User:Edgar~enwiki and Template:Infobox drug/testcases: Difference between pages
Appearance
(Difference between pages)
Content deleted Content added
mNo edit summary |
→Paracetamol: xfer to new test page |
||
Line 1: | Line 1: | ||
{{Testcases}} |
|||
nothing special. |
|||
{{Infobox drug/testcases/navbox|state=collapsed}} |
|||
==biosimilars== |
|||
:eg [[Rituximab]] |
|||
{{testcase table |
|||
|name=rituximab |
|||
|synonyms=synonyms |
|||
|biosimilars=rituximab-abbs,<ref name="Truxima FDA label">{{cite web | title=Truxima- rituximab-abbs injection, solution | website=DailyMed | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=9af3ddc7-4217-417a-ac89-8704edc5bc44 | access-date=26 March 2021}}</ref> rituximab-pvvr,<ref name="Ruxience FDA label">{{cite web | title=Ruxience- rituximab-pvvr injection, solution | website=DailyMed | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=f941fc61-f7a3-4e4a-ab7c-87c1667fa05b | access-date=26 March 2021}}</ref> rituximab-arrx<ref name="Riabni FDA label">{{cite web | title=Riabni- rituximab-arrx injection, solution | website=DailyMed | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=da1c4de7-0e5b-4f72-97ec-7a8d368f085f | access-date=26 March 2021}}</ref> |
|||
|Drugs.com = {{drugs.com|monograph|rituximab}} |
|||
}} |
|||
{{Section references}} |
|||
== Test Brazilian Legal Status == |
|||
{{testcase table |
|||
| image = |
|||
<!--Legal Status--> |
|||
| legal_status = |
|||
| legal_AU = S2 |
|||
| legal_BR = A1 |
|||
| legal_CA = Schedule I |
|||
| legal_DE = Anlage I |
|||
| legal_UK = GSL |
|||
| legal_US = Rx-only |
|||
}} |
|||
== Test 0 = blanks == |
|||
{{testcase table |
|||
| legal_status = |
|||
| legal_AU = |
|||
}} |
|||
== Test 1 == |
|||
{{purge}} |
|||
{{testcase table |
|||
| name = {{PAGENAME}} |
|||
| INN = [[Linezolid]] |
|||
| Verifiedfields = changed |
|||
| verifiedrevid = 415028406 |
|||
| IUPAC_name = (''S'')-''N''-({3-[3-fluoro-4-(morpholin-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl}methyl)acetamide |
|||
| image = Linezolid.svg |
|||
| alt = Skeletal formula of linezolid |
|||
| image2 = Linezolid-from-xtal-2008-3D-balls.png |
|||
<!--Clinical data--> |
|||
| pronounce = {{IPAc-en|nj|uː|ˈ|m|əʊ|n|i|ə}} |
|||
| tradename = Linospan, Zyvox, Zyvoxam, Zyvoxid |
|||
| Drugs.com = {{drugs.com|monograph|linezolid}} |
|||
| MedlinePlus = a602004 |
|||
| licence_CA = Linezolid |
|||
| licence_EU = Linezolid |
|||
| DailyMedID = Linezolid |
|||
| licence_US = Linezolid |
|||
| pregnancy_US = C |
|||
| pregnancy_AU = C |
|||
| legal_status_AU = S4 |
|||
| legal_status_UK = POM |
|||
| legal_status_US = ℞-only |
|||
| routes_of_administration = [[Intravenous therapy|Intravenous infusion]], oral |
|||
| dependency_liability = High |
|||
| addiction_liability = Low |
|||
<!--Pharmacokinetic data--> |
|||
| metabolites = some stuff |
|||
| duration_of_action= 1 to 3 hr |
|||
| bioavailability = ~100% (oral) |
|||
| protein_bound = Low (31%) |
|||
| metabolism = [[Liver|Hepatic]] (50–70%, [[cytochrome P450|CYP]] not involved) |
|||
| elimination_half-life = 4.2–5.4 hours (shorter in children) |
|||
| excretion = Nonrenal, [[kidney|renal]], and fecal |
|||
| onset = 1 hr |
|||
<!--Identifiers--> |
|||
| synonyms = Lenzomore |
|||
| CASNo_Ref = {{cascite|correct|CAS}} |
|||
| CAS_number_Ref = {{cascite|correct|??}} |
|||
| CAS_number = 165800-03-3 |
|||
| ATC_prefix = J01 |
|||
| ATC_suffix = XX08 |
|||
| PubChem = 441401 |
|||
| DrugBank_Ref = |
|||
| DrugBank = DB00601 |
|||
| ChemSpiderID_Ref = |
|||
| ChemSpiderID = |
|||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
| UNII = ISQ9I6J12J |
|||
| KEGG_Ref = {{keggcite|correct|kegg}} |
|||
| KEGG = D00947 |
|||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|||
| ChEMBL = 126 |
|||
| NIAID_ChemDB = 070944 |
|||
| PDB_ligand = ZLD |
|||
| IUPHAR_ligand = 1234 |
|||
<!--Chemical data--> |
|||
| C=16 | H=20 | F=1 | N=3 | O=4 |
|||
| molecular_weight = 337.346 g/mol |
|||
| smiles = O=C1O[C@@H](CNC(=O)C)CN1c3cc(F)c(N2CCOCC2)cc3 |
|||
| InChI = 1/C16H20FN3O4/c1-11(21)18-9-13-10-20(16(22)24-13)12-2-3-15(14(17)8-12)19-4-6-23-7-5-19/h2-3,8,13H,4-7,9-10H2,1H3,(H,18,21)/t13-/m0/s1 |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChI = 1S/C16H20FN3O4/c1-11(21)18-9-13-10-20(16(22)24-13)12-2-3-15(14(17)8-12)19-4-6-23-7-5-19/h2-3,8,13H,4-7,9-10H2,1H3,(H,18,21)/t13-/m0/s1 |
|||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChIKey = TYZROVQLWOKYKF-ZDUSSCGKSA-N |
|||
<!-- phys data --> |
|||
| density = 1.40 |
|||
| melting_point = 135 |
|||
| boiling_point = 140 |
|||
| boiling_notes = (decomposes) |
|||
| solubility = 3}} |
|||
{{purge}} |
|||
== Test 2 == |
|||
{{testcase table |
|||
| Verifiedfields = changed |
|||
| Watchedfields = changed |
|||
| verifiedrevid = 401042653 |
|||
| IUPAC_name = (7''S'',9''E'',11''S'',12''R'',13''S'',14''R'',15''R'',16''R'',17''S'',18''S'',19''E'',21''Z'',26''E'')-26-{[(4-cyclopentylpiperazin-1-yl)amino]methylidene}-2,15,17,29-tetrahydroxy-11-methoxy-3,7,12,14,16,18,22-heptamethyl-6,23,27-trioxo-8,30-dioxa-24-azatetracyclo[23.3.1.1<sup>4,7</sup>.0<sup>5,28</sup>]triaconta-1(28),2,4,9,19,21,25(29)-heptaen-13-yl acetate |
|||
| image = Rifapentine.svg |
|||
| width = 250 |
|||
<!--Clinical data--> |
|||
| pronounce = {{IPAc-en|nj|uː|ˈ|m|əʊ|n|i|ə}} |
|||
| tradename = |
|||
| Drugs.com = {{drugs.com|monograph|rifapentine}} |
|||
| MedlinePlus = a602026 |
|||
| pregnancy_category = |
|||
| legal_status = |
|||
| routes_of_administration = |
|||
<!--Pharmacokinetic data--> |
|||
| bioavailability = increases when administered with food |
|||
| protein_bound = |
|||
| metabolism = |
|||
| elimination_half-life = |
|||
| onset = 1 hr |
|||
<!--Identifiers--> |
|||
| CAS_number = 61379-65-5 |
|||
| ATC_prefix = J04 |
|||
| ATC_suffix = AB05 |
|||
| ATC_supplemental = |
|||
| PubChem = 5462354 |
|||
| DrugBank_Ref = |
|||
| DrugBank = APRD01217 |
|||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|||
| ChemSpiderID = 10482075 |
|||
| UNII_Ref = {{fdacite|changed|FDA}} |
|||
| UNII = XJM390A33U |
|||
| KEGG_Ref = {{keggcite|changed|kegg}} |
|||
| KEGG = D00879 |
|||
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|||
| ChEBI = 45304 |
|||
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|||
| ChEMBL = 1660 |
|||
| NIAID_ChemDB = 007686 |
|||
<!--Chemical data--> |
|||
| C=47 | H=64 | N=4 | O=12 |
|||
| molecular_weight = 877.031 g/mol |
|||
| smiles = CC(=O)O[C@H]3[C@H](C)[C@H](O)[C@H](C)[C@@H](O)[C@@H](C)\C=C\C=C(\C)C(=O)Nc6c(/C=N/N1CCN(CC1)C2CCCC2)c(O)c5c4C(=O)[C@@](C)(O/C=C/[C@H](OC)[C@H]3C)Oc4c(C)c(O)c5c6O |
|||
| InChI = 1/C47H64N4O12/c1-24-13-12-14-25(2)46(59)49-37-32(23-48-51-20-18-50(19-21-51)31-15-10-11-16-31)41(56)34-35(42(37)57)40(55)29(6)44-36(34)45(58)47(8,63-44)61-22-17-33(60-9)26(3)43(62-30(7)52)28(5)39(54)27(4)38(24)53/h12-14,17,22-24,26-28,31,33,38-39,43,53-57H,10-11,15-16,18-21H2,1-9H3,(H,49,59)/b13-12+,22-17+,25-14-,48-23+/t24-,26+,27+,28+,33-,38-,39+,43+,47-/m0/s1 |
|||
| InChIKey = WDZCUPBHRAEYDL-GZAUEHORBZ |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChI = 1S/C47H64N4O12/c1-24-13-12-14-25(2)46(59)49-37-32(23-48-51-20-18-50(19-21-51)31-15-10-11-16-31)41(56)34-35(42(37)57)40(55)29(6)44-36(34)45(58)47(8,63-44)61-22-17-33(60-9)26(3)43(62-30(7)52)28(5)39(54)27(4)38(24)53/h12-14,17,22-24,26-28,31,33,38-39,43,53-57H,10-11,15-16,18-21H2,1-9H3,(H,49,59)/b13-12+,22-17+,25-14-,48-23+/t24-,26+,27+,28+,33-,38-,39+,43+,47-/m0/s1 |
|||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChIKey = WDZCUPBHRAEYDL-GZAUEHORSA-N |
|||
| StdInChIKey_comment = Some comment StdInChIkey here |
|||
| StdInChI_comment = Commenting here<ref>Hello world</ref> |
|||
| synonyms = 3{[(4-cyclopentyl-1-piperazinyl)imino]methyl}rifamycin |
|||
}} |
|||
{{Section references}} |
|||
== Test 3 == |
|||
{{testcase table |
|||
| image = |
|||
<!--Vacine data--> |
|||
| type = vaccine |
|||
| target = [[Tuberculosis]] |
|||
| vaccine_type = live |
|||
<!--Clinical data--> |
|||
| pronounce = {{IPAc-en|nj|uː|ˈ|m|əʊ|n|i|ə}} |
|||
| Drugs.com = {{drugs.com|pro|bcg-vaccine}} |
|||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|||
| pregnancy_US = C |
|||
| pregnancy_category = |
|||
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|||
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|||
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|||
| legal_US = Rx-only |
|||
| legal_status = |
|||
| routes_of_administration = Percutaneous |
|||
<!--Identifiers--> |
|||
| CAS_number = |
|||
| ATC_prefix = J07 |
|||
| ATC_suffix = AN01 |
|||
| PubChem = |
|||
| DrugBank = |
|||
| ChemSpiderID = NA |
|||
<!--Chemical data--> |
|||
}} |
|||
== Test 4 == |
|||
{{testcase table |
|||
| Verifiedfields = changed |
|||
| Watchedfields = changed |
|||
| verifiedrevid = 477861573 |
|||
| name = Atorvastatin |
|||
| IUPAC_name = (3''R'',5''R'')-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoic acid |
|||
| image = Atorvastatin2DCSD.svg |
|||
| width = 300 |
|||
| image2 = Atorvastatin3Dan.gif |
|||
| width2 = 250 |
|||
<!--Clinical data--> |
|||
| pronounce = {{IPAc-en|nj|uː|ˈ|m|əʊ|n|i|ə}} |
|||
| tradename = Lipitor, Atorva |
|||
| Drugs.com = {{drugs.com|monograph|lipitor}} |
|||
| MedlinePlus = a600045 |
|||
| licence_US = Atorvastatin |
|||
| pregnancy_AU = D |
|||
| pregnancy_US = X |
|||
| legal_AU = S4 |
|||
| legal_UK = POM |
|||
| legal_US = Rx-only |
|||
| routes_of_administration = Oral |
|||
| DailyMedID = 42465 |
|||
<!--Pharmacokinetic data--> |
|||
| bioavailability = 12% |
|||
| metabolism = [[Liver|Hepatic]] - [[CYP3A4]] |
|||
| elimination_half-life = 14 h |
|||
| excretion = [[Bile]] |
|||
| onset = 1 hr |
|||
<!--Identifiers--> |
|||
| CAS_number_Ref = {{cascite|correct|??}} |
|||
| CAS_number = 134523-00-5 |
|||
| ATC_prefix = C10 |
|||
| ATC_suffix = AA05 |
|||
| PubChem = 60823 |
|||
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|||
| DrugBank = APRD00055 |
|||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|||
| ChemSpiderID = 54810 |
|||
| UNII_Ref = {{fdacite|changed|FDA}} |
|||
| UNII = A0JWA85V8F |
|||
| KEGG_Ref = {{keggcite|correct|kegg}} |
|||
| KEGG = D07474 |
|||
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|||
| ChEBI = 39548 |
|||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|||
| ChEMBL = 1487 |
|||
| PDB_ligand = 117 |
|||
| IUPHAR_ligand = 2949 |
|||
<!--Chemical data--> |
|||
| C=33 | H=35 | F=1 | N=2| Ca=2 | O=5 |
|||
| molecular_weight = 558.64 |
|||
| smiles = O=C(O)C[C@H](O)C[C@H](O)CCn2c(c(c(c2c1ccc(F)cc1)c3ccccc3)C(=O)Nc4ccccc4)C(C)C |
|||
| InChI = 1/C33H35FN2O5/c1-21(2)31-30(33(41)35-25-11-7-4-8-12-25)29(22-9-5-3-6-10-22)32(23-13-15-24(34)16-14-23)36(31)18-17-26(37)19-27(38)20-28(39)40/h3-16,21,26-27,37-38H,17-20H2,1-2H3,(H,35,41)(H,39,40)/t26-,27-/m1/s1 |
|||
| InChIKey = XUKUURHRXDUEBC-KAYWLYCHBX |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChI = 1S/C33H35FN2O5/c1-21(2)31-30(33(41)35-25-11-7-4-8-12-25)29(22-9-5-3-6-10-22)32(23-13-15-24(34)16-14-23)36(31)18-17-26(37)19-27(38)20-28(39)40/h3-16,21,26-27,37-38H,17-20H2,1-2H3,(H,35,41)(H,39,40)/t26-,27-/m1/s1 |
|||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChIKey = XUKUURHRXDUEBC-KAYWLYCHSA-N |
|||
}} |
|||
== Test all 1 == |
|||
{{Testcase table |
|||
| drug_name = 1 |
|||
| pronounce = {{IPAc-en|nj|uː|ˈ|m|əʊ|n|i|ə}} |
|||
| imagename = 2 |
|||
| type = 3 |
|||
| name = testcases |
|||
| image = Simple shapes example.png |
|||
| width = 175px |
|||
| alt = an example image |
|||
| image2 = Nocover.svg |
|||
| width2 = 150px |
|||
| alt2 = another example image |
|||
| caption = some images |
|||
| IUPAC_name = 12 |
|||
| target = 13 |
|||
| vaccine_type = Toxoid |
|||
| mab_type = F(ab')2 |
|||
| source = xi/a |
|||
| component1 = 17 |
|||
| class1 = 18 |
|||
| component2 = 19 |
|||
| class2 = 20 |
|||
| component3 = 21 |
|||
| class3 = 22 |
|||
| component4 = 23 |
|||
| class4 = 24 |
|||
| tradename = 25 |
|||
| ASHP = 26 |
|||
| Drugs.com = 27 |
|||
| eMedicine = 28 |
|||
| MedlinePlus = 29 |
|||
| licence_EU = 30 |
|||
| licence_US = 31 |
|||
| DailyMedID = 32 |
|||
| pregnancy_AU = B3 |
|||
| pregnancy_US = C |
|||
| pregnancy_category = 35 |
|||
| legal_AU = S4 |
|||
| legal_CA = Schedule IV |
|||
| legal_UK = POM |
|||
| legal_US = Schedule III |
|||
| legal_UN = N II III |
|||
| legal_EU = Category 2 Precursor |
|||
| legal_status = RX |
|||
| dependency_liability = 43 |
|||
| routes_of_administration = 44 |
|||
| bioavailability = 45 |
|||
| protein_bound = 46 |
|||
| metabolism = 47 |
|||
| onset = 47.5 |
|||
| elimination_half-life = 48 |
|||
| excretion = 49 |
|||
| CAS_number = 50 |
|||
| CAS_number_Ref = 51 |
|||
| CAS_supplemental = 52 |
|||
| ATCvet = 53 |
|||
| ATC_prefix = 54 |
|||
| ATC_suffix = 55 |
|||
| ATC_supplemental = 56 |
|||
| PubChem = 57 |
|||
| PubChemSubstance = 58 |
|||
| IUPHAR_ligand = 59 |
|||
| DrugBank = 60 |
|||
| ChemSpiderID = 61 |
|||
| ChemSpiderID_Ref = 62 |
|||
| UNII = 63 |
|||
| UNII_Ref = 64 |
|||
| KEGG = 65 |
|||
| KEGG_Ref = 66 |
|||
| ChEBI = 67 |
|||
| ChEBI_Ref = 68 |
|||
| ChEMBL = 69 |
|||
| ChEMBL_Ref = 70 |
|||
| NIAID_ChemDB = 71 |
|||
| synonyms = 72 |
|||
| PDB_ligand = 73 |
|||
| chemical_formula = 74 <!-- overrides next set of parameters --> |
|||
| C = 1 |
|||
| H = 2 |
|||
| Ag = 3 |
|||
| Al = 4 |
|||
| As = 5 |
|||
| Au = 6 |
|||
| B = 7 |
|||
| Bi = 8 |
|||
| Br = 9 |
|||
| Ca = 10 |
|||
| Cl = 11 |
|||
| Co = 12 |
|||
| Cr = 13 |
|||
| F = 14 |
|||
| Fe = 15 |
|||
| Gd = 16 |
|||
| Hg = 17 |
|||
| I = 18 |
|||
| K = 19 |
|||
| Li = 20 |
|||
| Mg = 21 |
|||
| Mn = 22 |
|||
| N = 23 |
|||
| Na = 24 |
|||
| O = 25 |
|||
| P = 26 |
|||
| Pt = 27 |
|||
| S = 28 |
|||
| Sb = 29 |
|||
| Se = 30 |
|||
| Si = 31 |
|||
| Sr = 32 |
|||
| Tc = 33 |
|||
| Zn = 34 |
|||
| charge = -1 |
|||
| molecular_weight = 75 |
|||
| smiles = 76 |
|||
| StdInChI = 77 |
|||
| StdInChI_comment = 78 |
|||
| StdInChI_Ref = 79 |
|||
| StdInChIKey = 80 |
|||
| StdInChIKey_comment = 81 |
|||
| StdInChIKey_Ref = 82 |
|||
| density = 83 |
|||
| density_notes = note83 |
|||
| melting_point = 84 |
|||
| melting_high = 85 |
|||
| melting_notes = 86 |
|||
| boiling_point = 87 |
|||
| boiling_notes = 88 |
|||
| solubility = 89 |
|||
| specific_rotation = 90 |
|||
| sec_combustion = 91 |
|||
| Verifiedfields = 92 |
|||
| verifiedrevid = 93 |
|||
}} |
|||
== Test all 2 == |
|||
{{Testcase table |
|||
| drug_name = 1 |
|||
| pronounce = {{IPAc-en|nj|uː|ˈ|m|əʊ|n|i|ə}} |
|||
| imagename = 2 |
|||
| type = combo |
|||
| name = testcases |
|||
| image = Simple shapes example.png |
|||
| width = 175px |
|||
| alt = an example image |
|||
| image2 = Nocover.svg |
|||
| width2 = 150px |
|||
| alt2 = another example image |
|||
| caption = some images |
|||
| IUPAC_name = 12 |
|||
| target = 13 |
|||
| vaccine_type = Toxoid |
|||
| mab_type = F(ab')2 |
|||
| source = xi/a |
|||
| component1 = 17 |
|||
| class1 = 18 |
|||
| component2 = 19 |
|||
| class2 = 20 |
|||
| component3 = 21 |
|||
| class3 = 22 |
|||
| component4 = 23 |
|||
| class4 = 24 |
|||
| tradename = 25 |
|||
| ASHP = 26 |
|||
| Drugs.com = 27 |
|||
| eMedicine = 28 |
|||
| MedlinePlus = 29 |
|||
| licence_EU = 30 |
|||
| licence_US = 31 |
|||
| DailyMedID = 32 |
|||
| pregnancy_AU = B3 |
|||
| pregnancy_US = C |
|||
| pregnancy_category = 35 |
|||
| legal_AU = S4 |
|||
| legal_CA = Schedule IV |
|||
| legal_UK = POM |
|||
| legal_US = Schedule III |
|||
| legal_UN = N II III |
|||
| legal_EU = Category 2 Precursor |
|||
| legal_status = RX |
|||
| dependency_liability = 43 |
|||
| routes_of_administration = 44 |
|||
| bioavailability = 45 |
|||
| protein_bound = 46 |
|||
| metabolism = 47 |
|||
| onset = 47.5 |
|||
| elimination_half-life = 48 |
|||
| excretion = 49 |
|||
| CAS_number = 50 |
|||
| CAS_number_Ref = 51 |
|||
| CAS_supplemental = 52 |
|||
| ATCvet = 53 |
|||
| ATC_prefix = 54 |
|||
| ATC_suffix = 55 |
|||
| ATC_supplemental = 56 |
|||
| PubChem = 57 |
|||
| PubChemSubstance = 58 |
|||
| IUPHAR_ligand = 59 |
|||
| DrugBank = 60 |
|||
| ChemSpiderID = 61 |
|||
| ChemSpiderID_Ref = 62 |
|||
| UNII = 63 |
|||
| UNII_Ref = 64 |
|||
| KEGG = 65 |
|||
| KEGG_Ref = 66 |
|||
| ChEBI = 67 |
|||
| ChEBI_Ref = 68 |
|||
| ChEMBL = 69 |
|||
| ChEMBL_Ref = 70 |
|||
| NIAID_ChemDB = 71 |
|||
| synonyms = 72 |
|||
| PDB_ligand = 73 |
|||
| chemical_formula = 74 <!-- overrides next set of parameters --> |
|||
| C = 1 |
|||
| H = 2 |
|||
| Ag = 3 |
|||
| Al = 4 |
|||
| As = 5 |
|||
| Au = 6 |
|||
| B = 7 |
|||
| Bi = 8 |
|||
| Br = 9 |
|||
| Ca = 10 |
|||
| Cl = 11 |
|||
| Co = 12 |
|||
| Cr = 13 |
|||
| F = 14 |
|||
| Fe = 15 |
|||
| Gd = 16 |
|||
| Hg = 17 |
|||
| I = 18 |
|||
| K = 19 |
|||
| Li = 20 |
|||
| Mg = 21 |
|||
| Mn = 22 |
|||
| N = 23 |
|||
| Na = 24 |
|||
| O = 25 |
|||
| P = 26 |
|||
| Pt = 27 |
|||
| S = 28 |
|||
| Sb = 29 |
|||
| Se = 30 |
|||
| Si = 31 |
|||
| Sr = 32 |
|||
| Tc = 33 |
|||
| Zn = 34 |
|||
| charge = -1 |
|||
| molecular_weight = 75 |
|||
| smiles = 76 |
|||
| StdInChI = 77 |
|||
| StdInChI_comment = 78 |
|||
| StdInChI_Ref = 79 |
|||
| StdInChIKey = 80 |
|||
| StdInChIKey_comment = 81 |
|||
| StdInChIKey_Ref = 82 |
|||
| density = 83 |
|||
| melting_point = 84 |
|||
| melting_high = 85 |
|||
| melting_notes = 86 |
|||
| boiling_point = 87 |
|||
| boiling_notes = 88 |
|||
| solubility = 89 |
|||
| specific_rotation = 90 |
|||
| sec_combustion = 91 |
|||
| Verifiedfields = 92 |
|||
| verifiedrevid = 93 |
|||
}} |
|||
== Test all 3 == |
|||
{{Testcase table |
|||
| pronounce = {{IPAc-en|nj|uː|ˈ|m|əʊ|n|i|ə}} |
|||
| drug_name = 1 |
|||
| imagename = 2 |
|||
| type = vaccine |
|||
| name = testcases |
|||
| image = Simple shapes example.png |
|||
| width = 175px |
|||
| alt = an example image |
|||
| image2 = Nocover.svg |
|||
| width2 = 150px |
|||
| alt2 = another example image |
|||
| caption = some images |
|||
| IUPAC_name = 12 |
|||
| target = 13 |
|||
| vaccine_type = Toxoid |
|||
| mab_type = F(ab')2 |
|||
| source = xi/a |
|||
| component1 = 17 |
|||
| class1 = 18 |
|||
| component2 = 19 |
|||
| class2 = 20 |
|||
| component3 = 21 |
|||
| class3 = 22 |
|||
| component4 = 23 |
|||
| class4 = 24 |
|||
| tradename = 25 |
|||
| ASHP = 26 |
|||
| Drugs.com = 27 |
|||
| eMedicine = 28 |
|||
| MedlinePlus = 29 |
|||
| licence_EU = 30 |
|||
| licence_US = 31 |
|||
| DailyMedID = 32 |
|||
| pregnancy_AU = B3 |
|||
| pregnancy_US = C |
|||
| pregnancy_category = 35 |
|||
| legal_AU = S4 |
|||
| legal_CA = Schedule IV |
|||
| legal_UK = POM |
|||
| legal_US = Schedule III |
|||
| legal_UN = N II III |
|||
| legal_EU = Category 2 Precursor |
|||
| legal_status = RX |
|||
| dependency_liability = 43 |
|||
| routes_of_administration = 44 |
|||
| bioavailability = 45 |
|||
| protein_bound = 46 |
|||
| metabolism = 47 |
|||
| onset = 47.5 |
|||
| elimination_half-life = 48 |
|||
| excretion = 49 |
|||
| CAS_number = 50 |
|||
| CAS_number_Ref = 51 |
|||
| CAS_supplemental = 52 |
|||
| ATCvet = 53 |
|||
| ATC_prefix = 54 |
|||
| ATC_suffix = 55 |
|||
| ATC_supplemental = 56 |
|||
| PubChem = 57 |
|||
| PubChemSubstance = 58 |
|||
| IUPHAR_ligand = 59 |
|||
| DrugBank = 60 |
|||
| ChemSpiderID = 61 |
|||
| ChemSpiderID_Ref = 62 |
|||
| UNII = 63 |
|||
| UNII_Ref = 64 |
|||
| KEGG = 65 |
|||
| KEGG_Ref = 66 |
|||
| ChEBI = 67 |
|||
| ChEBI_Ref = 68 |
|||
| ChEMBL = 69 |
|||
| ChEMBL_Ref = 70 |
|||
| NIAID_ChemDB = 71 |
|||
| synonyms = 72 |
|||
| PDB_ligand = 73 |
|||
| chemical_formula = 74 <!-- overrides next set of parameters --> |
|||
| C = 1 |
|||
| H = 2 |
|||
| Ag = 3 |
|||
| Al = 4 |
|||
| As = 5 |
|||
| Au = 6 |
|||
| B = 7 |
|||
| Bi = 8 |
|||
| Br = 9 |
|||
| Ca = 10 |
|||
| Cl = 11 |
|||
| Co = 12 |
|||
| Cr = 13 |
|||
| F = 14 |
|||
| Fe = 15 |
|||
| Gd = 16 |
|||
| Hg = 17 |
|||
| I = 18 |
|||
| K = 19 |
|||
| Li = 20 |
|||
| Mg = 21 |
|||
| Mn = 22 |
|||
| N = 23 |
|||
| Na = 24 |
|||
| O = 25 |
|||
| P = 26 |
|||
| Pt = 27 |
|||
| S = 28 |
|||
| Sb = 29 |
|||
| Se = 30 |
|||
| Si = 31 |
|||
| Sr = 32 |
|||
| Tc = 33 |
|||
| Zn = 34 |
|||
| charge = -1 |
|||
| molecular_weight = 75 |
|||
| smiles = 76 |
|||
| StdInChI = 77 |
|||
| StdInChI_comment = 78 |
|||
| StdInChI_Ref = 79 |
|||
| StdInChIKey = 80 |
|||
| StdInChIKey_comment = 81 |
|||
| StdInChIKey_Ref = 82 |
|||
| density = 83 |
|||
| melting_point = 84 |
|||
| melting_high = 85 |
|||
| melting_notes = 86 |
|||
| boiling_point = 87 |
|||
| boiling_notes = 88 |
|||
| solubility = 89 |
|||
| specific_rotation = 90 |
|||
| sec_combustion = 91 |
|||
| Verifiedfields = 92 |
|||
| verifiedrevid = 93 |
|||
}} |
|||
== Test all 4 == |
|||
{{Testcase table |
|||
| pronounce = {{IPAc-en|nj|uː|ˈ|m|əʊ|n|i|ə}} |
|||
| drug_name = 1 |
|||
| imagename = 2 |
|||
| type = mab |
|||
| name = testcases |
|||
| image = Simple shapes example.png |
|||
| width = 175px |
|||
| alt = an example image |
|||
| image2 = Nocover.svg |
|||
| width2 = 150px |
|||
| alt2 = another example image |
|||
| caption = some images |
|||
| IUPAC_name = 12 |
|||
| target = 13 |
|||
| vaccine_type = Toxoid |
|||
| mab_type = F(ab')2 |
|||
| source = xi/a |
|||
| component1 = 17 |
|||
| class1 = 18 |
|||
| component2 = 19 |
|||
| class2 = 20 |
|||
| component3 = 21 |
|||
| class3 = 22 |
|||
| component4 = 23 |
|||
| class4 = 24 |
|||
| tradename = 25 |
|||
| ASHP = 26 |
|||
| Drugs.com = 27 |
|||
| eMedicine = 28 |
|||
| MedlinePlus = 29 |
|||
| licence_EU = 30 |
|||
| licence_US = 31 |
|||
| DailyMedID = 32 |
|||
| pregnancy_AU = B3 |
|||
| pregnancy_US = C |
|||
| pregnancy_category = 35 |
|||
| legal_AU = S4 |
|||
| legal_CA = Schedule IV |
|||
| legal_UK = POM |
|||
| legal_US = Schedule III |
|||
| legal_UN = N II III |
|||
| legal_EU = Category 2 Precursor |
|||
| legal_status = RX |
|||
| dependency_liability = 43 |
|||
| addiction_liability = 43b |
|||
| routes_of_administration = 44 |
|||
| bioavailability = 45 |
|||
| protein_bound = 46 |
|||
| metabolism = 47 |
|||
| onset = 47.5 |
|||
| elimination_half-life = 48 |
|||
| excretion = 49 |
|||
| CAS_number = 50 |
|||
| CAS_number_Ref = 51 |
|||
| CAS_supplemental = 52 |
|||
| ATCvet = 53 |
|||
| ATC_prefix = 54 |
|||
| ATC_suffix = 55 |
|||
| ATC_supplemental = 56 |
|||
| PubChem = 57 |
|||
| PubChemSubstance = 58 |
|||
| IUPHAR_ligand = 59 |
|||
| DrugBank = 60 |
|||
| ChemSpiderID = 61 |
|||
| ChemSpiderID_Ref = 62 |
|||
| UNII = 63 |
|||
| UNII_Ref = 64 |
|||
| KEGG = 65 |
|||
| KEGG_Ref = 66 |
|||
| ChEBI = 67 |
|||
| ChEBI_Ref = 68 |
|||
| ChEMBL = 69 |
|||
| ChEMBL_Ref = 70 |
|||
| NIAID_ChemDB = 71 |
|||
| synonyms = 72 |
|||
| PDB_ligand = 73 |
|||
| chemical_formula = 74 <!-- overrides next set of parameters --> |
|||
| C = 1 |
|||
| H = 2 |
|||
| Ag = 3 |
|||
| Al = 4 |
|||
| As = 5 |
|||
| Au = 6 |
|||
| B = 7 |
|||
| Bi = 8 |
|||
| Br = 9 |
|||
| Ca = 10 |
|||
| Cl = 11 |
|||
| Co = 12 |
|||
| Cr = 13 |
|||
| F = 14 |
|||
| Fe = 15 |
|||
| Gd = 16 |
|||
| Hg = 17 |
|||
| I = 18 |
|||
| K = 19 |
|||
| Li = 20 |
|||
| Mg = 21 |
|||
| Mn = 22 |
|||
| N = 23 |
|||
| Na = 24 |
|||
| O = 25 |
|||
| P = 26 |
|||
| Pt = 27 |
|||
| S = 28 |
|||
| Sb = 29 |
|||
| Se = 30 |
|||
| Si = 31 |
|||
| Sr = 32 |
|||
| Tc = 33 |
|||
| Zn = 34 |
|||
| charge = -1 |
|||
| molecular_weight = 75 |
|||
| smiles = 76 |
|||
| StdInChI = 77 |
|||
| StdInChI_comment = 78 |
|||
| StdInChI_Ref = 79 |
|||
| StdInChIKey = 80 |
|||
| StdInChIKey_comment = 81 |
|||
| StdInChIKey_Ref = 82 |
|||
| density = 83 |
|||
| melting_point = 84 |
|||
| melting_high = 85 |
|||
| melting_notes = 86 |
|||
| boiling_point = 87 |
|||
| boiling_notes = 88 |
|||
| solubility = 89 |
|||
| specific_rotation = 90 |
|||
| sec_combustion = 91 |
|||
| Verifiedfields = 92 |
|||
| verifiedrevid = 93 |
|||
}} |
|||
== Test formula 1 == |
|||
{{Testcase table |
|||
| pronounce = {{IPAc-en|nj|uː|ˈ|m|əʊ|n|i|ə}} |
|||
| drug_name = 1 |
|||
| imagename = 2 |
|||
| type = 3 |
|||
| name = testcases |
|||
| image = Simple shapes example.png |
|||
| width = 175px |
|||
| alt = an example image |
|||
| image2 = Nocover.svg |
|||
| width2 = 150px |
|||
| alt2 = another example image |
|||
| caption = some images |
|||
| IUPAC_name = 12 |
|||
| target = 13 |
|||
| vaccine_type = Toxoid |
|||
| mab_type = F(ab')2 |
|||
| source = xi/a |
|||
| component1 = 17 |
|||
| class1 = 18 |
|||
| component2 = 19 |
|||
| class2 = 20 |
|||
| component3 = 21 |
|||
| class3 = 22 |
|||
| component4 = 23 |
|||
| class4 = 24 |
|||
| tradename = 25 |
|||
| ASHP = 26 |
|||
| Drugs.com = 27 |
|||
| eMedicine = 28 |
|||
| MedlinePlus = 29 |
|||
| licence_EU = 30 |
|||
| licence_US = 31 |
|||
| DailyMedID = 32 |
|||
| pregnancy_AU = B3 |
|||
| pregnancy_US = C |
|||
| pregnancy_category = 35 |
|||
| legal_AU = S4 |
|||
| legal_CA = Schedule IV |
|||
| legal_UK = POM |
|||
| legal_US = Schedule III |
|||
| legal_UN = N II III |
|||
| legal_EU = Category 2 Precursor |
|||
| legal_status = RX |
|||
| dependency_liability = 43 |
|||
| routes_of_administration = 44 |
|||
| bioavailability = 45 |
|||
| protein_bound = 46 |
|||
| metabolism = 47 |
|||
| onset = 47.5 |
|||
| elimination_half-life = 48 |
|||
| excretion = 49 |
|||
| CAS_number = 50 |
|||
| CAS_number_Ref = 51 |
|||
| CAS_supplemental = 52 |
|||
| ATCvet = 53 |
|||
| ATC_prefix = 54 |
|||
| ATC_suffix = 55 |
|||
| ATC_supplemental = 56 |
|||
| PubChem = 57 |
|||
| PubChemSubstance = 58 |
|||
| IUPHAR_ligand = 59 |
|||
| DrugBank = 60 |
|||
| ChemSpiderID = 61 |
|||
| ChemSpiderID_Ref = 62 |
|||
| UNII = 63 |
|||
| UNII_Ref = 64 |
|||
| KEGG = 65 |
|||
| KEGG_Ref = 66 |
|||
| ChEBI = 67 |
|||
| ChEBI_Ref = 68 |
|||
| ChEMBL = 69 |
|||
| ChEMBL_Ref = 70 |
|||
| NIAID_ChemDB = 71 |
|||
| synonyms = 72 |
|||
| PDB_ligand = 73 |
|||
| chemical_formula = |
|||
| C = 1 |
|||
| H = 2 |
|||
| Ag = 3 |
|||
| Al = 4 |
|||
| As = 5 |
|||
| Au = 6 |
|||
| B = 7 |
|||
| Bi = 8 |
|||
| charge = -1 |
|||
| molecular_weight = 75 |
|||
| smiles = 76 |
|||
| StdInChI = 77 |
|||
| StdInChI_comment = 78 |
|||
| StdInChI_Ref = 79 |
|||
| StdInChIKey = 80 |
|||
| StdInChIKey_comment = 81 |
|||
| StdInChIKey_Ref = 82 |
|||
| density = 83 |
|||
| melting_point = 84 |
|||
| melting_high = 85 |
|||
| melting_notes = 86 |
|||
| boiling_point = 87 |
|||
| boiling_notes = 88 |
|||
| solubility = 89 |
|||
| specific_rotation = 90 |
|||
| sec_combustion = 91 |
|||
| Verifiedfields = 92 |
|||
| verifiedrevid = 93 |
|||
}} |
|||
== Test formula 2 == |
|||
{{Testcase table |
|||
| pronounce = {{IPAc-en|nj|uː|ˈ|m|əʊ|n|i|ə}} |
|||
| drug_name = 1 |
|||
| imagename = 2 |
|||
| type = 3 |
|||
| name = testcases |
|||
| image = Simple shapes example.png |
|||
| width = 175px |
|||
| alt = an example image |
|||
| image2 = Nocover.svg |
|||
| width2 = 150px |
|||
| alt2 = another example image |
|||
| caption = some images |
|||
| IUPAC_name = 12 |
|||
| target = 13 |
|||
| vaccine_type = Toxoid |
|||
| mab_type = F(ab')2 |
|||
| source = xi/a |
|||
| component1 = 17 |
|||
| class1 = 18 |
|||
| component2 = 19 |
|||
| class2 = 20 |
|||
| component3 = 21 |
|||
| class3 = 22 |
|||
| component4 = 23 |
|||
| class4 = 24 |
|||
| tradename = 25 |
|||
| ASHP = 26 |
|||
| Drugs.com = 27 |
|||
| eMedicine = 28 |
|||
| MedlinePlus = 29 |
|||
| licence_EU = 30 |
|||
| licence_US = 31 |
|||
| DailyMedID = 32 |
|||
| pregnancy_AU = B3 |
|||
| pregnancy_US = C |
|||
| pregnancy_category = 35 |
|||
| legal_AU = S4 |
|||
| legal_CA = Schedule IV |
|||
| legal_UK = POM |
|||
| legal_US = Schedule III |
|||
| legal_UN = N II III |
|||
| legal_EU = Category 2 Precursor |
|||
| legal_status = RX |
|||
| dependency_liability = 43 |
|||
| routes_of_administration = 44 |
|||
| bioavailability = 45 |
|||
| protein_bound = 46 |
|||
| metabolism = 47 |
|||
| onset = 47.5 |
|||
| elimination_half-life = 48 |
|||
| excretion = 49 |
|||
| CAS_number = 50 |
|||
| CAS_number_Ref = 51 |
|||
| CAS_supplemental = 52 |
|||
| ATCvet = 53 |
|||
| ATC_prefix = 54 |
|||
| ATC_suffix = 55 |
|||
| ATC_supplemental = 56 |
|||
| PubChem = 57 |
|||
| PubChemSubstance = 58 |
|||
| IUPHAR_ligand = 59 |
|||
| DrugBank = 60 |
|||
| ChemSpiderID = 61 |
|||
| ChemSpiderID_Ref = 62 |
|||
| UNII = 63 |
|||
| UNII_Ref = 64 |
|||
| KEGG = 65 |
|||
| KEGG_Ref = 66 |
|||
| ChEBI = 67 |
|||
| ChEBI_Ref = 68 |
|||
| ChEMBL = 69 |
|||
| ChEMBL_Ref = 70 |
|||
| NIAID_ChemDB = 71 |
|||
| synonyms = 72 |
|||
| PDB_ligand = 73 |
|||
| chemical_formula = |
|||
| C = 1 |
|||
| Br = 9 |
|||
| Ca = 10 |
|||
| Cl = 11 |
|||
| Co = 12 |
|||
| Cr = 13 |
|||
| F = 14 |
|||
| Fe = 15 |
|||
| Gd = 16 |
|||
| Hg = 17 |
|||
| charge = -1 |
|||
| molecular_weight = 75 |
|||
| smiles = 76 |
|||
| StdInChI = 77 |
|||
| StdInChI_comment = 78 |
|||
| StdInChI_Ref = 79 |
|||
| StdInChIKey = 80 |
|||
| StdInChIKey_comment = 81 |
|||
| StdInChIKey_Ref = 82 |
|||
| density_notes = note83 |
|||
| melting_point = 84 |
|||
| melting_high = 85 |
|||
| melting_notes = 86 |
|||
| boiling_point = 87 |
|||
| boiling_notes = 88 |
|||
| solubility = 89 |
|||
| specific_rotation = 90 |
|||
| sec_combustion = 91 |
|||
| Verifiedfields = 92 |
|||
| verifiedrevid = 93 |
|||
}} |
|||
== Test formula 3 == |
|||
{{Testcase table |
|||
| pronounce = {{IPAc-en|nj|uː|ˈ|m|əʊ|n|i|ə}} |
|||
| drug_name = 1 |
|||
| imagename = 2 |
|||
| type = 3 |
|||
| name = testcases |
|||
| image = Simple shapes example.png |
|||
| width = 175px |
|||
| alt = an example image |
|||
| image2 = Nocover.svg |
|||
| width2 = 150px |
|||
| alt2 = another example image |
|||
| caption = some images |
|||
| IUPAC_name = 12 |
|||
| target = 13 |
|||
| vaccine_type = Toxoid |
|||
| mab_type = F(ab')2 |
|||
| source = xi/a |
|||
| component1 = 17 |
|||
| class1 = 18 |
|||
| component2 = 19 |
|||
| class2 = 20 |
|||
| component3 = 21 |
|||
| class3 = 22 |
|||
| component4 = 23 |
|||
| class4 = 24 |
|||
| tradename = 25 |
|||
| ASHP = 26 |
|||
| Drugs.com = 27 |
|||
| eMedicine = 28 |
|||
| MedlinePlus = 29 |
|||
| licence_EU = 30 |
|||
| licence_US = 31 |
|||
| DailyMedID = 32 |
|||
| pregnancy_AU = B3 |
|||
| pregnancy_US = C |
|||
| pregnancy_category = 35 |
|||
| legal_AU = S4 |
|||
| legal_CA = Schedule IV |
|||
| legal_UK = POM |
|||
| legal_US = Schedule III |
|||
| legal_UN = N II III |
|||
| legal_EU = Category 2 Precursor |
|||
| legal_status = RX |
|||
| dependency_liability = 43 |
|||
| routes_of_administration = 44 |
|||
| bioavailability = 45 |
|||
| protein_bound = 46 |
|||
| metabolism = 47 |
|||
| onset = 47.5 |
|||
| elimination_half-life = 48 |
|||
| excretion = 49 |
|||
| CAS_number = 50 |
|||
| CAS_number_Ref = 51 |
|||
| CAS_supplemental = 52 |
|||
| ATCvet = 53 |
|||
| ATC_prefix = 54 |
|||
| ATC_suffix = 55 |
|||
| ATC_supplemental = 56 |
|||
| PubChem = 57 |
|||
| PubChemSubstance = 58 |
|||
| IUPHAR_ligand = 59 |
|||
| DrugBank = 60 |
|||
| ChemSpiderID = 61 |
|||
| ChemSpiderID_Ref = 62 |
|||
| UNII = 63 |
|||
| UNII_Ref = 64 |
|||
| KEGG = 65 |
|||
| KEGG_Ref = 66 |
|||
| ChEBI = 67 |
|||
| ChEBI_Ref = 68 |
|||
| ChEMBL = 69 |
|||
| ChEMBL_Ref = 70 |
|||
| NIAID_ChemDB = 71 |
|||
| synonyms = 72 |
|||
| PDB_ligand = 73 |
|||
| chemical_formula = |
|||
| I = 18 |
|||
| K = 19 |
|||
| Li = 20 |
|||
| Mg = 21 |
|||
| Mn = 22 |
|||
| N = 23 |
|||
| Na = 24 |
|||
| O = 25 |
|||
| P = 26 |
|||
| Pt = 27 |
|||
| charge = -1 |
|||
| molecular_weight = 75 |
|||
| smiles = 76 |
|||
| StdInChI = 77 |
|||
| StdInChI_comment = 78 |
|||
| StdInChI_Ref = 79 |
|||
| StdInChIKey = 80 |
|||
| StdInChIKey_comment = 81 |
|||
| StdInChIKey_Ref = 82 |
|||
| density = 83 |
|||
| melting_point = 84 |
|||
| melting_high = 85 |
|||
| melting_notes = 86 |
|||
| boiling_point = 87 |
|||
| boiling_notes = 88 |
|||
| solubility = 89 |
|||
| specific_rotation = 90 |
|||
| sec_combustion = 91 |
|||
| Verifiedfields = 92 |
|||
| verifiedrevid = 93 |
|||
}} |
|||
== Test formula 4 == |
|||
{{Testcase table |
|||
| pronounce = {{IPAc-en|nj|uː|ˈ|m|əʊ|n|i|ə}} |
|||
| drug_name = 1 |
|||
| imagename = 2 |
|||
| type = 3 |
|||
| name = testcases |
|||
| image = Simple shapes example.png |
|||
| width = 175px |
|||
| alt = an example image |
|||
| image2 = Nocover.svg |
|||
| width2 = 150px |
|||
| alt2 = another example image |
|||
| caption = some images |
|||
| IUPAC_name = 12 |
|||
| target = 13 |
|||
| vaccine_type = Toxoid |
|||
| mab_type = F(ab')2 |
|||
| source = xi/a |
|||
| component1 = 17 |
|||
| class1 = 18 |
|||
| component2 = 19 |
|||
| class2 = 20 |
|||
| component3 = 21 |
|||
| class3 = 22 |
|||
| component4 = 23 |
|||
| class4 = 24 |
|||
| tradename = 25 |
|||
| ASHP = 26 |
|||
| Drugs.com = 27 |
|||
| eMedicine = 28 |
|||
| MedlinePlus = 29 |
|||
| licence_EU = 30 |
|||
| licence_US = 31 |
|||
| DailyMedID = 32 |
|||
| pregnancy_AU = B3 |
|||
| pregnancy_US = C |
|||
| pregnancy_category = 35 |
|||
| legal_AU = S4 |
|||
| legal_CA = Schedule IV |
|||
| legal_UK = POM |
|||
| legal_US = Schedule III |
|||
| legal_UN = N II III |
|||
| legal_EU = Category 2 Precursor |
|||
| legal_status = RX |
|||
| dependency_liability = 43 |
|||
| routes_of_administration = 44 |
|||
| bioavailability = 45 |
|||
| protein_bound = 46 |
|||
| metabolism = 47 |
|||
| onset = 47.5 |
|||
| elimination_half-life = 48 |
|||
| excretion = 49 |
|||
| CAS_number = 50 |
|||
| CAS_number_Ref = 51 |
|||
| CAS_supplemental = 52 |
|||
| ATCvet = 53 |
|||
| ATC_prefix = 54 |
|||
| ATC_suffix = 55 |
|||
| ATC_supplemental = 56 |
|||
| PubChem = 57 |
|||
| PubChemSubstance = 58 |
|||
| IUPHAR_ligand = 59 |
|||
| DrugBank = 60 |
|||
| ChemSpiderID = 61 |
|||
| ChemSpiderID_Ref = 62 |
|||
| UNII = 63 |
|||
| UNII_Ref = 64 |
|||
| KEGG = 65 |
|||
| KEGG_Ref = 66 |
|||
| ChEBI = 67 |
|||
| ChEBI_Ref = 68 |
|||
| ChEMBL = 69 |
|||
| ChEMBL_Ref = 70 |
|||
| NIAID_ChemDB = 71 |
|||
| synonyms = 72 |
|||
| PDB_ligand = 73 |
|||
| chemical_formula = |
|||
| S = 28 |
|||
| Sb = 29 |
|||
| Se = 30 |
|||
| Si = 31 |
|||
| Sr = 32 |
|||
| Tc = 33 |
|||
| Zn = 34 |
|||
| charge = -1 |
|||
| molecular_weight = 75 |
|||
| smiles = 76 |
|||
| StdInChI = 77 |
|||
| StdInChI_comment = 78 |
|||
| StdInChI_Ref = 79 |
|||
| StdInChIKey = 80 |
|||
| StdInChIKey_comment = 81 |
|||
| StdInChIKey_Ref = 82 |
|||
| density = 83 |
|||
| melting_point = 84 |
|||
| melting_high = 85 |
|||
| melting_notes = 86 |
|||
| boiling_point = 87 |
|||
| boiling_notes = 88 |
|||
| solubility = 89 |
|||
| specific_rotation = 90 |
|||
| sec_combustion = 91 |
|||
| Verifiedfields = 92 |
|||
| verifiedrevid = 93 |
|||
}} |