Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and 4-Fluoropethidine: Difference between pages
(Difference between pages)
Content deleted Content added
Saving copy of the {{drugbox}} taken from revid 456503787 of page 4-Fluoropethidine for the Chem/Drugbox validation project (updated: ''). |
m →top: replaced: However → However, |
||
| Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:4-Fluoropethidine|oldid=456503787}} 456503787] of page [[4-Fluoropethidine]] with values updated to verified values.}} |
|||
{{Drugbox |
{{Drugbox |
||
| Watchedfields = changed |
|||
| verifiedrevid = |
| verifiedrevid = 477221845 |
||
| IUPAC_name = ethyl 4-(4-fluorophenyl)-1-methylpiperidine-4-carboxylate |
| IUPAC_name = ethyl 4-(4-fluorophenyl)-1-methylpiperidine-4-carboxylate |
||
| image = 4- |
| image = 4-Fluoropethidine Structure.svg |
||
| width = 240 |
| width = 240 |
||
| Line 27: | Line 28: | ||
<!--Identifiers--> |
<!--Identifiers--> |
||
| CAS_number_Ref = {{cascite|correct|??}} |
| CAS_number_Ref = {{cascite|correct|??}} |
||
| CAS_number = |
| CAS_number = 258500-87-7 |
||
| ATC_prefix = none |
| ATC_prefix = none |
||
| ATC_suffix = |
| ATC_suffix = |
||
| Line 41: | Line 42: | ||
<!--Chemical data--> |
<!--Chemical data--> |
||
| C=15 | H=20 | F=1 | N=1 | O=2 |
| C=15 | H=20 | F=1 | N=1 | O=2 |
||
| smiles = FC1=CC=C(C2(CCN(C)CC2)C(OCC)=O)C=C1 |
|||
| molecular_weight = 265.322 g/mol |
|||
| smiles = Fc2ccc(cc2)C(C(=O)OCC)(CC1)CCN1C |
|||
| InChI = 1/C15H20FNO2/c1-3-19-14(18)15(8-10-17(2)11-9-15)12-4-6-13(16)7-5-12/h4-7H,3,8-11H2,1-2H3 |
|||
| InChIKey = CHOQGLPFQOQESN-UHFFFAOYAI |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C15H20FNO2/c1-3-19-14(18)15(8-10-17(2)11-9-15)12-4-6-13(16)7-5-12/h4-7H,3,8-11H2,1-2H3 |
| StdInChI = 1S/C15H20FNO2/c1-3-19-14(18)15(8-10-17(2)11-9-15)12-4-6-13(16)7-5-12/h4-7H,3,8-11H2,1-2H3 |
||
| Line 50: | Line 48: | ||
| StdInChIKey = CHOQGLPFQOQESN-UHFFFAOYSA-N |
| StdInChIKey = CHOQGLPFQOQESN-UHFFFAOYSA-N |
||
}} |
}} |
||
'''4-Fluoropethidine''' is a drug that is a derivative of [[pethidine]] (meperidine), which combines pethidine's [[opioid]] [[analgesic]] effects with increased [[monoamine]] [[Reuptake inhibitor|reuptake inhibition]]. It is around 50% less potent than pethidine as an opioid analgesic, but conversely is 50% more potent as a [[dopamine reuptake inhibitor]], with other derivatives such as the 4-iodo and 3,4-dichloro analogues being even more potent dopamine reuptake inhibitors again. However, none of these compounds substitute for [[cocaine]] or produce [[stimulant]] effects in animals, suggesting that they still act primarily as opioid analgesic drugs in practice.<ref name="pmid15743177">{{cite journal |vauthors =Lomenzo SA, Rhoden JB, Izenwasser S, Wade D, Kopajtic T, Katz JL, Trudell ML |title=Synthesis and biological evaluation of meperidine analogues at monoamine transporters |journal=Journal of Medicinal Chemistry |volume=48 |issue=5 |pages=1336–43 |date=March 2005 |pmid=15743177 |doi=10.1021/jm0401614 }}</ref> Its action and degree of relation to pethidine means that it may be controlled in those countries which have laws about controlled-substance analogues; it is not itself listed in the Controlled Substances Act 1970.<ref>{{Cite web|url=https://www.dea.gov/controlled-substances-act|title=The Controlled Substances Act}}</ref> |
|||
==See also== |
|||
* [[Hydroxypethidine|Hydroxypethidine (Bemidone)]] |
|||
* [[Nocaine]] |
|||
== References == |
|||
{{Reflist}} |
|||
{{Opioid receptor modulators}} |
|||
{{Monoamine reuptake inhibitors}} |
|||
{{DEFAULTSORT:Fluoromeperidine, 4-}} |
|||
[[Category:Synthetic opioids]] |
|||
[[Category:4-Phenylpiperidines]] |
|||
[[Category:Ethyl esters]] |
|||
[[Category:Fluoroarenes]] |
|||
[[Category:Mu-opioid receptor agonists]] |
|||
[[Category:Dopamine reuptake inhibitors]] |
|||
{{analgesic-stub}} |
|||