Search results

or inositol in Wiktionary, the free dictionary. The molecular formula C6H12O6 (molar mass: 180.16 g/mol) may refer to: Hexoses Aldohexoses Allose Altrose...

many hydrogen atoms as carbon and oxygen), while its molecular formula is C6H12O6 (12 hydrogen atoms, six carbon and oxygen atoms). Sometimes a chemical...

l-Glucose is an organic compound with formula C6H12O6 or O=CH[CH(OH)]5H, specifically one of the aldohexose monosaccharides. As the l-isomer of glucose...

oxidation of glucose (C6H12O6) to CO2 and the reduction of oxygen to water. The summary equation for cell respiration is: C6H12O6 + 6 O2 → 6 CO2 + 6 H2O...

cogenerates hydrogen peroxide, which is often the key product of the enzyme: C6H12O6 + O2 → C6H10O6 + H2O2 Gluconolactone spontaneously hydrolyzes to gluconic...

(or any six-carbon sugar) is converted to two molecules of lactic acid: C6H12O6 → 2 CH3CHOHCOOH It occurs in the muscles of animals when they need energy...

D-Psicose (C6H12O6), also known as D-allulose, or simply allulose, is a low-calorie epimer of the monosaccharide sugar fructose, used by some major commercial...

respiration: C6H12O6(s) + 6O2(g) → 6CO2(g) + 6H2O(l) The oxygen (O2) is being reduced, so it is the oxidizing agent. The glucose (C6H12O6) is being oxidized...

6 H 12 O 6 + 6 O 2 {\displaystyle {\ce {6CO2{}+6H2O{}->[{\text{light}}]C6H12O6{}+6O2{}}}} This causes plants to release oxygen into the atmosphere. Green...

of the chemical compound cyclohexane-1,2,3,4,5,6-hexol. Its formula is C6H12O6; the molecule has a ring of six carbon atoms, each with an hydrogen atom...

anaerobic organisms typically use the lactic acid fermentation pathway: C6H12O6 + 2 ADP + 2 phosphate → 2 lactic acid + 2 ATP + 2 H2O The energy released...

year. Tagatose is a white crystalline powder with a molecular formula of C6H12O6 with a molecular weight of 180.16 g/mol. Active maillard reaction of tagatose...

two moles of carbon dioxide, producing two moles of ATP in the process. C6H12O6 + 2 ADP + 2 Pi → 2 C2H5OH + 2 CO2 + 2 ATP Sucrose is a sugar composed of...

mg/dl (milligrams per decilitre). Since the molecular mass of glucose C6H12O6 is approximately 180 g/mol, the difference between the two units is a factor...

D-chiro-inositol (often abbreviated DCI) is a chemical substance with formula C6H12O6, one of the nine isomers of cyclohexane-1,2,3,4,5,6-hexol (which may be...

Glycolysis is the metabolic pathway that converts glucose (C6H12O6) into pyruvate and, in most organisms, occurs in the liquid part of cells (the cytosol)...

anions and cations, all formulas of ionic compounds are empirical. Glucose (C6H12O6), ribose (C5H10O5), Acetic acid (C2H4O2), and formaldehyde (CH2O) all have...

Numbers in circles indicate counts of carbon atoms in molecules, C6 is glucose C6H12O6, C1 carbon dioxide CO2. Mitochondrial outer membrane is omitted....

InChI InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2−,3+,4+,5−,6+/m1/s1 Y Key: WQZGKKKJIJFFOK-PHYPRBDBSA-N Y InChI=1/C6H12O6...

C 6 H 12 O 6 + NADH + H + ⟶ C 6 H 14 O 6 + NAD + {\displaystyle {\ce {C6H12O6 + NADH + H+ -> C6H14O6 + NAD+}}} The mechanism involves a tyrosine residue...