Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Abarelix: Difference between pages

{{Short description|Chemical compound}}

| verifiedrevid = 477237014

| IUPAC_name = N-acetyl-3-(2-naphthyl)-D-alanyl-4-chloro-D-phenylalanyl-3-(3-pyridyl)-D-alanyl-L-seryl-N-methyl-L-tyrosyl-D-asparagyl-L-leucyl-N6-isopropyl-L-lysyl-L-prolyl-D-alaninamide<ref>{{cite web| title=Abarelix| website=PubChem| date=2017-07-29| url=https://pubchem.ncbi.nlm.nih.gov/compound/Abarelix}}</ref><!--not validated by [[Wikipedia:WikiProject Pharmacology]]-->

| width = 250px

| tradename = Plenaxis

| pregnancy_US = X

| legal_status =

| routes_of_administration = [[Intramuscular injection]]

| class = [[GnRH analogue]]; [[GnRH antagonist]]; [[Antigonadotropin]]

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 183552-38-7

| CAS_supplemental =

| ATC_supplemental =

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| synonyms =

| C=72 | H=95 | Cl=1 | N=14 | O=14

| SMILES = CC(C)C[C@H](NC(=O)[C@@H](CC(N)=O)NC(=O)[C@H](Cc1ccc(O)cc1)N(C)C(=O)[C@H](CO)NC(=O)[C@@H](Cc2cccnc2)NC(=O)[C@@H](Cc3ccc(Cl)cc3)NC(=O)[C@@H](NCc5ccc4ccccc4c5)NC(C)=O)C(=O)N[C@@H](CCCCNC(C)C)C(=O)N6CCC[C@H]6C(=O)N[C@H](C)C(N)=O

'''Abarelix''', sold under the brand name '''Plenaxis''', is an injectable [[gonadotropin-releasing hormone]] antagonist ([[gonadotropin-releasing hormone antagonist|GnRH antagonist]]) which is marketed in [[Germany]] and the [[Netherlands]]. It is primarily used in [[oncology]] to reduce the amount of [[testosterone]] made in patients with advanced symptomatic [[prostate cancer]] for which no other treatment options are available.<ref name="Drugs.com-2">{{cite web | work = Drugs.com | url = https://www.drugs.com/mtm/abarelix.html | title = Abarelix | access-date = 2018-01-23 | archive-date = 2018-02-10 | archive-url = https://web.archive.org/web/20180210163254/https://www.drugs.com/mtm/abarelix.html | url-status = dead }}</ref><ref>{{cite journal | vauthors = Boccon-Gibod L, van der Meulen E, Persson BE | title = An update on the use of gonadotropin-releasing hormone antagonists in prostate cancer | journal = Therapeutic Advances in Urology | volume = 3 | issue = 3 | pages = 127–40 | date = June 2011 | pmid = 21904569 | pmc = 3159401 | doi = 10.1177/1756287211414457 }}</ref>

It was originally marketed by Praecis Pharmaceuticals as ''Plenaxis'',<ref name="Drugs.com-2" /> and is now marketed by Speciality European Pharma in Germany<ref>Pharmazeutische Zeitung online: [http://www.pharmazeutische-zeitung.de/index.php?id=4760 Abarelix] {{in lang|de}}</ref> after receiving a marketing authorization in 2005. The drug was introduced in the [[United States]] in 2003, but was discontinued in this country in May 2005 due to poor sales and a higher-than-expected incidence of severe [[allergic reaction]]s.<ref name="Minev2011">{{cite book| first = Boris | last = Minev | name-list-style = vanc |title=Cancer Management in Man: Chemotherapy, Biological Therapy, Hyperthermia and Supporting Measures|url=https://books.google.com/books?id=mOdKDLAAd0AC&pg=PA182|date=13 January 2011|publisher=Springer Science & Business Media|isbn=978-90-481-9704-0|pages=182–}}</ref> It remains marketed in [[Germany]] and the [[Netherlands]] however.<ref name="Drugs.com">{{cite web | title = Abarelix | url = https://www.drugs.com/international/abarelix.html | work = Drugs.com | access-date = 2018-08-27 | archive-date = 2019-08-29 | archive-url = https://web.archive.org/web/20190829113846/https://www.drugs.com/international/abarelix.html | url-status = dead }}</ref>

== See also ==

* [[Gonadotropin-releasing hormone receptor#Antagonists|Gonadotropin-releasing hormone receptor § Antagonists]]

== References ==

{{Reflist}}

{{GnRH and gonadotropins}}

{{GnRH and gonadotropin receptor modulators}}

[[Category:GnRH antagonists]]

[[Category:Peptide therapeutics]]

{{pharma-stub}}