Jump to content

Oroxindin: Difference between revisions

Page 1
Page 2
Content deleted Content added
mNo edit summary
move systematic name
 
(21 intermediate revisions by 14 users not shown)
Line 1: Line 1:
{{chembox
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| Watchedfields = changed
| verifiedrevid = 401008616
| verifiedrevid = 423307851
| Name = Oroxindin
| Name = Oroxindin
| ImageFile = Oroxindin.png
| ImageFile = Oroxindin.svg
| ImageSize = 200px
| ImageName =
| IUPACName = 5-Hydroxy-8-methoxy-4-oxoflav-2-en-7-yl β-<small>D</small>-glucopyranosiduronic acid
| ImageName =
| SystematicName = (2''S'',3''S'',4''S'',5''R'',6''S'')-3,4,5-Trihydroxy-6-[(5-hydroxy-8-methoxy-4-oxo-2-phenyl-4''H''-1-benzopyran-7-yl)oxy]oxane-2-carboxylic acid
| IUPACName = 5-Hydroxy-8-methoxy-7-''O''-β-<small>D</small>-glucopyranuronosyl flavone
| OtherNames = Wogonin-7-''O''-β-<small>D</small>-glucuronide
| OtherNames = Wogonin-7-''O''-β-<small>D</small>-glucuronide
| Section1 = {{Chembox Identifiers
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|??}}
| CASNo= 51059-44-0
| CASNo= 51059-44-0
| PubChem= 3084961
| UNII_Ref = {{fdacite|correct|FDA}}
| SMILES = COC1=C(C=C(C2=C1OC(=CC2=O)C3=CC=CC=C3)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)C(=O)O)O)O)O
| InChI =
| UNII = ETX4944Z3R
| PubChem= 3084961

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 2341950
| SMILES = COc1c(cc(c2c1oc(cc2=O)c3ccccc3)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)C(=O)O)O)O)O
| InChI = 1/C22H20O11/c1-30-18-13(32-22-17(27)15(25)16(26)20(33-22)21(28)29)8-11(24)14-10(23)7-12(31-19(14)18)9-5-3-2-4-6-9/h2-8,15-17,20,22,24-27H,1H3,(H,28,29)/t15-,16-,17+,20-,22+/m0/s1
| InChIKey = LNOHXHDWGCMVCO-NTKSAMNMBE
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C22H20O11/c1-30-18-13(32-22-17(27)15(25)16(26)20(33-22)21(28)29)8-11(24)14-10(23)7-12(31-19(14)18)9-5-3-2-4-6-9/h2-8,15-17,20,22,24-27H,1H3,(H,28,29)/t15-,16-,17+,20-,22+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = LNOHXHDWGCMVCO-NTKSAMNMSA-N

}}
}}
| Section2 = {{Chembox Properties
|Section2={{Chembox Properties
| Formula = C<sub>22</sub>H<sub>20</sub>O<sub>11</sub>
| Formula = C<sub>22</sub>H<sub>20</sub>O<sub>11</sub>
| MolarMass = 460.388 g/mol
| MolarMass = 460.388 g/mol
| Density =
| ExactMass = 460.100561 u
| Density =
| MeltingPt =
| MeltingPt =
| BoilingPt =
| BoilingPt =
}}
}}
}}
}}
'''Oroxindin''' is a chemical compound. It is a [[wogonoside]], more accurately a wogonin [[glucuronide]] isolated from ''[[Oroxylum indicum]]'' (Bignoniaceae),<ref>{{cite journal | url = http://www.springerlink.com/content/dn4mwx7805167353/ | title = Oroxindin—A new flavone glucuronide from Oroxylum indicum| doi = 10.1007/BF02844710}}</ref> ''[[Bacopa monnieri]]'' (Plantaginaceae) and ''[[Holmskioldia sanguinea]]''<ref>[http://cat.inist.fr/?aModele=afficheN&cpsidt=15532983 Phytotoxic and antimicrobial constituents of Bacopa monnieri and Holmskioldia sanguinea]</ref> (Chinese hat plant, Verbenaceae).
'''Oroxindin''' is a [[flavone]], a type of phenolic chemical compound. It is a [[wogonoside]], more accurately a wogonin [[glucuronide]] isolated from ''[[Oroxylum indicum]]'' (Bignoniaceae),<ref>{{cite journal | title = Oroxindin—A new flavone glucuronide from Oroxylum indicum| doi = 10.1007/BF02844710| s2cid = 90414405}}</ref> ''[[Bacopa monnieri]]'' (Plantaginaceae) and ''[[Holmskioldia sanguinea]]''<ref>[http://cat.inist.fr/?aModele=afficheN&cpsidt=15532983 Phytotoxic and antimicrobial constituents of Bacopa monnieri and Holmskioldia sanguinea]</ref> (Chinese hat plant, Verbenaceae).


==References==
== References ==
{{Reflist}}
{{Reflist}}


==External links==
== External links ==
* [http://www.nextbio.com/b/search/ov/Oroxindin Oroxindin] at nextbio.com
* [http://www.nextbio.com/b/search/ov/Oroxindin Oroxindin at nextbio.com]


{{flavone}}
{{flavone}}


[[Category:Flavone glycosides]]
[[Category:Flavone glycosides]]
[[Category:Phenol ethers]]
[[Category:Flavonoid glucuronides]]
[[Category:Glucuronides]]
[[Category:Glucuronide esters]]

{{Natural-phenol-stub}}


{{Aromatic-stub}}
[[fr:Oroxindine]]