Jump to content

Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Template:Infobox drug/testcases: Difference between pages

(Difference between pages)
Page 1
Page 2
Content deleted Content added
VisualWikitext
Saving copy of the {{drugbox}} taken from revid 466647414 of page Template:Drugbox/Atorvastatin for the Chem/Drugbox validation project (updated: 'DrugBank', 'UNII').
 
→‎Paracetamol: xfer to new test page
 
Line 1: Line 1:
{{Testcases}}
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:Template:Drugbox/Atorvastatin|oldid=466647414}} 466647414] of page [[Template:Drugbox/Atorvastatin]] with values updated to verified values.}}

{{Drugbox
{{Infobox drug/testcases/navbox|state=collapsed}}

==biosimilars==
:eg [[Rituximab]]
{{testcase table
|name=rituximab
|synonyms=synonyms
|biosimilars=rituximab-abbs,<ref name="Truxima FDA label">{{cite web | title=Truxima- rituximab-abbs injection, solution | website=DailyMed | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=9af3ddc7-4217-417a-ac89-8704edc5bc44 | access-date=26 March 2021}}</ref> rituximab-pvvr,<ref name="Ruxience FDA label">{{cite web | title=Ruxience- rituximab-pvvr injection, solution | website=DailyMed | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=f941fc61-f7a3-4e4a-ab7c-87c1667fa05b | access-date=26 March 2021}}</ref> rituximab-arrx<ref name="Riabni FDA label">{{cite web | title=Riabni- rituximab-arrx injection, solution | website=DailyMed | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=da1c4de7-0e5b-4f72-97ec-7a8d368f085f | access-date=26 March 2021}}</ref>
|Drugs.com = {{drugs.com|monograph|rituximab}}
}}

{{Section references}}

== Test Brazilian Legal Status ==
{{testcase table
| image =
<!--Legal Status-->
| legal_status =
| legal_AU = S2
| legal_BR = A1
| legal_CA = Schedule I
| legal_DE = Anlage I
| legal_UK = GSL
| legal_US = Rx-only
}}


== Test 0 = blanks ==
{{testcase table
| legal_status =
| legal_AU =

}}

== Test 1 ==
{{purge}}
{{testcase table
| name = {{PAGENAME}}
| INN = [[Linezolid]]
| Verifiedfields = changed
| verifiedrevid = 415028406
| IUPAC_name = (''S'')-''N''-({3-[3-fluoro-4-(morpholin-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl}methyl)acetamide
| image = Linezolid.svg
| alt = Skeletal formula of linezolid
| image2 = Linezolid-from-xtal-2008-3D-balls.png

<!--Clinical data-->
| pronounce = {{IPAc-en|nj|uː|ˈ|m|əʊ|n|i|ə}}
| tradename = Linospan, Zyvox, Zyvoxam, Zyvoxid
| Drugs.com = {{drugs.com|monograph|linezolid}}
| MedlinePlus = a602004
| licence_CA = Linezolid
| licence_EU = Linezolid
| DailyMedID = Linezolid
| licence_US = Linezolid
| pregnancy_US = C
| pregnancy_AU = C
| legal_status_AU = S4
| legal_status_UK = POM
| legal_status_US = ℞-only
| routes_of_administration = [[Intravenous therapy|Intravenous infusion]], oral
| dependency_liability = High
| addiction_liability = Low
<!--Pharmacokinetic data-->
| metabolites = some stuff
| duration_of_action= 1 to 3 hr
| bioavailability = ~100% (oral)
| protein_bound = Low (31%)
| metabolism = [[Liver|Hepatic]] (50–70%, [[cytochrome P450|CYP]] not&nbsp;involved)
| elimination_half-life = 4.2–5.4 hours (shorter in children)
| excretion = Nonrenal, [[kidney|renal]], and fecal
| onset = 1 hr

<!--Identifiers-->
| synonyms = Lenzomore
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 165800-03-3
| ATC_prefix = J01
| ATC_suffix = XX08
| PubChem = 441401
| DrugBank_Ref =
| DrugBank = DB00601
| ChemSpiderID_Ref =
| ChemSpiderID =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = ISQ9I6J12J
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00947
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 126
| NIAID_ChemDB = 070944
| PDB_ligand = ZLD
| IUPHAR_ligand = 1234

<!--Chemical data-->
| C=16 | H=20 | F=1 | N=3 | O=4
| molecular_weight = 337.346 g/mol
| smiles = O=C1O[C@@H](CNC(=O)C)CN1c3cc(F)c(N2CCOCC2)cc3
| InChI = 1/C16H20FN3O4/c1-11(21)18-9-13-10-20(16(22)24-13)12-2-3-15(14(17)8-12)19-4-6-23-7-5-19/h2-3,8,13H,4-7,9-10H2,1H3,(H,18,21)/t13-/m0/s1
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C16H20FN3O4/c1-11(21)18-9-13-10-20(16(22)24-13)12-2-3-15(14(17)8-12)19-4-6-23-7-5-19/h2-3,8,13H,4-7,9-10H2,1H3,(H,18,21)/t13-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = TYZROVQLWOKYKF-ZDUSSCGKSA-N
<!-- phys data -->
| density = 1.40
| melting_point = 135
| boiling_point = 140
| boiling_notes = (decomposes)
| solubility = 3}}
{{purge}}

== Test 2 ==
{{testcase table
| Verifiedfields = changed
| Verifiedfields = changed
| Watchedfields = changed
| Watchedfields = changed
| verifiedrevid = 421695281
| verifiedrevid = 401042653
| IUPAC_name = (7''S'',9''E'',11''S'',12''R'',13''S'',14''R'',15''R'',16''R'',17''S'',18''S'',19''E'',21''Z'',26''E'')-26-{[(4-cyclopentylpiperazin-1-yl)amino]methylidene}-2,15,17,29-tetrahydroxy-11-methoxy-3,7,12,14,16,18,22-heptamethyl-6,23,27-trioxo-8,30-dioxa-24-azatetracyclo[23.3.1.1<sup>4,7</sup>.0<sup>5,28</sup>]triaconta-1(28),2,4,9,19,21,25(29)-heptaen-13-yl acetate
| name = {{PAGENAME}}
| image = Rifapentine.svg
| IUPAC_name = (3''R'',5''R'')-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoate
| width = 250
| image = Atorvastatin.svg

| width = 200
<!--Clinical data-->
| image2 = Atorvastatin-1HWK-3D-balls.png
| pronounce = {{IPAc-en|nj|uː|ˈ|m|əʊ|n|i|ə}}
| tradename =
| Drugs.com = {{drugs.com|monograph|rifapentine}}
| MedlinePlus = a602026
| pregnancy_category =
| legal_status =
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability = increases when administered with food
| protein_bound =
| metabolism =
| elimination_half-life =
| onset = 1 hr

<!--Identifiers-->
| CAS_number = 61379-65-5
| ATC_prefix = J04
| ATC_suffix = AB05
| ATC_supplemental =
| PubChem = 5462354
| DrugBank_Ref =
| DrugBank = APRD01217
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 10482075
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = XJM390A33U
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = D00879
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 45304
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1660
| NIAID_ChemDB = 007686

<!--Chemical data-->
| C=47 | H=64 | N=4 | O=12
| molecular_weight = 877.031 g/mol
| smiles = CC(=O)O[C@H]3[C@H](C)[C@H](O)[C@H](C)[C@@H](O)[C@@H](C)\C=C\C=C(\C)C(=O)Nc6c(/C=N/N1CCN(CC1)C2CCCC2)c(O)c5c4C(=O)[C@@](C)(O/C=C/[C@H](OC)[C@H]3C)Oc4c(C)c(O)c5c6O
| InChI = 1/C47H64N4O12/c1-24-13-12-14-25(2)46(59)49-37-32(23-48-51-20-18-50(19-21-51)31-15-10-11-16-31)41(56)34-35(42(37)57)40(55)29(6)44-36(34)45(58)47(8,63-44)61-22-17-33(60-9)26(3)43(62-30(7)52)28(5)39(54)27(4)38(24)53/h12-14,17,22-24,26-28,31,33,38-39,43,53-57H,10-11,15-16,18-21H2,1-9H3,(H,49,59)/b13-12+,22-17+,25-14-,48-23+/t24-,26+,27+,28+,33-,38-,39+,43+,47-/m0/s1
| InChIKey = WDZCUPBHRAEYDL-GZAUEHORBZ
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C47H64N4O12/c1-24-13-12-14-25(2)46(59)49-37-32(23-48-51-20-18-50(19-21-51)31-15-10-11-16-31)41(56)34-35(42(37)57)40(55)29(6)44-36(34)45(58)47(8,63-44)61-22-17-33(60-9)26(3)43(62-30(7)52)28(5)39(54)27(4)38(24)53/h12-14,17,22-24,26-28,31,33,38-39,43,53-57H,10-11,15-16,18-21H2,1-9H3,(H,49,59)/b13-12+,22-17+,25-14-,48-23+/t24-,26+,27+,28+,33-,38-,39+,43+,47-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = WDZCUPBHRAEYDL-GZAUEHORSA-N

| StdInChIKey_comment = Some comment StdInChIkey here
| StdInChI_comment = Commenting here<ref>Hello world</ref>

| synonyms = 3{[(4-cyclopentyl-1-piperazinyl)imino]methyl}rifamycin
}}

{{Section references}}

== Test 3 ==
{{testcase table
| image =

<!--Vacine data-->
| type = vaccine
| target = [[Tuberculosis]]
| vaccine_type = live

<!--Clinical data-->
| pronounce = {{IPAc-en|nj|uː|ˈ|m|əʊ|n|i|ə}}
| Drugs.com = {{drugs.com|pro|bcg-vaccine}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = C
| pregnancy_category =
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = Rx-only
| legal_status =
| routes_of_administration = Percutaneous

<!--Identifiers-->
| CAS_number =
| ATC_prefix = J07
| ATC_suffix = AN01
| PubChem =
| DrugBank =
| ChemSpiderID = NA

<!--Chemical data-->
}}

== Test 4 ==
{{testcase table
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477861573
| name = Atorvastatin
| IUPAC_name = (3''R'',5''R'')-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoic acid
| image = Atorvastatin2DCSD.svg
| width = 300
| image2 = Atorvastatin3Dan.gif
| width2 = 250


<!--Clinical data-->
<!--Clinical data-->
| pronounce = {{IPAc-en|nj|uː|ˈ|m|əʊ|n|i|ə}}
| tradename = Lipitor
| tradename = Lipitor, Atorva
| Drugs.com = {{drugs.com|monograph|lipitor}}
| Drugs.com = {{drugs.com|monograph|lipitor}}
| MedlinePlus = a600045
| MedlinePlus = a600045
| licence_US = Atorvastatin
| licence_US = Atorvastatin
| pregnancy_AU = C
| pregnancy_AU = D
| pregnancy_US = X
| pregnancy_US = X
| legal_AU = S4
| legal_AU = S4
Line 28: Line 241:
| elimination_half-life = 14 h
| elimination_half-life = 14 h
| excretion = [[Bile]]
| excretion = [[Bile]]
| onset = 1 hr


<!--Identifiers-->
<!--Identifiers-->
Line 35: Line 249:
| ATC_suffix = AA05
| ATC_suffix = AA05
| PubChem = 60823
| PubChem = 60823
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank = DB01076
| DrugBank = APRD00055
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 54810
| ChemSpiderID = 54810
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = <!-- blanked - oldvalue: A0JWA85V8F -->
| UNII = A0JWA85V8F
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07474
| KEGG = D07474
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 39548
| ChEBI = 39548
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1487
| ChEMBL = 1487
| PDB_ligand = 117
| IUPHAR_ligand = 2949


<!--Chemical data-->
<!--Chemical data-->
| C=33 | H=35 | F=1 | N=2 | O=5
| C=33 | H=35 | F=1 | N=2| Ca=2 | O=5
| molecular_weight = 558.64
| molecular_weight = 558.64
| smiles = O=C(O)C[C@H](O)C[C@H](O)CCn2c(c(c(c2c1ccc(F)cc1)c3ccccc3)C(=O)Nc4ccccc4)C(C)C
| smiles = O=C(O)C[C@H](O)C[C@H](O)CCn2c(c(c(c2c1ccc(F)cc1)c3ccccc3)C(=O)Nc4ccccc4)C(C)C
Line 58: Line 274:
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = XUKUURHRXDUEBC-KAYWLYCHSA-N
| StdInChIKey = XUKUURHRXDUEBC-KAYWLYCHSA-N
}}

== Test all 1 ==
{{Testcase table
| drug_name = 1
| pronounce = {{IPAc-en|nj|uː|ˈ|m|əʊ|n|i|ə}}
| imagename = 2
| type = 3
| name = testcases
| image = Simple shapes example.png
| width = 175px
| alt = an example image
| image2 = Nocover.svg
| width2 = 150px
| alt2 = another example image
| caption = some images
| IUPAC_name = 12
| target = 13
| vaccine_type = Toxoid
| mab_type = F(ab')2
| source = xi/a
| component1 = 17
| class1 = 18
| component2 = 19
| class2 = 20
| component3 = 21
| class3 = 22
| component4 = 23
| class4 = 24
| tradename = 25
| ASHP = 26
| Drugs.com = 27
| eMedicine = 28
| MedlinePlus = 29
| licence_EU = 30
| licence_US = 31
| DailyMedID = 32
| pregnancy_AU = B3
| pregnancy_US = C
| pregnancy_category = 35
| legal_AU = S4
| legal_CA = Schedule IV
| legal_UK = POM
| legal_US = Schedule III
| legal_UN = N II III
| legal_EU = Category 2 Precursor
| legal_status = RX
| dependency_liability = 43
| routes_of_administration = 44
| bioavailability = 45
| protein_bound = 46
| metabolism = 47
| onset = 47.5
| elimination_half-life = 48
| excretion = 49
| CAS_number = 50
| CAS_number_Ref = 51
| CAS_supplemental = 52
| ATCvet = 53
| ATC_prefix = 54
| ATC_suffix = 55
| ATC_supplemental = 56
| PubChem = 57
| PubChemSubstance = 58
| IUPHAR_ligand = 59
| DrugBank = 60
| ChemSpiderID = 61
| ChemSpiderID_Ref = 62
| UNII = 63
| UNII_Ref = 64
| KEGG = 65
| KEGG_Ref = 66
| ChEBI = 67
| ChEBI_Ref = 68
| ChEMBL = 69
| ChEMBL_Ref = 70
| NIAID_ChemDB = 71
| synonyms = 72
| PDB_ligand = 73
| chemical_formula = 74 <!-- overrides next set of parameters -->
| C = 1
| H = 2
| Ag = 3
| Al = 4
| As = 5
| Au = 6
| B = 7
| Bi = 8
| Br = 9
| Ca = 10
| Cl = 11
| Co = 12
| Cr = 13
| F = 14
| Fe = 15
| Gd = 16
| Hg = 17
| I = 18
| K = 19
| Li = 20
| Mg = 21
| Mn = 22
| N = 23
| Na = 24
| O = 25
| P = 26
| Pt = 27
| S = 28
| Sb = 29
| Se = 30
| Si = 31
| Sr = 32
| Tc = 33
| Zn = 34
| charge = -1
| molecular_weight = 75
| smiles = 76
| StdInChI = 77
| StdInChI_comment = 78
| StdInChI_Ref = 79
| StdInChIKey = 80
| StdInChIKey_comment = 81
| StdInChIKey_Ref = 82
| density = 83
| density_notes = note83
| melting_point = 84
| melting_high = 85
| melting_notes = 86
| boiling_point = 87
| boiling_notes = 88
| solubility = 89
| specific_rotation = 90
| sec_combustion = 91
| Verifiedfields = 92
| verifiedrevid = 93
}}

== Test all 2 ==
{{Testcase table
| drug_name = 1
| pronounce = {{IPAc-en|nj|uː|ˈ|m|əʊ|n|i|ə}}
| imagename = 2
| type = combo
| name = testcases
| image = Simple shapes example.png
| width = 175px
| alt = an example image
| image2 = Nocover.svg
| width2 = 150px
| alt2 = another example image
| caption = some images
| IUPAC_name = 12
| target = 13
| vaccine_type = Toxoid
| mab_type = F(ab')2
| source = xi/a
| component1 = 17
| class1 = 18
| component2 = 19
| class2 = 20
| component3 = 21
| class3 = 22
| component4 = 23
| class4 = 24
| tradename = 25
| ASHP = 26
| Drugs.com = 27
| eMedicine = 28
| MedlinePlus = 29
| licence_EU = 30
| licence_US = 31
| DailyMedID = 32
| pregnancy_AU = B3
| pregnancy_US = C
| pregnancy_category = 35
| legal_AU = S4
| legal_CA = Schedule IV
| legal_UK = POM
| legal_US = Schedule III
| legal_UN = N II III
| legal_EU = Category 2 Precursor
| legal_status = RX
| dependency_liability = 43
| routes_of_administration = 44
| bioavailability = 45
| protein_bound = 46
| metabolism = 47
| onset = 47.5
| elimination_half-life = 48
| excretion = 49
| CAS_number = 50
| CAS_number_Ref = 51
| CAS_supplemental = 52
| ATCvet = 53
| ATC_prefix = 54
| ATC_suffix = 55
| ATC_supplemental = 56
| PubChem = 57
| PubChemSubstance = 58
| IUPHAR_ligand = 59
| DrugBank = 60
| ChemSpiderID = 61
| ChemSpiderID_Ref = 62
| UNII = 63
| UNII_Ref = 64
| KEGG = 65
| KEGG_Ref = 66
| ChEBI = 67
| ChEBI_Ref = 68
| ChEMBL = 69
| ChEMBL_Ref = 70
| NIAID_ChemDB = 71
| synonyms = 72
| PDB_ligand = 73
| chemical_formula = 74 <!-- overrides next set of parameters -->
| C = 1
| H = 2
| Ag = 3
| Al = 4
| As = 5
| Au = 6
| B = 7
| Bi = 8
| Br = 9
| Ca = 10
| Cl = 11
| Co = 12
| Cr = 13
| F = 14
| Fe = 15
| Gd = 16
| Hg = 17
| I = 18
| K = 19
| Li = 20
| Mg = 21
| Mn = 22
| N = 23
| Na = 24
| O = 25
| P = 26
| Pt = 27
| S = 28
| Sb = 29
| Se = 30
| Si = 31
| Sr = 32
| Tc = 33
| Zn = 34
| charge = -1
| molecular_weight = 75
| smiles = 76
| StdInChI = 77
| StdInChI_comment = 78
| StdInChI_Ref = 79
| StdInChIKey = 80
| StdInChIKey_comment = 81
| StdInChIKey_Ref = 82
| density = 83
| melting_point = 84
| melting_high = 85
| melting_notes = 86
| boiling_point = 87
| boiling_notes = 88
| solubility = 89
| specific_rotation = 90
| sec_combustion = 91
| Verifiedfields = 92
| verifiedrevid = 93
}}
== Test all 3 ==
{{Testcase table
| pronounce = {{IPAc-en|nj|uː|ˈ|m|əʊ|n|i|ə}}
| drug_name = 1
| imagename = 2
| type = vaccine
| name = testcases
| image = Simple shapes example.png
| width = 175px
| alt = an example image
| image2 = Nocover.svg
| width2 = 150px
| alt2 = another example image
| caption = some images
| IUPAC_name = 12
| target = 13
| vaccine_type = Toxoid
| mab_type = F(ab')2
| source = xi/a
| component1 = 17
| class1 = 18
| component2 = 19
| class2 = 20
| component3 = 21
| class3 = 22
| component4 = 23
| class4 = 24
| tradename = 25
| ASHP = 26
| Drugs.com = 27
| eMedicine = 28
| MedlinePlus = 29
| licence_EU = 30
| licence_US = 31
| DailyMedID = 32
| pregnancy_AU = B3
| pregnancy_US = C
| pregnancy_category = 35
| legal_AU = S4
| legal_CA = Schedule IV
| legal_UK = POM
| legal_US = Schedule III
| legal_UN = N II III
| legal_EU = Category 2 Precursor
| legal_status = RX
| dependency_liability = 43
| routes_of_administration = 44
| bioavailability = 45
| protein_bound = 46
| metabolism = 47
| onset = 47.5
| elimination_half-life = 48
| excretion = 49
| CAS_number = 50
| CAS_number_Ref = 51
| CAS_supplemental = 52
| ATCvet = 53
| ATC_prefix = 54
| ATC_suffix = 55
| ATC_supplemental = 56
| PubChem = 57
| PubChemSubstance = 58
| IUPHAR_ligand = 59
| DrugBank = 60
| ChemSpiderID = 61
| ChemSpiderID_Ref = 62
| UNII = 63
| UNII_Ref = 64
| KEGG = 65
| KEGG_Ref = 66
| ChEBI = 67
| ChEBI_Ref = 68
| ChEMBL = 69
| ChEMBL_Ref = 70
| NIAID_ChemDB = 71
| synonyms = 72
| PDB_ligand = 73
| chemical_formula = 74 <!-- overrides next set of parameters -->
| C = 1
| H = 2
| Ag = 3
| Al = 4
| As = 5
| Au = 6
| B = 7
| Bi = 8
| Br = 9
| Ca = 10
| Cl = 11
| Co = 12
| Cr = 13
| F = 14
| Fe = 15
| Gd = 16
| Hg = 17
| I = 18
| K = 19
| Li = 20
| Mg = 21
| Mn = 22
| N = 23
| Na = 24
| O = 25
| P = 26
| Pt = 27
| S = 28
| Sb = 29
| Se = 30
| Si = 31
| Sr = 32
| Tc = 33
| Zn = 34
| charge = -1
| molecular_weight = 75
| smiles = 76
| StdInChI = 77
| StdInChI_comment = 78
| StdInChI_Ref = 79
| StdInChIKey = 80
| StdInChIKey_comment = 81
| StdInChIKey_Ref = 82
| density = 83
| melting_point = 84
| melting_high = 85
| melting_notes = 86
| boiling_point = 87
| boiling_notes = 88
| solubility = 89
| specific_rotation = 90
| sec_combustion = 91
| Verifiedfields = 92
| verifiedrevid = 93
}}
== Test all 4 ==
{{Testcase table
| pronounce = {{IPAc-en|nj|uː|ˈ|m|əʊ|n|i|ə}}
| drug_name = 1
| imagename = 2
| type = mab
| name = testcases
| image = Simple shapes example.png
| width = 175px
| alt = an example image
| image2 = Nocover.svg
| width2 = 150px
| alt2 = another example image
| caption = some images
| IUPAC_name = 12
| target = 13
| vaccine_type = Toxoid
| mab_type = F(ab')2
| source = xi/a
| component1 = 17
| class1 = 18
| component2 = 19
| class2 = 20
| component3 = 21
| class3 = 22
| component4 = 23
| class4 = 24
| tradename = 25
| ASHP = 26
| Drugs.com = 27
| eMedicine = 28
| MedlinePlus = 29
| licence_EU = 30
| licence_US = 31
| DailyMedID = 32
| pregnancy_AU = B3
| pregnancy_US = C
| pregnancy_category = 35
| legal_AU = S4
| legal_CA = Schedule IV
| legal_UK = POM
| legal_US = Schedule III
| legal_UN = N II III
| legal_EU = Category 2 Precursor
| legal_status = RX
| dependency_liability = 43
| addiction_liability = 43b
| routes_of_administration = 44
| bioavailability = 45
| protein_bound = 46
| metabolism = 47
| onset = 47.5
| elimination_half-life = 48
| excretion = 49
| CAS_number = 50
| CAS_number_Ref = 51
| CAS_supplemental = 52
| ATCvet = 53
| ATC_prefix = 54
| ATC_suffix = 55
| ATC_supplemental = 56
| PubChem = 57
| PubChemSubstance = 58
| IUPHAR_ligand = 59
| DrugBank = 60
| ChemSpiderID = 61
| ChemSpiderID_Ref = 62
| UNII = 63
| UNII_Ref = 64
| KEGG = 65
| KEGG_Ref = 66
| ChEBI = 67
| ChEBI_Ref = 68
| ChEMBL = 69
| ChEMBL_Ref = 70
| NIAID_ChemDB = 71
| synonyms = 72
| PDB_ligand = 73
| chemical_formula = 74 <!-- overrides next set of parameters -->
| C = 1
| H = 2
| Ag = 3
| Al = 4
| As = 5
| Au = 6
| B = 7
| Bi = 8
| Br = 9
| Ca = 10
| Cl = 11
| Co = 12
| Cr = 13
| F = 14
| Fe = 15
| Gd = 16
| Hg = 17
| I = 18
| K = 19
| Li = 20
| Mg = 21
| Mn = 22
| N = 23
| Na = 24
| O = 25
| P = 26
| Pt = 27
| S = 28
| Sb = 29
| Se = 30
| Si = 31
| Sr = 32
| Tc = 33
| Zn = 34
| charge = -1
| molecular_weight = 75
| smiles = 76
| StdInChI = 77
| StdInChI_comment = 78
| StdInChI_Ref = 79
| StdInChIKey = 80
| StdInChIKey_comment = 81
| StdInChIKey_Ref = 82
| density = 83
| melting_point = 84
| melting_high = 85
| melting_notes = 86
| boiling_point = 87
| boiling_notes = 88
| solubility = 89
| specific_rotation = 90
| sec_combustion = 91
| Verifiedfields = 92
| verifiedrevid = 93
}}

== Test formula 1 ==
{{Testcase table
| pronounce = {{IPAc-en|nj|uː|ˈ|m|əʊ|n|i|ə}}
| drug_name = 1
| imagename = 2
| type = 3
| name = testcases
| image = Simple shapes example.png
| width = 175px
| alt = an example image
| image2 = Nocover.svg
| width2 = 150px
| alt2 = another example image
| caption = some images
| IUPAC_name = 12
| target = 13
| vaccine_type = Toxoid
| mab_type = F(ab')2
| source = xi/a
| component1 = 17
| class1 = 18
| component2 = 19
| class2 = 20
| component3 = 21
| class3 = 22
| component4 = 23
| class4 = 24
| tradename = 25
| ASHP = 26
| Drugs.com = 27
| eMedicine = 28
| MedlinePlus = 29
| licence_EU = 30
| licence_US = 31
| DailyMedID = 32
| pregnancy_AU = B3
| pregnancy_US = C
| pregnancy_category = 35
| legal_AU = S4
| legal_CA = Schedule IV
| legal_UK = POM
| legal_US = Schedule III
| legal_UN = N II III
| legal_EU = Category 2 Precursor
| legal_status = RX
| dependency_liability = 43
| routes_of_administration = 44
| bioavailability = 45
| protein_bound = 46
| metabolism = 47
| onset = 47.5
| elimination_half-life = 48
| excretion = 49
| CAS_number = 50
| CAS_number_Ref = 51
| CAS_supplemental = 52
| ATCvet = 53
| ATC_prefix = 54
| ATC_suffix = 55
| ATC_supplemental = 56
| PubChem = 57
| PubChemSubstance = 58
| IUPHAR_ligand = 59
| DrugBank = 60
| ChemSpiderID = 61
| ChemSpiderID_Ref = 62
| UNII = 63
| UNII_Ref = 64
| KEGG = 65
| KEGG_Ref = 66
| ChEBI = 67
| ChEBI_Ref = 68
| ChEMBL = 69
| ChEMBL_Ref = 70
| NIAID_ChemDB = 71
| synonyms = 72
| PDB_ligand = 73
| chemical_formula =
| C = 1
| H = 2
| Ag = 3
| Al = 4
| As = 5
| Au = 6
| B = 7
| Bi = 8
| charge = -1
| molecular_weight = 75
| smiles = 76
| StdInChI = 77
| StdInChI_comment = 78
| StdInChI_Ref = 79
| StdInChIKey = 80
| StdInChIKey_comment = 81
| StdInChIKey_Ref = 82
| density = 83
| melting_point = 84
| melting_high = 85
| melting_notes = 86
| boiling_point = 87
| boiling_notes = 88
| solubility = 89
| specific_rotation = 90
| sec_combustion = 91
| Verifiedfields = 92
| verifiedrevid = 93
}}

== Test formula 2 ==
{{Testcase table
| pronounce = {{IPAc-en|nj|uː|ˈ|m|əʊ|n|i|ə}}
| drug_name = 1
| imagename = 2
| type = 3
| name = testcases
| image = Simple shapes example.png
| width = 175px
| alt = an example image
| image2 = Nocover.svg
| width2 = 150px
| alt2 = another example image
| caption = some images
| IUPAC_name = 12
| target = 13
| vaccine_type = Toxoid
| mab_type = F(ab')2
| source = xi/a
| component1 = 17
| class1 = 18
| component2 = 19
| class2 = 20
| component3 = 21
| class3 = 22
| component4 = 23
| class4 = 24
| tradename = 25
| ASHP = 26
| Drugs.com = 27
| eMedicine = 28
| MedlinePlus = 29
| licence_EU = 30
| licence_US = 31
| DailyMedID = 32
| pregnancy_AU = B3
| pregnancy_US = C
| pregnancy_category = 35
| legal_AU = S4
| legal_CA = Schedule IV
| legal_UK = POM
| legal_US = Schedule III
| legal_UN = N II III
| legal_EU = Category 2 Precursor
| legal_status = RX
| dependency_liability = 43
| routes_of_administration = 44
| bioavailability = 45
| protein_bound = 46
| metabolism = 47
| onset = 47.5
| elimination_half-life = 48
| excretion = 49
| CAS_number = 50
| CAS_number_Ref = 51
| CAS_supplemental = 52
| ATCvet = 53
| ATC_prefix = 54
| ATC_suffix = 55
| ATC_supplemental = 56
| PubChem = 57
| PubChemSubstance = 58
| IUPHAR_ligand = 59
| DrugBank = 60
| ChemSpiderID = 61
| ChemSpiderID_Ref = 62
| UNII = 63
| UNII_Ref = 64
| KEGG = 65
| KEGG_Ref = 66
| ChEBI = 67
| ChEBI_Ref = 68
| ChEMBL = 69
| ChEMBL_Ref = 70
| NIAID_ChemDB = 71
| synonyms = 72
| PDB_ligand = 73
| chemical_formula =
| C = 1
| Br = 9
| Ca = 10
| Cl = 11
| Co = 12
| Cr = 13
| F = 14
| Fe = 15
| Gd = 16
| Hg = 17
| charge = -1
| molecular_weight = 75
| smiles = 76
| StdInChI = 77
| StdInChI_comment = 78
| StdInChI_Ref = 79
| StdInChIKey = 80
| StdInChIKey_comment = 81
| StdInChIKey_Ref = 82
| density_notes = note83
| melting_point = 84
| melting_high = 85
| melting_notes = 86
| boiling_point = 87
| boiling_notes = 88
| solubility = 89
| specific_rotation = 90
| sec_combustion = 91
| Verifiedfields = 92
| verifiedrevid = 93
}}

== Test formula 3 ==
{{Testcase table
| pronounce = {{IPAc-en|nj|uː|ˈ|m|əʊ|n|i|ə}}
| drug_name = 1
| imagename = 2
| type = 3
| name = testcases
| image = Simple shapes example.png
| width = 175px
| alt = an example image
| image2 = Nocover.svg
| width2 = 150px
| alt2 = another example image
| caption = some images
| IUPAC_name = 12
| target = 13
| vaccine_type = Toxoid
| mab_type = F(ab')2
| source = xi/a
| component1 = 17
| class1 = 18
| component2 = 19
| class2 = 20
| component3 = 21
| class3 = 22
| component4 = 23
| class4 = 24
| tradename = 25
| ASHP = 26
| Drugs.com = 27
| eMedicine = 28
| MedlinePlus = 29
| licence_EU = 30
| licence_US = 31
| DailyMedID = 32
| pregnancy_AU = B3
| pregnancy_US = C
| pregnancy_category = 35
| legal_AU = S4
| legal_CA = Schedule IV
| legal_UK = POM
| legal_US = Schedule III
| legal_UN = N II III
| legal_EU = Category 2 Precursor
| legal_status = RX
| dependency_liability = 43
| routes_of_administration = 44
| bioavailability = 45
| protein_bound = 46
| metabolism = 47
| onset = 47.5
| elimination_half-life = 48
| excretion = 49
| CAS_number = 50
| CAS_number_Ref = 51
| CAS_supplemental = 52
| ATCvet = 53
| ATC_prefix = 54
| ATC_suffix = 55
| ATC_supplemental = 56
| PubChem = 57
| PubChemSubstance = 58
| IUPHAR_ligand = 59
| DrugBank = 60
| ChemSpiderID = 61
| ChemSpiderID_Ref = 62
| UNII = 63
| UNII_Ref = 64
| KEGG = 65
| KEGG_Ref = 66
| ChEBI = 67
| ChEBI_Ref = 68
| ChEMBL = 69
| ChEMBL_Ref = 70
| NIAID_ChemDB = 71
| synonyms = 72
| PDB_ligand = 73
| chemical_formula =
| I = 18
| K = 19
| Li = 20
| Mg = 21
| Mn = 22
| N = 23
| Na = 24
| O = 25
| P = 26
| Pt = 27
| charge = -1
| molecular_weight = 75
| smiles = 76
| StdInChI = 77
| StdInChI_comment = 78
| StdInChI_Ref = 79
| StdInChIKey = 80
| StdInChIKey_comment = 81
| StdInChIKey_Ref = 82
| density = 83
| melting_point = 84
| melting_high = 85
| melting_notes = 86
| boiling_point = 87
| boiling_notes = 88
| solubility = 89
| specific_rotation = 90
| sec_combustion = 91
| Verifiedfields = 92
| verifiedrevid = 93
}}
== Test formula 4 ==
{{Testcase table
| pronounce = {{IPAc-en|nj|uː|ˈ|m|əʊ|n|i|ə}}
| drug_name = 1
| imagename = 2
| type = 3
| name = testcases
| image = Simple shapes example.png
| width = 175px
| alt = an example image
| image2 = Nocover.svg
| width2 = 150px
| alt2 = another example image
| caption = some images
| IUPAC_name = 12
| target = 13
| vaccine_type = Toxoid
| mab_type = F(ab')2
| source = xi/a
| component1 = 17
| class1 = 18
| component2 = 19
| class2 = 20
| component3 = 21
| class3 = 22
| component4 = 23
| class4 = 24
| tradename = 25
| ASHP = 26
| Drugs.com = 27
| eMedicine = 28
| MedlinePlus = 29
| licence_EU = 30
| licence_US = 31
| DailyMedID = 32
| pregnancy_AU = B3
| pregnancy_US = C
| pregnancy_category = 35
| legal_AU = S4
| legal_CA = Schedule IV
| legal_UK = POM
| legal_US = Schedule III
| legal_UN = N II III
| legal_EU = Category 2 Precursor
| legal_status = RX
| dependency_liability = 43
| routes_of_administration = 44
| bioavailability = 45
| protein_bound = 46
| metabolism = 47
| onset = 47.5
| elimination_half-life = 48
| excretion = 49
| CAS_number = 50
| CAS_number_Ref = 51
| CAS_supplemental = 52
| ATCvet = 53
| ATC_prefix = 54
| ATC_suffix = 55
| ATC_supplemental = 56
| PubChem = 57
| PubChemSubstance = 58
| IUPHAR_ligand = 59
| DrugBank = 60
| ChemSpiderID = 61
| ChemSpiderID_Ref = 62
| UNII = 63
| UNII_Ref = 64
| KEGG = 65
| KEGG_Ref = 66
| ChEBI = 67
| ChEBI_Ref = 68
| ChEMBL = 69
| ChEMBL_Ref = 70
| NIAID_ChemDB = 71
| synonyms = 72
| PDB_ligand = 73
| chemical_formula =
| S = 28
| Sb = 29
| Se = 30
| Si = 31
| Sr = 32
| Tc = 33
| Zn = 34
| charge = -1
| molecular_weight = 75
| smiles = 76
| StdInChI = 77
| StdInChI_comment = 78
| StdInChI_Ref = 79
| StdInChIKey = 80
| StdInChIKey_comment = 81
| StdInChIKey_Ref = 82
| density = 83
| melting_point = 84
| melting_high = 85
| melting_notes = 86
| boiling_point = 87
| boiling_notes = 88
| solubility = 89
| specific_rotation = 90
| sec_combustion = 91
| Verifiedfields = 92
| verifiedrevid = 93
}}
}}
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"