Jump to content

Glyceryl behenate: Difference between revisions

Page 1
Page 2
Content deleted Content added
CheMoBot (talk | contribs)
Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (
m Reverted edits by Muckaow (talk) (AV)
 
(25 intermediate revisions by 15 users not shown)
Line 1: Line 1:
{{orphan|date= May 2011}}
{{Chembox
{{Chembox
| verifiedrevid = 435843046
| verifiedrevid = 436678828
| ImageFile =Glyceryl behenate.svg
| ImageFile =Glyceryl behenate.svg
| ImageSize =150px
| ImageSize =150px
| ImageAlt =
| ImageAlt =
| IUPACName =
| IUPACName =
| OtherNames =Glycerol behenate; Glycerin behenate; Glycerol docosanoate
| OtherNames =Glycerol behenate; Glycerin behenate; Glycerol docosanoate
| Section1 = {{Chembox Identifiers
|Section1={{Chembox Identifiers
| index1_label = 1-mono
| CASNo =77538-19-3
| index2_label = 1,2-di
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo1 = 30233-64-8
| index3_label = 1,3-di
| index4_label = tri
| CASNo1_Ref = {{cascite|correct|CAS}}
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo1_Comment = (monoglycerides)
| CASNo =77538-19-3
| PubChem =
| CASNo1_Ref = {{cascite|correct|CAS}}
| SMILES = }}
| CASNo1 = 30233-64-8
| Section2 = {{Chembox Properties
| CASNo2_Ref = {{cascite|correct|CAS}}
| Formula = Variable
| CASNo2 = 99880-64-5
| MolarMass = Variable
| CASNo3_Ref = {{cascite|correct|CAS}}
| Appearance =
| CASNo3 = 94201-62-4
| Density =
| CASNo4_Ref = {{cascite|correct|CAS}}
| MeltingPt =
| CASNo4 = 18641-57-1
| BoilingPt =
| Solubility = }}
| PubChem1 = 5362585
| PubChem3 = 9810617
| Section3 = {{Chembox Hazards
| PubChem4 = 62726
| MainHazards =
| ChemSpiderID1 = 4515097
| FlashPt =
| ChemSpiderID2 = 7822873
| Autoignition = }}
| ChemSpiderID3 = 7986372
| ChemSpiderID4 = 56470
| EC_number = 278-717-5
| EC_number1 = 250-097-0
| EC_number3 = 303-650-6
| EC_number4 = 242-471-7
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII1_Ref = {{fdacite|correct|FDA}}
| UNII2_Ref = {{fdacite|correct|FDA}}
| UNII3_Ref = {{fdacite|correct|FDA}}
| UNII4_Ref = {{fdacite|correct|FDA}}
| UNII = R8WTH25YS2
| UNII1 = A626UU0W2A
| UNII2 = 21E45121YS
| UNII3 = 84T2X52XS0
| UNII4 = 8OC9U7TQZ0
| ChEBI1 = 142497
| ChEMBL4 = 2104418
| SMILES1 = CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(CO)O
| SMILES3 = CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCC)O
| SMILES4 = CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC
| InChI1=1S/C25H50O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25(28)29-23-24(27)22-26/h24,26-27H,2-23H2,1H3
| InChIKey1 = OKMWKBLSFKFYGZ-UHFFFAOYSA-N
|InChI3=1S/C47H92O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39-41-46(49)51-43-45(48)44-52-47(50)42-40-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h45,48H,3-44H2,1-2H3
| InChIKey3 = GYNODFLZPXTEPN-UHFFFAOYSA-N
| InChI4=1S/C69H134O6/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-52-55-58-61-67(70)73-64-66(75-69(72)63-60-57-54-51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3)65-74-68(71)62-59-56-53-50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2/h66H,4-65H2,1-3H3
| InChIKey4 = DMBUODUULYCPAK-UHFFFAOYSA-N
}}
}}
|Section2={{Chembox Properties
| Formula = Variable
| MolarMass = Variable
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility = }}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt = }}
}}

'''Glyceryl behenate''' is a [[fat]] used in [[cosmetics]], [[food]]s, and oral [[pharmaceutical formulation]]s. In cosmetics, it is mainly used as a [[viscosity]]-increasing agent in [[emulsion]]s.


In pharmaceutical formulations, glyceryl behenate is mainly used as a [[Tablet (pharmacy)|tablet]] and [[Capsule (pharmacy)|capsule]] [[lubricant]] and as a lipidic coating [[excipient]]. It has been investigated for the encapsulation of various drugs such as [[retinoid]]s. It has also been investigated for use in the preparation of [[sustained release]] tablets as a matrix-forming agent for the [[controlled release]] of [[water-soluble]] drugs and as a lubricant in oral solid dosage formulations. It can also be used as a hot-melt coating agent sprayed onto a [[powder (substance)|powder]].<ref>Handbook of pharmaceutical excipient, 5th edition</ref>
'''Glyceryl behenate''' is a [[Chemical compound|compound]] used in [[cosmetics]], [[food]]s, and oral [[pharmaceutical formulation]]s. In cosmetics, it is mainly used as a [[viscosity]]-increasing agent in [[emulsion]]s.


It is used widely in cosmetics as non-comedogenic (non- pimple causing substance) ingredient. It does not clog the oil pores of facial skin.
In pharmaceutical formulations, glyceryl behenate is mainly used as a [[tablet]] and [[Capsule (pharmacy)|capsule]] [[lubricant]] and as a lipidic coating [[excipient]]. It has been investigated for the encapsulation of various drugs such as [[retinoid]]s. It has also been investigated for use in the preparation of [[sustained release]] tablets as a matrix-forming agent for the [[controlled release]] of [[water-soluble]] drugs and as a lubricant in oral solid dosage formulations. It can also be used as a hot-melt coating agent sprayed onto a [[powder (substance)|powder]].<ref>Handbook of pharmaceutical excipient, 5<sup>th</sup> edition</ref>


Chemically, glyceryl behenate is a mixture of various [[ester]]s of [[behenic acid]] and [[glycerol]] ([[glyceride]]s).<ref name=cfr>{{CodeFedReg|21|184|1328}}</ref> The mixture contains predominately the diester, glyceryl dibehenate.<ref name=cfr/>
It is also used widely as ingredient for preparation of lipidic nano-particles such as solid lipid nanoparticles (SLN) and nanostructured lipid carriers (NLC). Chemically, glyceryl behenate is a mixture of various [[ester]]s of [[behenic acid]] and [[glycerol]] ([[glyceride]]s).<ref name=cfr>{{CodeFedReg|21|184|1328}}</ref> The mixture predominantly contains the diester glyceryl dibehenate.<ref name=cfr/>


==See also==
==See also==
Line 39: Line 80:


==References==
==References==
{{reflist|30em}}
<references/>


[[Category:Food additives]]
[[Category:Food additives]]
[[Category:Cosmetics chemicals]]
[[Category:Cosmetics chemicals]]
[[Category:Excipients]]
[[Category:Excipients]]
{{chemistry-stub}}