Purpurogallin: Difference between revisions
Appearance
Content deleted Content added
mNo edit summary |
Citation bot (talk | contribs) Add: url. | Use this bot. Report bugs. | Suggested by Corvus florensis | #UCB_webform 1188/1746 |
||
(32 intermediate revisions by 23 users not shown) | |||
Line 1: | Line 1: | ||
{{chembox |
{{chembox |
||
| Verifiedfields = changed |
|||
⚫ | |||
| Watchedfields = changed |
|||
⚫ | |||
| Name = Purpurogallin |
| Name = Purpurogallin |
||
| ImageFile = Purpurogallin.svg |
| ImageFile = Purpurogallin.svg |
||
| ImageSize = |
| ImageSize = 200px |
||
| ImageName = Chemical structure of purpurogallin |
| ImageName = Chemical structure of purpurogallin |
||
| ImageAlt = Chemical structure of purpurogallin |
| ImageAlt = Chemical structure of purpurogallin |
||
| |
| PIN = 1,7,8,9-Tetrahydroxy-2''H''-benzo[7]annulen-2-one |
||
| OtherNames = Purpurogalline<br>2,3,4,6-Tetrahydroxybenzocyclohepten-5-one<br>PPG |
| OtherNames = Purpurogalline<br>2,3,4,6-Tetrahydroxybenzocyclohepten-5-one<br>PPG |
||
|Section1= |
|Section1={{Chembox Identifiers |
||
| CASNo_Ref = {{cascite|correct|??}} |
|||
| CASNo = 569-77-7 |
| CASNo = 569-77-7 |
||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
| CASNo_Ref = |
|||
| |
| UNII = L3Z7U4N28P |
||
| CASNoOther = |
|||
| PubChem = 5281571 |
| PubChem = 5281571 |
||
| SMILES = C1=CC(=O)C(=C2C(=C1)C=C(C(=C2O)O)O)O |
| SMILES = C1=CC(=O)C(=C2C(=C1)C=C(C(=C2O)O)O)O |
||
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChI = 1S/C11H8O5/c12-6-3-1-2-5-4-7(13)10(15)11(16)8(5)9(6)14/h1-4,13,15-16H,(H,12,14) |
|||
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChIKey = WDGFFVCWBZVLCE-UHFFFAOYSA-N |
|||
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|||
| ChemSpiderID = 4444893 |
|||
| InChI = |
| InChI = |
||
| MeSHName = |
| MeSHName = C026133 |
||
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|||
| ChEBI = 8647 |
|||
| KEGG_Ref = {{keggcite|changed|kegg}} |
|||
| KEGG = C09964 |
|||
}} |
}} |
||
|Section2= |
|Section2={{Chembox Properties |
||
| C=11|H=8|O=5 |
|||
| Formula = C<sub>11</sub>H<sub>8</sub>O<sub>5</sub> |
|||
⚫ | |||
| MolarMass = 220.17 g/mol |
|||
| ExactMass = 220.037173 u |
|||
⚫ | |||
| Density = |
| Density = |
||
| MeltingPt = |
| MeltingPt = |
||
| BoilingPt = |
| BoilingPt = |
||
| Solubility = |
| Solubility = |
||
}} |
}} |
||
}} |
}} |
||
'''Purpurogallin''' is a red, crystalline compound, and the aglycon of several glycosides from [[nutgall]]s and [[oak bark]]s.<ref>Molecular structure and antioxidant specificity of purpurogallin in three types of human cardiovascular cells. Tai-Wing Wu, Ling-Hua Zeng, Jun Wu, Kwok-Pui Fung, Richard D. Weisel, Andrew Hempel and Norman Camerman, Biochemical Pharmacology, Volume 52, Issue 7, 11 October 1996, Pages 1073-1080, {{doi|:10.1016/0006-2952(96)00447-9}}</ref> It can inhibit [[hydroxyestradiol]] methylation by [[catechol-O-methyltransferase]].<ref>Benzo[[tropolone]] inhibitors of estradiol methylation: kinetics and in silico modeling studies. Joshua D. Lambert, Dapeng Chena, Ching Y. Wang, Ni Ai, Shengmin Sang, Chi-Tang Ho, William J. Welsh and Chung S. Yang, Bioorganic & Medicinal Chemistry, Volume 13, Issue 7, 1 April 2005, Pages 2501-2507, {{doi|10.1016/j.bmc.2005.01.037}}</ref> |
|||
'''Purpurogallin''' is an [[aglycone]] natural product. It is an orange-red solid that is soluble in polar organic solvents but not in water. Its [[glycoside]] (ether-linked to sugar), called dryophantin, is found in [[nutgall]]s and [[oak bark]]s. Purpurogallin can be prepared by oxidation of [[pyrogallol]] with [[sodium periodate]].<ref>{{cite journal |doi=10.1021/acs.jchemed.1c00699|title=Synthesis and Analytical Characterization of Purpurogallin: A Pharmacologically Active Constituent of Oak Galls |year=2022 |last1=Kelly-Hunt |first1=Alexandra E. |last2=Mehan |first2=Aman |last3=Brooks |first3=Sarah |last4=Leanca |first4=Miron A. |last5=McKay |first5=Jack E. D. |last6=Mahamed |first6=Nashad |last7=Lambert |first7=Daniel |last8=Dempster |first8=Nicola M. |last9=Allen |first9=Robert J. |last10=Evans |first10=Andrew R. |last11=Sarker |first11=Satyajit D. |last12=Nahar |first12=Lutfun |last13=Sharples |first13=George P. |last14=Drew |first14=Michael G. B. |last15=Fielding |first15=Alistair J. |last16=Ismail |first16=Fyaz M. D. |journal=Journal of Chemical Education |volume=99 |issue=2 |pages=983–993 |bibcode=2022JChEd..99..983K |s2cid=245366264 |url=https://researchonline.ljmu.ac.uk/id/eprint/16051/3/Synthesis%20and%20analytical%20characterization%20of%20purpurogallin%20-%20a%20pharmacologically%20active%20constituent%20of%20oak%20galls.pdf }}</ref> |
|||
==Medicinal aspects== |
|||
Purpurogallin is bioactive<ref>{{cite journal | doi = 10.1016/0006-2952(96)00447-9| pmid = 8831727| title = Molecular structure and antioxidant specificity of purpurogallin in three types of human cardiovascular cells| journal = Biochemical Pharmacology| volume = 52| issue = 7| pages = 1073–80| year = 1996| last1 = Wu| first1 = Tai-Wing| last2 = Zeng| first2 = Ling-Hua| last3 = Wu| first3 = Jun| last4 = Fung| first4 = Kwok-Pui| last5 = Weisel| first5 = Richard D| last6 = Hempel| first6 = Andrew| last7 = Camerman| first7 = Norman}}</ref> It can inhibit [[2-Hydroxyestradiol|2-hydroxy]] and [[4-Hydroxyestradiol|4-hydroxyestradiol]] methylation by [[catechol-O-methyltransferase]].<ref>{{cite journal | doi = 10.1016/j.bmc.2005.01.037| title = Benzotropolone inhibitors of estradiol methylation: Kinetics and in silico modeling studies| journal = Bioorganic & Medicinal Chemistry| volume = 13| issue = 7| pages = 2501–7| year = 2005| last1 = Lambert| first1 = Joshua D| last2 = Chen| first2 = Dapeng| last3 = Wang| first3 = Ching Y| last4 = Ai| first4 = Ni| last5 = Sang| first5 = Shengmin| last6 = Ho| first6 = Chi-Tang| last7 = Welsh| first7 = William J| last8 = Yang| first8 = Chung S| pmid = 15755652}}</ref> It potently and specifically inhibits [[TLR1]]/[[TLR2]] activation pathway.<ref>{{cite journal | doi = 10.1002/anie.201204910| pmid = 22969053| title = Discovery of Small-Molecule Inhibitors of the TLR1/TLR2 Complex| journal = Angewandte Chemie International Edition| volume = 51| issue = 49| pages = 12246–9| year = 2012| last1 = Cheng| first1 = Kui| last2 = Wang| first2 = Xiaohui| last3 = Zhang| first3 = Shuting| last4 = Yin| first4 = Hang| pmc=3510333}}</ref> |
|||
==References== |
==References== |
||
{{reflist}} |
{{reflist}} |
||
[[Category: |
[[Category:Polyphenols]] |
||
[[Category:Tropolones]] |
|||
[[Category:Tetrols]] |
|||
[[Category:Azulenes]] |
|||
[[Category:Pyrogallols]] |
|||
{{ |
{{phenol-stub}} |