Penimepicycline: Difference between revisions

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
+{{Short description|Chemical compound}}
-{{drugbox
+{{Drugbox
 | Verifiedfields = changed
-| verifiedrevid = 400842995
+| verifiedrevid = 436505734
-| IUPAC_name        =
+| IUPAC_name =
-| image             = Penimepicycline.png
+| image = Penimepicycline.svg
-| InChI = 1/C29H38N4O9.C16H18N2O5S/c1-28(41)15-5-4-6-18(35)19(15)23(36)20-16(28)13-17-22(31(2)3)24(37)21(26(39)29(17,42)25(20)38)27(40)30-14-33-9-7-32(8-10-33)11-12-34;1-16(2)12(15(21)22)18-13(20)11(14(18)24-16)17-10(19)8-23-9-6-4-3-5-7-9/h4-6,16-17,22,34-35,37-38,41-42H,7-14H2,1-3H3,(H,30,40);3-7,11-12,14H,8H2,1-2H3,(H,17,19)(H,21,22)/t16?,17-,22-,28+,29-;11-,12+,14-/m01/s1
+<!--Clinical data-->
-| InChIKey = MEGKRPMNPGTIIG-FPAXJKHWBM
+| tradename =
+| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
+| pregnancy_US = <!-- A / B            / C / D / X -->
+| pregnancy_category =
+| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
+| legal_CA = <!--             / Schedule I, II, III, IV, V, VI, VII, VIII -->
+| legal_UK = <!-- GSL         / P       / POM / CD / Class A, B, C -->
+| legal_US = <!-- OTC                   / Rx-only  / Schedule I, II, III, IV, V -->
+| legal_status =
+| routes_of_administration = Oral, [[intramuscular injection|intramuscular]]
+<!--Pharmacokinetic data-->
+| bioavailability =
+| protein_bound =
+| metabolism =
+| elimination_half-life =
+| excretion =
+<!--Identifiers-->
+| CAS_number_Ref = {{cascite|correct|??}}
+| CAS_number = 4599-60-4
+| UNII_Ref = {{fdacite|correct|FDA}}
+| UNII = 3RGQ4B6E87
+| ATC_prefix = J01
+| ATC_suffix = AA10
+| PubChem = 5464323
+| ChEBI_Ref = {{ebicite|changed|EBI}}
+| ChEBI = 75258
+| DrugBank =
+| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
+| ChemSpiderID = 16736440
+| KEGG_Ref = {{keggcite|correct|kegg}}
+| KEGG = D07233
+<!--Chemical data-->
+| C=45 | H=56 | N=6 | O=14 | S=1
 | smiles = O=C(O)[C@@H]2N3C(=O)[C@@H](NC(=O)COc1ccccc1)[C@H]3SC2(C)C.CN(C)[C@@H]2C(\O)=C(/C(=O)[C@@]3(O)C(/O)=C4/C(=O)c1c(O)cccc1[C@@](C)(O)C4C[C@@H]23)C(=O)NCN5CCN(CCO)CC5
 | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
@@ Line 11: / Line 48: @@
 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
 | StdInChIKey = MEGKRPMNPGTIIG-FPAXJKHWSA-N
-| CAS_number        = 4599-60-4
-| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
-| ChemSpiderID=16736440
-| ATC_prefix        = J01
-| ATC_suffix        = AA10
-| PubChem           = 5464323
-| DrugBank          =
-| KEGG_Ref = {{keggcite|changed|kegg}}
-| KEGG = D07233
-| C = 45 | H = 56 | N = 6 | O = 14 | S = 1
-| molecular_weight  = 937.024 g/mol
-| bioavailability   =
-| protein_bound     =
-| metabolism        =
-| elimination_half-life =
-| excretion         =
-| pregnancy_AU      =  <!-- A / B1 / B2 / B3 / C / D / X -->
-| pregnancy_US      =  <!-- A / B            / C / D / X -->
-| pregnancy_category=
-| legal_AU          =  <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
-| legal_CA          =  <!--             / Schedule I, II, III, IV, V, VI, VII, VIII -->
-| legal_UK          =  <!-- GSL         / P       / POM / CD / Class A, B, C -->
-| legal_US          =  <!-- OTC                   / Rx-only  / Schedule I, II, III, IV, V -->
-| legal_status      =
-| routes_of_administration = Oral, [[intramuscular injection|intramuscular]]
 }}
-'''Penimepicycline''' ([[International Nonproprietary Name|INN]], also known as '''mepicycline penicillinate''') is an [[antibiotic]]. It is the [[phenoxymethylpenicillin]]ate salt of the [[tetracycline antibiotic]] [[pipacycline]].
+'''Penimepicycline''' ([[International Nonproprietary Name|INN]], also known as '''mepicycline penicillinate''') is an [[antibiotic]].<ref>{{cite web | url = https://go.drugbank.com/drugs/DB13264 | title = Penimepicycline | work = [[DrugBank]] }}</ref> It is the [[phenoxymethylpenicillin]]ate salt of the [[tetracycline antibiotic]] [[pipacycline]] (mepicycline).{{cn|date=March 2023}}
+==References==
+{{Reflist}}
 {{TetracyclineAntiBiotics}}
-[[Category:Beta-lactam antibiotics]]
+[[Category:Penicillins]]
 [[Category:Combination antibiotics]]
 [[Category:Tetracycline antibiotics]]
@@ Line 47: / Line 63: @@
 {{antibiotic-stub}}
-[[th:เพนิเมพิไซคลีน]]
-[[zh:青哌环素]]