxwidth = boxwidth
| caption = caption
| category = category
| class = class
| cleavage = cleavage
| color = color
| colour = colour
| dana = dana
| density = density
| diagnostic = diagnostic
| diaphaneity = diaphaneity
| dispersion = dispersion
| extinction = extinction
| fluorescence = fluorescence
| formula = formula
| fracture = fracture
| fusibility = fusibility
| gravity = gravity
| habit = habit
| IMAsymbol = IMAsymbol
| impurities = impurities
| length fast/slow = length fast/slow
| luster = luster
| lustre = lustre
| melt = melt
| mohs = mohs
| molweight = molweight
| name = name
| opticalprop = opticalprop
| other = other
| pleochroism = pleochroism
| polish = polish
| polish lustre = polish lustre
| prop1 = prop1
| prop1text = prop1text
| references = references
| refractive = refractive
| solubility = solubility
| streak = streak
| strunz = strunz
| symmetry = symmetry
| system = system
| tenacity = tenacity
| twinning = twinning
| unit cell = unit cell
| var1 = var1
| var1text = var1text
| var2 = var2
| var2text = var2text
| var3 = var3
| var3text = var3text
| var4 = var4
| var4text = var4text
| var5 = var5
| var5text = var5text
| var6 = var6
| var6text = var6text
Description
This should describe the parameters used in this template.
Parameter | Explanation | Example |
---|---|---|
name | IMA mineral name (if there is another common name, put it in parentheses) | Baryte (Barite) |
boxwidth | ||
boxbgcolor | Background color of box headers | |
boxtextcolor | Text color of box headers | |
image | Wikimedia Commons image filename (to go at top) | Epidoto.jpeg |
imagesize | ||
alt | alt text for image, for visually impaired readers; see WP:ALT | Agglomeration of dark cylindrical crystals |
caption | image caption | Epidote crystals |
category | broad group then subgroup then sub-subgroup (if applicable) template does not auto-link | Sulfate minerals, Barite group |
formula | chemical formula giving the elemental composition of a repeating unit of an alloy, a polymer, a crystal structure, a chain, or a network | BaSO4 |
IMAsymbol | IMA symbol of the mineral | Brt |
strunz | Nickel-Strunz classification of the mineral (10 ed, MinDat) | 9.BG.05 |
dana | Dana classification of the mineral | 28.03.01.01 |
symmetry | Hermann–Mauguin notation of the mineral's symmetry element, labeled: Space group | |
unit cell | Unit cell dimensions and number (Z) of formula units per unit cell | |
molweight | molar mass of the chemical formula above | |
color | common colors of the mineral | |
colour | same as above, but for British pages | |
habit | common mineral habit | |
system | crystal system (cubic, etc.) | |
class | crystal class | |
twinning | common type of twinning | |
cleavage | type of cleavage | |
fracture | type of fracture (appearance of broken surface) | irregular |
tenacity | tenacity (how the mineral can deform or break) | brittle |
mohs | hardness (scratchability) of mineral on Mohs hardness scale | 3-3.5 |
luster | way the mineral reflects light, see luster | |
lustre | same as above, but for British pages | |
streak | see streak | |
diaphaneity | transparency of mineral | |
gravity | specific gravity | |
density | density at STP in g/cm3 | |
polish | ability to take a polish | |
opticalprop | ||
refractive | refractive index of mineral | |
birefringence | birefringence of a 30micron thin section | |
pleochroism | see pleochroism | |
2V | 2V angle | |
dispersion | see dispersion | |
extinction | extinction angle, e.g. "parallel", or "inclined" and a quantitative angle. Irrelevant for minerals without an extinction angle (isotropic, opaque, or amorphous minerals). | |
length fast/slow | Sign of elongation: length fast or length slow | |
fluorescence | see fluorescence | |
absorption | see absorption | |
melt | melting point of mineral | |
Curie | Curie temperature of mineral | |
fusibility | fusibility of mineral | |
diagnostic | key way to recognize mineral | |
solubility | solubility of mineral in water at STP | |
impurities | common impurities | |
alteration | alteration products | |
other | ||
prop1 | ||
prop1text | ||
references | use the Wikipedia template:ref to cite | References supporting the properties to be added at that line using <ref>...</ref> tag notation. Individual items can be tagged separately if needed. |
var1 | ||
var1text | ||
var2 | ||
var2text | ||
var3 | ||
var3text | ||
var4 | ||
var4text | ||
var5 | ||
var5text | ||
var6 | ||
var6text |
TemplateData
TemplateData for Infobox mineral
No description.
Parameter | Description | Type | Status | |
---|---|---|---|---|
boxwidth | boxwidth | no description | Unknown | optional |
boxtextcolor | boxtextcolor | no description | Unknown | optional |
boxbgcolor | boxbgcolor | no description | Unknown | optional |
name | name | no description | Unknown | optional |
image | image | no description | Unknown | optional |
imagesize | imagesize | no description | Unknown | optional |
alt | alt | no description | Unknown | optional |
caption | caption | no description | Unknown | optional |
category | category | no description | Unknown | optional |
formula | formula | no description | Unknown | optional |
IMAsymbol | IMAsymbol | no description | Unknown | optional |
strunz | strunz | no description | Unknown | optional |
system | system | no description | Unknown | optional |
dana | dana | no description | Unknown | optional |
class | class | no description | Unknown | optional |
symmetry | symmetry | no description | Unknown | optional |
unit cell | unit cell | no description | Unknown | optional |
molweight | molweight | no description | Unknown | optional |
color | color | no description | Unknown | optional |
habit | habit | no description | Unknown | optional |
twinning | twinning | no description | Unknown | optional |
cleavage | cleavage | no description | Unknown | optional |
fracture | fracture | no description | Unknown | optional |
tenacity | tenacity | no description | Unknown | optional |
mohs | mohs | no description | Unknown | optional |
luster | luster | no description | Unknown | optional |
polish | polish | no description | Unknown | optional |
opticalprop | opticalprop | no description | Unknown | optional |
refractive | refractive | no description | Unknown | optional |
birefringence | birefringence | no description | Unknown | optional |
pleochroism | pleochroism | no description | Unknown | optional |
2V | 2V | no description | Unknown | optional |
dispersion | dispersion | no description | Unknown | optional |
extinction | extinction | no description | Unknown | optional |
length fast/slow | length fast/slow | no description | Unknown | optional |
fluorescence | fluorescence | no description | Unknown | optional |
absorption | absorption | no description | Unknown | optional |
streak | streak | no description | Unknown | optional |
gravity | gravity | no description | Unknown | optional |
density | density | no description | Unknown | optional |
melt | melt | no description | Unknown | optional |
fusibility | fusibility | no description | Unknown | optional |
diagnostic | diagnostic | no description | Unknown | optional |
solubility | solubility | no description | Unknown | optional |
diaphaneity | diaphaneity | no description | Unknown | optional |
impurities | impurities | no description | Unknown | optional |
alteration | alteration | no description | Unknown | optional |
other | other | no description | Unknown | optional |
prop1text | prop1text | no description | Unknown | optional |
references | references | no description | Unknown | optional |
colour | colour | no description | Unknown | optional |
lustre | lustre | no description | Unknown | optional |
polish lustre | polish lustre | no description | Unknown | optional |
prop1 | prop1 | no description | Unknown | optional |
var1 | var1 | no description | Unknown | optional |
var1text | var1text | no description | Unknown | optional |
var2 | var2 | no description | Unknown | optional |
var2text | var2text | no description | Unknown | optional |
var3 | var3 | no description | Unknown | optional |
var3text | var3text | no description | Unknown | optional |
var4 | var4 | no description | Unknown | optional |
var4text | var4text | no description | Unknown | optional |
var5 | var5 | no description | Unknown | optional |
var5text | var5text | no description | Unknown | optional |
var6 | var6 | no description | Unknown | optional |
var6text | var6text | no description | Unknown | optional |
struct image | struct image | no description | Unknown | optional |
struct2 image | struct2 image | no description | Unknown | optional |
struct caption | struct caption | no description | Unknown | optional |
struct imagesize | struct imagesize | no description | Unknown | optional |
struct alt | struct alt | no description | Unknown | optional |
struct2 imagesize | struct2 imagesize | no description | Unknown | optional |
struct2 caption | struct2 caption | no description | Unknown | optional |
struct2 alt | struct2 alt | no description | Unknown | optional |
Jmol | Jmol | no description | Unknown | optional |
SMILES | SMILES | no description | Unknown | optional |
piezo | piezo | no description | Unknown | optional |